2015-05-17 16:10:35 +00:00
|
|
|
<?php
|
2015-05-20 18:17:17 +00:00
|
|
|
|
|
|
|
/** PHPExcel root directory */
|
|
|
|
if (!defined('PHPEXCEL_ROOT')) {
|
|
|
|
/**
|
|
|
|
* @ignore
|
|
|
|
*/
|
|
|
|
define('PHPEXCEL_ROOT', dirname(__FILE__) . '/../../');
|
|
|
|
require(PHPEXCEL_ROOT . 'PHPExcel/Autoloader.php');
|
|
|
|
}
|
|
|
|
|
2015-05-17 16:10:35 +00:00
|
|
|
/**
|
2015-05-20 18:17:17 +00:00
|
|
|
* PHPExcel_Reader_Excel5
|
2015-05-17 16:10:35 +00:00
|
|
|
*
|
|
|
|
* Copyright (c) 2006 - 2015 PHPExcel
|
|
|
|
*
|
|
|
|
* This library is free software; you can redistribute it and/or
|
|
|
|
* modify it under the terms of the GNU Lesser General Public
|
|
|
|
* License as published by the Free Software Foundation; either
|
|
|
|
* version 2.1 of the License, or (at your option) any later version.
|
|
|
|
*
|
|
|
|
* This library is distributed in the hope that it will be useful,
|
|
|
|
* but WITHOUT ANY WARRANTY; without even the implied warranty of
|
|
|
|
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
|
|
|
|
* Lesser General Public License for more details.
|
|
|
|
*
|
|
|
|
* You should have received a copy of the GNU Lesser General Public
|
|
|
|
* License along with this library; if not, write to the Free Software
|
|
|
|
* Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA
|
|
|
|
*
|
|
|
|
* @category PHPExcel
|
|
|
|
* @package PHPExcel_Reader_Excel5
|
|
|
|
* @copyright Copyright (c) 2006 - 2015 PHPExcel (http://www.codeplex.com/PHPExcel)
|
|
|
|
* @license http://www.gnu.org/licenses/old-licenses/lgpl-2.1.txt LGPL
|
|
|
|
* @version ##VERSION##, ##DATE##
|
|
|
|
*/
|
|
|
|
|
|
|
|
// Original file header of ParseXL (used as the base for this class):
|
|
|
|
// --------------------------------------------------------------------------------
|
|
|
|
// Adapted from Excel_Spreadsheet_Reader developed by users bizon153,
|
|
|
|
// trex005, and mmp11 (SourceForge.net)
|
|
|
|
// http://sourceforge.net/projects/phpexcelreader/
|
|
|
|
// Primary changes made by canyoncasa (dvc) for ParseXL 1.00 ...
|
|
|
|
// Modelled moreso after Perl Excel Parse/Write modules
|
|
|
|
// Added Parse_Excel_Spreadsheet object
|
|
|
|
// Reads a whole worksheet or tab as row,column array or as
|
|
|
|
// associated hash of indexed rows and named column fields
|
|
|
|
// Added variables for worksheet (tab) indexes and names
|
|
|
|
// Added an object call for loading individual woorksheets
|
|
|
|
// Changed default indexing defaults to 0 based arrays
|
|
|
|
// Fixed date/time and percent formats
|
|
|
|
// Includes patches found at SourceForge...
|
|
|
|
// unicode patch by nobody
|
|
|
|
// unpack("d") machine depedency patch by matchy
|
|
|
|
// boundsheet utf16 patch by bjaenichen
|
|
|
|
// Renamed functions for shorter names
|
|
|
|
// General code cleanup and rigor, including <80 column width
|
|
|
|
// Included a testcase Excel file and PHP example calls
|
|
|
|
// Code works for PHP 5.x
|
|
|
|
|
|
|
|
// Primary changes made by canyoncasa (dvc) for ParseXL 1.10 ...
|
|
|
|
// http://sourceforge.net/tracker/index.php?func=detail&aid=1466964&group_id=99160&atid=623334
|
|
|
|
// Decoding of formula conditions, results, and tokens.
|
|
|
|
// Support for user-defined named cells added as an array "namedcells"
|
|
|
|
// Patch code for user-defined named cells supports single cells only.
|
|
|
|
// NOTE: this patch only works for BIFF8 as BIFF5-7 use a different
|
|
|
|
// external sheet reference structure
|
|
|
|
class PHPExcel_Reader_Excel5 extends PHPExcel_Reader_Abstract implements PHPExcel_Reader_IReader
|
|
|
|
{
|
|
|
|
// ParseXL definitions
|
|
|
|
const XLS_BIFF8 = 0x0600;
|
|
|
|
const XLS_BIFF7 = 0x0500;
|
|
|
|
const XLS_WorkbookGlobals = 0x0005;
|
|
|
|
const XLS_Worksheet = 0x0010;
|
|
|
|
|
|
|
|
// record identifiers
|
|
|
|
const XLS_Type_FORMULA = 0x0006;
|
|
|
|
const XLS_Type_EOF = 0x000a;
|
|
|
|
const XLS_Type_PROTECT = 0x0012;
|
|
|
|
const XLS_Type_OBJECTPROTECT = 0x0063;
|
|
|
|
const XLS_Type_SCENPROTECT = 0x00dd;
|
|
|
|
const XLS_Type_PASSWORD = 0x0013;
|
|
|
|
const XLS_Type_HEADER = 0x0014;
|
|
|
|
const XLS_Type_FOOTER = 0x0015;
|
|
|
|
const XLS_Type_EXTERNSHEET = 0x0017;
|
|
|
|
const XLS_Type_DEFINEDNAME = 0x0018;
|
|
|
|
const XLS_Type_VERTICALPAGEBREAKS = 0x001a;
|
|
|
|
const XLS_Type_HORIZONTALPAGEBREAKS = 0x001b;
|
|
|
|
const XLS_Type_NOTE = 0x001c;
|
|
|
|
const XLS_Type_SELECTION = 0x001d;
|
|
|
|
const XLS_Type_DATEMODE = 0x0022;
|
|
|
|
const XLS_Type_EXTERNNAME = 0x0023;
|
|
|
|
const XLS_Type_LEFTMARGIN = 0x0026;
|
|
|
|
const XLS_Type_RIGHTMARGIN = 0x0027;
|
|
|
|
const XLS_Type_TOPMARGIN = 0x0028;
|
|
|
|
const XLS_Type_BOTTOMMARGIN = 0x0029;
|
|
|
|
const XLS_Type_PRINTGRIDLINES = 0x002b;
|
|
|
|
const XLS_Type_FILEPASS = 0x002f;
|
|
|
|
const XLS_Type_FONT = 0x0031;
|
|
|
|
const XLS_Type_CONTINUE = 0x003c;
|
|
|
|
const XLS_Type_PANE = 0x0041;
|
|
|
|
const XLS_Type_CODEPAGE = 0x0042;
|
|
|
|
const XLS_Type_DEFCOLWIDTH = 0x0055;
|
|
|
|
const XLS_Type_OBJ = 0x005d;
|
|
|
|
const XLS_Type_COLINFO = 0x007d;
|
|
|
|
const XLS_Type_IMDATA = 0x007f;
|
|
|
|
const XLS_Type_SHEETPR = 0x0081;
|
|
|
|
const XLS_Type_HCENTER = 0x0083;
|
|
|
|
const XLS_Type_VCENTER = 0x0084;
|
|
|
|
const XLS_Type_SHEET = 0x0085;
|
|
|
|
const XLS_Type_PALETTE = 0x0092;
|
|
|
|
const XLS_Type_SCL = 0x00a0;
|
|
|
|
const XLS_Type_PAGESETUP = 0x00a1;
|
|
|
|
const XLS_Type_MULRK = 0x00bd;
|
|
|
|
const XLS_Type_MULBLANK = 0x00be;
|
|
|
|
const XLS_Type_DBCELL = 0x00d7;
|
|
|
|
const XLS_Type_XF = 0x00e0;
|
|
|
|
const XLS_Type_MERGEDCELLS = 0x00e5;
|
|
|
|
const XLS_Type_MSODRAWINGGROUP = 0x00eb;
|
|
|
|
const XLS_Type_MSODRAWING = 0x00ec;
|
|
|
|
const XLS_Type_SST = 0x00fc;
|
|
|
|
const XLS_Type_LABELSST = 0x00fd;
|
|
|
|
const XLS_Type_EXTSST = 0x00ff;
|
|
|
|
const XLS_Type_EXTERNALBOOK = 0x01ae;
|
|
|
|
const XLS_Type_DATAVALIDATIONS = 0x01b2;
|
|
|
|
const XLS_Type_TXO = 0x01b6;
|
|
|
|
const XLS_Type_HYPERLINK = 0x01b8;
|
|
|
|
const XLS_Type_DATAVALIDATION = 0x01be;
|
|
|
|
const XLS_Type_DIMENSION = 0x0200;
|
|
|
|
const XLS_Type_BLANK = 0x0201;
|
|
|
|
const XLS_Type_NUMBER = 0x0203;
|
|
|
|
const XLS_Type_LABEL = 0x0204;
|
|
|
|
const XLS_Type_BOOLERR = 0x0205;
|
|
|
|
const XLS_Type_STRING = 0x0207;
|
|
|
|
const XLS_Type_ROW = 0x0208;
|
|
|
|
const XLS_Type_INDEX = 0x020b;
|
|
|
|
const XLS_Type_ARRAY = 0x0221;
|
|
|
|
const XLS_Type_DEFAULTROWHEIGHT = 0x0225;
|
|
|
|
const XLS_Type_WINDOW2 = 0x023e;
|
|
|
|
const XLS_Type_RK = 0x027e;
|
|
|
|
const XLS_Type_STYLE = 0x0293;
|
|
|
|
const XLS_Type_FORMAT = 0x041e;
|
|
|
|
const XLS_Type_SHAREDFMLA = 0x04bc;
|
|
|
|
const XLS_Type_BOF = 0x0809;
|
|
|
|
const XLS_Type_SHEETPROTECTION = 0x0867;
|
|
|
|
const XLS_Type_RANGEPROTECTION = 0x0868;
|
|
|
|
const XLS_Type_SHEETLAYOUT = 0x0862;
|
|
|
|
const XLS_Type_XFEXT = 0x087d;
|
|
|
|
const XLS_Type_PAGELAYOUTVIEW = 0x088b;
|
|
|
|
const XLS_Type_UNKNOWN = 0xffff;
|
|
|
|
|
|
|
|
// Encryption type
|
|
|
|
const MS_BIFF_CRYPTO_NONE = 0;
|
|
|
|
const MS_BIFF_CRYPTO_XOR = 1;
|
|
|
|
const MS_BIFF_CRYPTO_RC4 = 2;
|
|
|
|
|
|
|
|
// Size of stream blocks when using RC4 encryption
|
|
|
|
const REKEY_BLOCK = 0x400;
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Summary Information stream data.
|
|
|
|
*
|
|
|
|
* @var string
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private $summaryInformation;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
/**
|
|
|
|
* Extended Summary Information stream data.
|
|
|
|
*
|
|
|
|
* @var string
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private $documentSummaryInformation;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
/**
|
|
|
|
* User-Defined Properties stream data.
|
|
|
|
*
|
|
|
|
* @var string
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private $userDefinedProperties;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
/**
|
|
|
|
* Workbook stream data. (Includes workbook globals substream as well as sheet substreams)
|
|
|
|
*
|
|
|
|
* @var string
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private $data;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
/**
|
2015-05-20 18:17:17 +00:00
|
|
|
* Size in bytes of $this->data
|
2015-05-17 16:10:35 +00:00
|
|
|
*
|
|
|
|
* @var int
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private $dataSize;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
/**
|
|
|
|
* Current position in stream
|
|
|
|
*
|
|
|
|
* @var integer
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private $pos;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
/**
|
|
|
|
* Workbook to be returned by the reader.
|
|
|
|
*
|
|
|
|
* @var PHPExcel
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private $phpExcel;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
/**
|
|
|
|
* Worksheet that is currently being built by the reader.
|
|
|
|
*
|
|
|
|
* @var PHPExcel_Worksheet
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private $phpSheet;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
/**
|
|
|
|
* BIFF version
|
|
|
|
*
|
|
|
|
* @var int
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private $version;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
/**
|
|
|
|
* Codepage set in the Excel file being read. Only important for BIFF5 (Excel 5.0 - Excel 95)
|
|
|
|
* For BIFF8 (Excel 97 - Excel 2003) this will always have the value 'UTF-16LE'
|
|
|
|
*
|
|
|
|
* @var string
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private $codepage;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
/**
|
|
|
|
* Shared formats
|
|
|
|
*
|
|
|
|
* @var array
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private $formats;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
/**
|
|
|
|
* Shared fonts
|
|
|
|
*
|
|
|
|
* @var array
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private $objFonts;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
/**
|
|
|
|
* Color palette
|
|
|
|
*
|
|
|
|
* @var array
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private $palette;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
/**
|
|
|
|
* Worksheets
|
|
|
|
*
|
|
|
|
* @var array
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private $sheets;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
/**
|
|
|
|
* External books
|
|
|
|
*
|
|
|
|
* @var array
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private $externalBooks;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
/**
|
|
|
|
* REF structures. Only applies to BIFF8.
|
|
|
|
*
|
|
|
|
* @var array
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private $ref;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
/**
|
|
|
|
* External names
|
|
|
|
*
|
|
|
|
* @var array
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private $externalNames;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
/**
|
|
|
|
* Defined names
|
|
|
|
*
|
|
|
|
* @var array
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private $definedname;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
/**
|
|
|
|
* Shared strings. Only applies to BIFF8.
|
|
|
|
*
|
|
|
|
* @var array
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private $sst;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
/**
|
|
|
|
* Panes are frozen? (in sheet currently being read). See WINDOW2 record.
|
|
|
|
*
|
|
|
|
* @var boolean
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private $frozen;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
/**
|
|
|
|
* Fit printout to number of pages? (in sheet currently being read). See SHEETPR record.
|
|
|
|
*
|
|
|
|
* @var boolean
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private $isFitToPages;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
/**
|
|
|
|
* Objects. One OBJ record contributes with one entry.
|
|
|
|
*
|
|
|
|
* @var array
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private $objs;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
/**
|
|
|
|
* Text Objects. One TXO record corresponds with one entry.
|
|
|
|
*
|
|
|
|
* @var array
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private $textObjects;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
/**
|
|
|
|
* Cell Annotations (BIFF8)
|
|
|
|
*
|
|
|
|
* @var array
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private $cellNotes;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
/**
|
|
|
|
* The combined MSODRAWINGGROUP data
|
|
|
|
*
|
|
|
|
* @var string
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private $drawingGroupData;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
/**
|
|
|
|
* The combined MSODRAWING data (per sheet)
|
|
|
|
*
|
|
|
|
* @var string
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private $drawingData;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
/**
|
|
|
|
* Keep track of XF index
|
|
|
|
*
|
|
|
|
* @var int
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private $xfIndex;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
/**
|
|
|
|
* Mapping of XF index (that is a cell XF) to final index in cellXf collection
|
|
|
|
*
|
|
|
|
* @var array
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private $mapCellXfIndex;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
/**
|
|
|
|
* Mapping of XF index (that is a style XF) to final index in cellStyleXf collection
|
|
|
|
*
|
|
|
|
* @var array
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private $mapCellStyleXfIndex;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
/**
|
|
|
|
* The shared formulas in a sheet. One SHAREDFMLA record contributes with one value.
|
|
|
|
*
|
|
|
|
* @var array
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private $sharedFormulas;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
/**
|
|
|
|
* The shared formula parts in a sheet. One FORMULA record contributes with one value if it
|
|
|
|
* refers to a shared formula.
|
|
|
|
*
|
|
|
|
* @var array
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private $sharedFormulaParts;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
/**
|
|
|
|
* The type of encryption in use
|
|
|
|
*
|
|
|
|
* @var int
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private $encryption = 0;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
/**
|
|
|
|
* The position in the stream after which contents are encrypted
|
|
|
|
*
|
|
|
|
* @var int
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private $encryptionStartPos = false;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
/**
|
|
|
|
* The current RC4 decryption object
|
|
|
|
*
|
|
|
|
* @var PHPExcel_Reader_Excel5_RC4
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private $rc4Key = null;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
/**
|
|
|
|
* The position in the stream that the RC4 decryption object was left at
|
|
|
|
*
|
|
|
|
* @var int
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private $rc4Pos = 0;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
/**
|
|
|
|
* The current MD5 context state
|
|
|
|
*
|
|
|
|
* @var string
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private $md5Ctxt = null;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
/**
|
|
|
|
* Create a new PHPExcel_Reader_Excel5 instance
|
|
|
|
*/
|
|
|
|
public function __construct()
|
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readFilter = new PHPExcel_Reader_DefaultReadFilter();
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Can the current PHPExcel_Reader_IReader read the file?
|
|
|
|
*
|
|
|
|
* @param string $pFilename
|
|
|
|
* @return boolean
|
|
|
|
* @throws PHPExcel_Reader_Exception
|
|
|
|
*/
|
|
|
|
public function canRead($pFilename)
|
|
|
|
{
|
|
|
|
// Check if file exists
|
|
|
|
if (!file_exists($pFilename)) {
|
|
|
|
throw new PHPExcel_Reader_Exception("Could not open " . $pFilename . " for reading! File does not exist.");
|
|
|
|
}
|
|
|
|
|
|
|
|
try {
|
|
|
|
// Use ParseXL for the hard work.
|
|
|
|
$ole = new PHPExcel_Shared_OLERead();
|
|
|
|
|
|
|
|
// get excel data
|
|
|
|
$res = $ole->read($pFilename);
|
|
|
|
return true;
|
|
|
|
} catch (PHPExcel_Exception $e) {
|
|
|
|
return false;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Reads names of the worksheets from a file, without parsing the whole file to a PHPExcel object
|
|
|
|
*
|
|
|
|
* @param string $pFilename
|
|
|
|
* @throws PHPExcel_Reader_Exception
|
|
|
|
*/
|
|
|
|
public function listWorksheetNames($pFilename)
|
|
|
|
{
|
|
|
|
// Check if file exists
|
|
|
|
if (!file_exists($pFilename)) {
|
|
|
|
throw new PHPExcel_Reader_Exception("Could not open " . $pFilename . " for reading! File does not exist.");
|
|
|
|
}
|
|
|
|
|
|
|
|
$worksheetNames = array();
|
|
|
|
|
|
|
|
// Read the OLE file
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->loadOLE($pFilename);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// total byte size of Excel data (workbook global substream + sheet substreams)
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->dataSize = strlen($this->data);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos = 0;
|
|
|
|
$this->sheets = array();
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// Parse Workbook Global Substream
|
2015-05-20 18:17:17 +00:00
|
|
|
while ($this->pos < $this->dataSize) {
|
|
|
|
$code = self::getInt2d($this->data, $this->pos);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
switch ($code) {
|
|
|
|
case self::XLS_Type_BOF:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readBof();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_SHEET:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readSheet();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_EOF:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readDefault();
|
2015-05-17 16:10:35 +00:00
|
|
|
break 2;
|
|
|
|
default:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readDefault();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
foreach ($this->sheets as $sheet) {
|
2015-05-17 16:10:35 +00:00
|
|
|
if ($sheet['sheetType'] != 0x00) {
|
|
|
|
// 0x00: Worksheet, 0x02: Chart, 0x06: Visual Basic module
|
|
|
|
continue;
|
|
|
|
}
|
|
|
|
|
|
|
|
$worksheetNames[] = $sheet['name'];
|
|
|
|
}
|
|
|
|
|
|
|
|
return $worksheetNames;
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Return worksheet info (Name, Last Column Letter, Last Column Index, Total Rows, Total Columns)
|
|
|
|
*
|
|
|
|
* @param string $pFilename
|
|
|
|
* @throws PHPExcel_Reader_Exception
|
|
|
|
*/
|
|
|
|
public function listWorksheetInfo($pFilename)
|
|
|
|
{
|
|
|
|
// Check if file exists
|
|
|
|
if (!file_exists($pFilename)) {
|
|
|
|
throw new PHPExcel_Reader_Exception("Could not open " . $pFilename . " for reading! File does not exist.");
|
|
|
|
}
|
|
|
|
|
|
|
|
$worksheetInfo = array();
|
|
|
|
|
|
|
|
// Read the OLE file
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->loadOLE($pFilename);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// total byte size of Excel data (workbook global substream + sheet substreams)
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->dataSize = strlen($this->data);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// initialize
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos = 0;
|
|
|
|
$this->sheets = array();
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// Parse Workbook Global Substream
|
2015-05-20 18:17:17 +00:00
|
|
|
while ($this->pos < $this->dataSize) {
|
|
|
|
$code = self::getInt2d($this->data, $this->pos);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
switch ($code) {
|
|
|
|
case self::XLS_Type_BOF:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readBof();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_SHEET:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readSheet();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_EOF:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readDefault();
|
2015-05-17 16:10:35 +00:00
|
|
|
break 2;
|
|
|
|
default:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readDefault();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
// Parse the individual sheets
|
2015-05-20 18:17:17 +00:00
|
|
|
foreach ($this->sheets as $sheet) {
|
2015-05-17 16:10:35 +00:00
|
|
|
if ($sheet['sheetType'] != 0x00) {
|
|
|
|
// 0x00: Worksheet
|
|
|
|
// 0x02: Chart
|
|
|
|
// 0x06: Visual Basic module
|
|
|
|
continue;
|
|
|
|
}
|
|
|
|
|
|
|
|
$tmpInfo = array();
|
|
|
|
$tmpInfo['worksheetName'] = $sheet['name'];
|
|
|
|
$tmpInfo['lastColumnLetter'] = 'A';
|
|
|
|
$tmpInfo['lastColumnIndex'] = 0;
|
|
|
|
$tmpInfo['totalRows'] = 0;
|
|
|
|
$tmpInfo['totalColumns'] = 0;
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos = $sheet['offset'];
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
while ($this->pos <= $this->dataSize - 4) {
|
|
|
|
$code = self::getInt2d($this->data, $this->pos);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
switch ($code) {
|
|
|
|
case self::XLS_Type_RK:
|
|
|
|
case self::XLS_Type_LABELSST:
|
|
|
|
case self::XLS_Type_NUMBER:
|
|
|
|
case self::XLS_Type_FORMULA:
|
|
|
|
case self::XLS_Type_BOOLERR:
|
|
|
|
case self::XLS_Type_LABEL:
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$rowIndex = self::getInt2d($recordData, 0) + 1;
|
|
|
|
$columnIndex = self::getInt2d($recordData, 2);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
$tmpInfo['totalRows'] = max($tmpInfo['totalRows'], $rowIndex);
|
|
|
|
$tmpInfo['lastColumnIndex'] = max($tmpInfo['lastColumnIndex'], $columnIndex);
|
|
|
|
break;
|
|
|
|
case self::XLS_Type_BOF:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readBof();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_EOF:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readDefault();
|
2015-05-17 16:10:35 +00:00
|
|
|
break 2;
|
|
|
|
default:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readDefault();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
$tmpInfo['lastColumnLetter'] = PHPExcel_Cell::stringFromColumnIndex($tmpInfo['lastColumnIndex']);
|
|
|
|
$tmpInfo['totalColumns'] = $tmpInfo['lastColumnIndex'] + 1;
|
|
|
|
|
|
|
|
$worksheetInfo[] = $tmpInfo;
|
|
|
|
}
|
|
|
|
|
|
|
|
return $worksheetInfo;
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Loads PHPExcel from file
|
|
|
|
*
|
|
|
|
* @param string $pFilename
|
|
|
|
* @return PHPExcel
|
|
|
|
* @throws PHPExcel_Reader_Exception
|
|
|
|
*/
|
|
|
|
public function load($pFilename)
|
|
|
|
{
|
|
|
|
// Read the OLE file
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->loadOLE($pFilename);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// Initialisations
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpExcel = new PHPExcel;
|
|
|
|
$this->phpExcel->removeSheetByIndex(0); // remove 1st sheet
|
|
|
|
if (!$this->readDataOnly) {
|
|
|
|
$this->phpExcel->removeCellStyleXfByIndex(0); // remove the default style
|
|
|
|
$this->phpExcel->removeCellXfByIndex(0); // remove the default style
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
// Read the summary information stream (containing meta data)
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readSummaryInformation();
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// Read the Additional document summary information stream (containing application-specific meta data)
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readDocumentSummaryInformation();
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// total byte size of Excel data (workbook global substream + sheet substreams)
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->dataSize = strlen($this->data);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// initialize
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos = 0;
|
|
|
|
$this->codepage = 'CP1252';
|
|
|
|
$this->formats = array();
|
|
|
|
$this->objFonts = array();
|
|
|
|
$this->palette = array();
|
|
|
|
$this->sheets = array();
|
|
|
|
$this->externalBooks = array();
|
|
|
|
$this->ref = array();
|
|
|
|
$this->definedname = array();
|
|
|
|
$this->sst = array();
|
|
|
|
$this->drawingGroupData = '';
|
|
|
|
$this->xfIndex = '';
|
|
|
|
$this->mapCellXfIndex = array();
|
|
|
|
$this->mapCellStyleXfIndex = array();
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// Parse Workbook Global Substream
|
2015-05-20 18:17:17 +00:00
|
|
|
while ($this->pos < $this->dataSize) {
|
|
|
|
$code = self::getInt2d($this->data, $this->pos);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
switch ($code) {
|
|
|
|
case self::XLS_Type_BOF:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readBof();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_FILEPASS:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readFilepass();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_CODEPAGE:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readCodepage();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_DATEMODE:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readDateMode();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_FONT:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readFont();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_FORMAT:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readFormat();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_XF:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readXf();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_XFEXT:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readXfExt();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_STYLE:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readStyle();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_PALETTE:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readPalette();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_SHEET:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readSheet();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_EXTERNALBOOK:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readExternalBook();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_EXTERNNAME:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readExternName();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_EXTERNSHEET:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readExternSheet();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_DEFINEDNAME:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readDefinedName();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_MSODRAWINGGROUP:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readMsoDrawingGroup();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_SST:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readSst();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_EOF:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readDefault();
|
2015-05-17 16:10:35 +00:00
|
|
|
break 2;
|
|
|
|
default:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readDefault();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
// Resolve indexed colors for font, fill, and border colors
|
|
|
|
// Cannot be resolved already in XF record, because PALETTE record comes afterwards
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!$this->readDataOnly) {
|
|
|
|
foreach ($this->objFonts as $objFont) {
|
2015-05-17 16:10:35 +00:00
|
|
|
if (isset($objFont->colorIndex)) {
|
2015-05-20 18:17:17 +00:00
|
|
|
$color = self::readColor($objFont->colorIndex, $this->palette, $this->version);
|
2015-05-17 16:10:35 +00:00
|
|
|
$objFont->getColor()->setRGB($color['rgb']);
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
foreach ($this->phpExcel->getCellXfCollection() as $objStyle) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// fill start and end color
|
|
|
|
$fill = $objStyle->getFill();
|
|
|
|
|
|
|
|
if (isset($fill->startcolorIndex)) {
|
2015-05-20 18:17:17 +00:00
|
|
|
$startColor = self::readColor($fill->startcolorIndex, $this->palette, $this->version);
|
2015-05-17 16:10:35 +00:00
|
|
|
$fill->getStartColor()->setRGB($startColor['rgb']);
|
|
|
|
}
|
|
|
|
if (isset($fill->endcolorIndex)) {
|
2015-05-20 18:17:17 +00:00
|
|
|
$endColor = self::readColor($fill->endcolorIndex, $this->palette, $this->version);
|
2015-05-17 16:10:35 +00:00
|
|
|
$fill->getEndColor()->setRGB($endColor['rgb']);
|
|
|
|
}
|
|
|
|
|
|
|
|
// border colors
|
|
|
|
$top = $objStyle->getBorders()->getTop();
|
|
|
|
$right = $objStyle->getBorders()->getRight();
|
|
|
|
$bottom = $objStyle->getBorders()->getBottom();
|
|
|
|
$left = $objStyle->getBorders()->getLeft();
|
|
|
|
$diagonal = $objStyle->getBorders()->getDiagonal();
|
|
|
|
|
|
|
|
if (isset($top->colorIndex)) {
|
2015-05-20 18:17:17 +00:00
|
|
|
$borderTopColor = self::readColor($top->colorIndex, $this->palette, $this->version);
|
2015-05-17 16:10:35 +00:00
|
|
|
$top->getColor()->setRGB($borderTopColor['rgb']);
|
|
|
|
}
|
|
|
|
if (isset($right->colorIndex)) {
|
2015-05-20 18:17:17 +00:00
|
|
|
$borderRightColor = self::readColor($right->colorIndex, $this->palette, $this->version);
|
2015-05-17 16:10:35 +00:00
|
|
|
$right->getColor()->setRGB($borderRightColor['rgb']);
|
|
|
|
}
|
|
|
|
if (isset($bottom->colorIndex)) {
|
2015-05-20 18:17:17 +00:00
|
|
|
$borderBottomColor = self::readColor($bottom->colorIndex, $this->palette, $this->version);
|
2015-05-17 16:10:35 +00:00
|
|
|
$bottom->getColor()->setRGB($borderBottomColor['rgb']);
|
|
|
|
}
|
|
|
|
if (isset($left->colorIndex)) {
|
2015-05-20 18:17:17 +00:00
|
|
|
$borderLeftColor = self::readColor($left->colorIndex, $this->palette, $this->version);
|
2015-05-17 16:10:35 +00:00
|
|
|
$left->getColor()->setRGB($borderLeftColor['rgb']);
|
|
|
|
}
|
|
|
|
if (isset($diagonal->colorIndex)) {
|
2015-05-20 18:17:17 +00:00
|
|
|
$borderDiagonalColor = self::readColor($diagonal->colorIndex, $this->palette, $this->version);
|
2015-05-17 16:10:35 +00:00
|
|
|
$diagonal->getColor()->setRGB($borderDiagonalColor['rgb']);
|
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
// treat MSODRAWINGGROUP records, workbook-level Escher
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!$this->readDataOnly && $this->drawingGroupData) {
|
2015-05-17 16:10:35 +00:00
|
|
|
$escherWorkbook = new PHPExcel_Shared_Escher();
|
|
|
|
$reader = new PHPExcel_Reader_Excel5_Escher($escherWorkbook);
|
2015-05-20 18:17:17 +00:00
|
|
|
$escherWorkbook = $reader->load($this->drawingGroupData);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// debug Escher stream
|
|
|
|
//$debug = new Debug_Escher(new PHPExcel_Shared_Escher());
|
2015-05-20 18:17:17 +00:00
|
|
|
//$debug->load($this->drawingGroupData);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
// Parse the individual sheets
|
2015-05-20 18:17:17 +00:00
|
|
|
foreach ($this->sheets as $sheet) {
|
2015-05-17 16:10:35 +00:00
|
|
|
if ($sheet['sheetType'] != 0x00) {
|
|
|
|
// 0x00: Worksheet, 0x02: Chart, 0x06: Visual Basic module
|
|
|
|
continue;
|
|
|
|
}
|
|
|
|
|
|
|
|
// check if sheet should be skipped
|
2015-05-20 18:17:17 +00:00
|
|
|
if (isset($this->loadSheetsOnly) && !in_array($sheet['name'], $this->loadSheetsOnly)) {
|
2015-05-17 16:10:35 +00:00
|
|
|
continue;
|
|
|
|
}
|
|
|
|
|
|
|
|
// add sheet to PHPExcel object
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet = $this->phpExcel->createSheet();
|
2015-05-17 16:10:35 +00:00
|
|
|
// Use false for $updateFormulaCellReferences to prevent adjustment of worksheet references in formula
|
|
|
|
// cells... during the load, all formulae should be correct, and we're simply bringing the worksheet
|
|
|
|
// name in line with the formula, not the reverse
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->setTitle($sheet['name'], false);
|
|
|
|
$this->phpSheet->setSheetState($sheet['sheetState']);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos = $sheet['offset'];
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// Initialize isFitToPages. May change after reading SHEETPR record.
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->isFitToPages = false;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// Initialize drawingData
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->drawingData = '';
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// Initialize objs
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->objs = array();
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// Initialize shared formula parts
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->sharedFormulaParts = array();
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// Initialize shared formulas
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->sharedFormulas = array();
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// Initialize text objs
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->textObjects = array();
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// Initialize cell annotations
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->cellNotes = array();
|
2015-05-17 16:10:35 +00:00
|
|
|
$this->textObjRef = -1;
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
while ($this->pos <= $this->dataSize - 4) {
|
|
|
|
$code = self::getInt2d($this->data, $this->pos);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
switch ($code) {
|
|
|
|
case self::XLS_Type_BOF:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readBof();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_PRINTGRIDLINES:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readPrintGridlines();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_DEFAULTROWHEIGHT:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readDefaultRowHeight();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_SHEETPR:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readSheetPr();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_HORIZONTALPAGEBREAKS:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readHorizontalPageBreaks();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_VERTICALPAGEBREAKS:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readVerticalPageBreaks();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_HEADER:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readHeader();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_FOOTER:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readFooter();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_HCENTER:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readHcenter();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_VCENTER:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readVcenter();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_LEFTMARGIN:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readLeftMargin();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_RIGHTMARGIN:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readRightMargin();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_TOPMARGIN:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readTopMargin();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_BOTTOMMARGIN:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readBottomMargin();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_PAGESETUP:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readPageSetup();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_PROTECT:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readProtect();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_SCENPROTECT:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readScenProtect();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_OBJECTPROTECT:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readObjectProtect();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_PASSWORD:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readPassword();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_DEFCOLWIDTH:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readDefColWidth();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_COLINFO:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readColInfo();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_DIMENSION:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readDefault();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_ROW:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readRow();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_DBCELL:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readDefault();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_RK:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readRk();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_LABELSST:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readLabelSst();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_MULRK:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readMulRk();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_NUMBER:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readNumber();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_FORMULA:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readFormula();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_SHAREDFMLA:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readSharedFmla();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_BOOLERR:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readBoolErr();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_MULBLANK:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readMulBlank();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_LABEL:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readLabel();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_BLANK:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readBlank();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_MSODRAWING:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readMsoDrawing();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_OBJ:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readObj();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_WINDOW2:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readWindow2();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_PAGELAYOUTVIEW:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readPageLayoutView();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_SCL:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readScl();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_PANE:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readPane();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_SELECTION:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readSelection();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_MERGEDCELLS:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readMergedCells();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_HYPERLINK:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readHyperLink();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_DATAVALIDATIONS:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readDataValidations();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_DATAVALIDATION:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readDataValidation();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_SHEETLAYOUT:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readSheetLayout();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_SHEETPROTECTION:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readSheetProtection();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_RANGEPROTECTION:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readRangeProtection();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_NOTE:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readNote();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
2015-05-20 18:17:17 +00:00
|
|
|
//case self::XLS_Type_IMDATA: $this->readImData(); break;
|
2015-05-17 16:10:35 +00:00
|
|
|
case self::XLS_Type_TXO:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readTextObject();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_CONTINUE:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readContinue();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Type_EOF:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readDefault();
|
2015-05-17 16:10:35 +00:00
|
|
|
break 2;
|
|
|
|
default:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readDefault();
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
}
|
|
|
|
|
|
|
|
}
|
|
|
|
|
|
|
|
// treat MSODRAWING records, sheet-level Escher
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!$this->readDataOnly && $this->drawingData) {
|
2015-05-17 16:10:35 +00:00
|
|
|
$escherWorksheet = new PHPExcel_Shared_Escher();
|
|
|
|
$reader = new PHPExcel_Reader_Excel5_Escher($escherWorksheet);
|
2015-05-20 18:17:17 +00:00
|
|
|
$escherWorksheet = $reader->load($this->drawingData);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// debug Escher stream
|
|
|
|
//$debug = new Debug_Escher(new PHPExcel_Shared_Escher());
|
2015-05-20 18:17:17 +00:00
|
|
|
//$debug->load($this->drawingData);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// get all spContainers in one long array, so they can be mapped to OBJ records
|
|
|
|
$allSpContainers = $escherWorksheet->getDgContainer()->getSpgrContainer()->getAllSpContainers();
|
|
|
|
}
|
|
|
|
|
|
|
|
// treat OBJ records
|
2015-05-20 18:17:17 +00:00
|
|
|
foreach ($this->objs as $n => $obj) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// echo '<hr /><b>Object</b> reference is ', $n,'<br />';
|
|
|
|
// var_dump($obj);
|
|
|
|
// echo '<br />';
|
|
|
|
|
|
|
|
// the first shape container never has a corresponding OBJ record, hence $n + 1
|
|
|
|
if (isset($allSpContainers[$n + 1]) && is_object($allSpContainers[$n + 1])) {
|
|
|
|
$spContainer = $allSpContainers[$n + 1];
|
|
|
|
|
|
|
|
// we skip all spContainers that are a part of a group shape since we cannot yet handle those
|
|
|
|
if ($spContainer->getNestingLevel() > 1) {
|
|
|
|
continue;
|
|
|
|
}
|
|
|
|
|
|
|
|
// calculate the width and height of the shape
|
|
|
|
list($startColumn, $startRow) = PHPExcel_Cell::coordinateFromString($spContainer->getStartCoordinates());
|
|
|
|
list($endColumn, $endRow) = PHPExcel_Cell::coordinateFromString($spContainer->getEndCoordinates());
|
|
|
|
|
|
|
|
$startOffsetX = $spContainer->getStartOffsetX();
|
|
|
|
$startOffsetY = $spContainer->getStartOffsetY();
|
|
|
|
$endOffsetX = $spContainer->getEndOffsetX();
|
|
|
|
$endOffsetY = $spContainer->getEndOffsetY();
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$width = PHPExcel_Shared_Excel5::getDistanceX($this->phpSheet, $startColumn, $startOffsetX, $endColumn, $endOffsetX);
|
|
|
|
$height = PHPExcel_Shared_Excel5::getDistanceY($this->phpSheet, $startRow, $startOffsetY, $endRow, $endOffsetY);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// calculate offsetX and offsetY of the shape
|
2015-05-20 18:17:17 +00:00
|
|
|
$offsetX = $startOffsetX * PHPExcel_Shared_Excel5::sizeCol($this->phpSheet, $startColumn) / 1024;
|
|
|
|
$offsetY = $startOffsetY * PHPExcel_Shared_Excel5::sizeRow($this->phpSheet, $startRow) / 256;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
switch ($obj['otObjType']) {
|
|
|
|
case 0x19:
|
|
|
|
// Note
|
|
|
|
// echo 'Cell Annotation Object<br />';
|
|
|
|
// echo 'Object ID is ', $obj['idObjID'],'<br />';
|
2015-05-20 18:17:17 +00:00
|
|
|
if (isset($this->cellNotes[$obj['idObjID']])) {
|
|
|
|
$cellNote = $this->cellNotes[$obj['idObjID']];
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if (isset($this->textObjects[$obj['idObjID']])) {
|
|
|
|
$textObject = $this->textObjects[$obj['idObjID']];
|
|
|
|
$this->cellNotes[$obj['idObjID']]['objTextData'] = $textObject;
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
}
|
|
|
|
break;
|
|
|
|
case 0x08:
|
|
|
|
// echo 'Picture Object<br />';
|
|
|
|
// picture
|
|
|
|
// get index to BSE entry (1-based)
|
|
|
|
$BSEindex = $spContainer->getOPT(0x0104);
|
|
|
|
$BSECollection = $escherWorkbook->getDggContainer()->getBstoreContainer()->getBSECollection();
|
|
|
|
$BSE = $BSECollection[$BSEindex - 1];
|
|
|
|
$blipType = $BSE->getBlipType();
|
|
|
|
|
|
|
|
// need check because some blip types are not supported by Escher reader such as EMF
|
|
|
|
if ($blip = $BSE->getBlip()) {
|
|
|
|
$ih = imagecreatefromstring($blip->getData());
|
|
|
|
$drawing = new PHPExcel_Worksheet_MemoryDrawing();
|
|
|
|
$drawing->setImageResource($ih);
|
|
|
|
|
|
|
|
// width, height, offsetX, offsetY
|
|
|
|
$drawing->setResizeProportional(false);
|
|
|
|
$drawing->setWidth($width);
|
|
|
|
$drawing->setHeight($height);
|
|
|
|
$drawing->setOffsetX($offsetX);
|
|
|
|
$drawing->setOffsetY($offsetY);
|
|
|
|
|
|
|
|
switch ($blipType) {
|
|
|
|
case PHPExcel_Shared_Escher_DggContainer_BstoreContainer_BSE::BLIPTYPE_JPEG:
|
|
|
|
$drawing->setRenderingFunction(PHPExcel_Worksheet_MemoryDrawing::RENDERING_JPEG);
|
|
|
|
$drawing->setMimeType(PHPExcel_Worksheet_MemoryDrawing::MIMETYPE_JPEG);
|
|
|
|
break;
|
|
|
|
case PHPExcel_Shared_Escher_DggContainer_BstoreContainer_BSE::BLIPTYPE_PNG:
|
|
|
|
$drawing->setRenderingFunction(PHPExcel_Worksheet_MemoryDrawing::RENDERING_PNG);
|
|
|
|
$drawing->setMimeType(PHPExcel_Worksheet_MemoryDrawing::MIMETYPE_PNG);
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$drawing->setWorksheet($this->phpSheet);
|
2015-05-17 16:10:35 +00:00
|
|
|
$drawing->setCoordinates($spContainer->getStartCoordinates());
|
|
|
|
}
|
|
|
|
break;
|
|
|
|
default:
|
|
|
|
// other object type
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
// treat SHAREDFMLA records
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($this->version == self::XLS_BIFF8) {
|
|
|
|
foreach ($this->sharedFormulaParts as $cell => $baseCell) {
|
2015-05-17 16:10:35 +00:00
|
|
|
list($column, $row) = PHPExcel_Cell::coordinateFromString($cell);
|
2015-05-20 18:17:17 +00:00
|
|
|
if (($this->getReadFilter() !== null) && $this->getReadFilter()->readCell($column, $row, $this->phpSheet->getTitle())) {
|
|
|
|
$formula = $this->getFormulaFromStructure($this->sharedFormulas[$baseCell], $cell);
|
|
|
|
$this->phpSheet->getCell($cell)->setValueExplicit('=' . $formula, PHPExcel_Cell_DataType::TYPE_FORMULA);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!empty($this->cellNotes)) {
|
|
|
|
foreach ($this->cellNotes as $note => $noteDetails) {
|
2015-05-17 16:10:35 +00:00
|
|
|
if (!isset($noteDetails['objTextData'])) {
|
2015-05-20 18:17:17 +00:00
|
|
|
if (isset($this->textObjects[$note])) {
|
|
|
|
$textObject = $this->textObjects[$note];
|
2015-05-17 16:10:35 +00:00
|
|
|
$noteDetails['objTextData'] = $textObject;
|
|
|
|
} else {
|
|
|
|
$noteDetails['objTextData']['text'] = '';
|
|
|
|
}
|
|
|
|
}
|
|
|
|
// echo '<b>Cell annotation ', $note,'</b><br />';
|
|
|
|
// var_dump($noteDetails);
|
|
|
|
// echo '<br />';
|
|
|
|
$cellAddress = str_replace('$', '', $noteDetails['cellRef']);
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getComment($cellAddress)->setAuthor($noteDetails['author'])->setText($this->parseRichText($noteDetails['objTextData']['text']));
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
// add the named ranges (defined names)
|
2015-05-20 18:17:17 +00:00
|
|
|
foreach ($this->definedname as $definedName) {
|
2015-05-17 16:10:35 +00:00
|
|
|
if ($definedName['isBuiltInName']) {
|
|
|
|
switch ($definedName['name']) {
|
|
|
|
case pack('C', 0x06):
|
|
|
|
// print area
|
|
|
|
// in general, formula looks like this: Foo!$C$7:$J$66,Bar!$A$1:$IV$2
|
|
|
|
$ranges = explode(',', $definedName['formula']); // FIXME: what if sheetname contains comma?
|
|
|
|
|
|
|
|
$extractedRanges = array();
|
|
|
|
foreach ($ranges as $range) {
|
|
|
|
// $range should look like one of these
|
|
|
|
// Foo!$C$7:$J$66
|
|
|
|
// Bar!$A$1:$IV$2
|
|
|
|
$explodes = explode('!', $range); // FIXME: what if sheetname contains exclamation mark?
|
|
|
|
$sheetName = trim($explodes[0], "'");
|
|
|
|
if (count($explodes) == 2) {
|
|
|
|
if (strpos($explodes[1], ':') === false) {
|
|
|
|
$explodes[1] = $explodes[1] . ':' . $explodes[1];
|
|
|
|
}
|
|
|
|
$extractedRanges[] = str_replace('$', '', $explodes[1]); // C7:J66
|
|
|
|
}
|
|
|
|
}
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($docSheet = $this->phpExcel->getSheetByName($sheetName)) {
|
2015-05-17 16:10:35 +00:00
|
|
|
$docSheet->getPageSetup()->setPrintArea(implode(',', $extractedRanges)); // C7:J66,A1:IV2
|
|
|
|
}
|
|
|
|
break;
|
|
|
|
case pack('C', 0x07):
|
|
|
|
// print titles (repeating rows)
|
|
|
|
// Assuming BIFF8, there are 3 cases
|
|
|
|
// 1. repeating rows
|
|
|
|
// formula looks like this: Sheet!$A$1:$IV$2
|
|
|
|
// rows 1-2 repeat
|
|
|
|
// 2. repeating columns
|
|
|
|
// formula looks like this: Sheet!$A$1:$B$65536
|
|
|
|
// columns A-B repeat
|
|
|
|
// 3. both repeating rows and repeating columns
|
|
|
|
// formula looks like this: Sheet!$A$1:$B$65536,Sheet!$A$1:$IV$2
|
|
|
|
$ranges = explode(',', $definedName['formula']); // FIXME: what if sheetname contains comma?
|
|
|
|
foreach ($ranges as $range) {
|
|
|
|
// $range should look like this one of these
|
|
|
|
// Sheet!$A$1:$B$65536
|
|
|
|
// Sheet!$A$1:$IV$2
|
|
|
|
$explodes = explode('!', $range);
|
|
|
|
if (count($explodes) == 2) {
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($docSheet = $this->phpExcel->getSheetByName($explodes[0])) {
|
2015-05-17 16:10:35 +00:00
|
|
|
$extractedRange = $explodes[1];
|
|
|
|
$extractedRange = str_replace('$', '', $extractedRange);
|
|
|
|
|
|
|
|
$coordinateStrings = explode(':', $extractedRange);
|
|
|
|
if (count($coordinateStrings) == 2) {
|
|
|
|
list($firstColumn, $firstRow) = PHPExcel_Cell::coordinateFromString($coordinateStrings[0]);
|
|
|
|
list($lastColumn, $lastRow) = PHPExcel_Cell::coordinateFromString($coordinateStrings[1]);
|
|
|
|
|
|
|
|
if ($firstColumn == 'A' and $lastColumn == 'IV') {
|
|
|
|
// then we have repeating rows
|
|
|
|
$docSheet->getPageSetup()->setRowsToRepeatAtTop(array($firstRow, $lastRow));
|
|
|
|
} elseif ($firstRow == 1 and $lastRow == 65536) {
|
|
|
|
// then we have repeating columns
|
|
|
|
$docSheet->getPageSetup()->setColumnsToRepeatAtLeft(array($firstColumn, $lastColumn));
|
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
} else {
|
|
|
|
// Extract range
|
|
|
|
$explodes = explode('!', $definedName['formula']);
|
|
|
|
|
|
|
|
if (count($explodes) == 2) {
|
2015-05-20 18:17:17 +00:00
|
|
|
if (($docSheet = $this->phpExcel->getSheetByName($explodes[0])) ||
|
|
|
|
($docSheet = $this->phpExcel->getSheetByName(trim($explodes[0], "'")))) {
|
2015-05-17 16:10:35 +00:00
|
|
|
$extractedRange = $explodes[1];
|
|
|
|
$extractedRange = str_replace('$', '', $extractedRange);
|
|
|
|
|
|
|
|
$localOnly = ($definedName['scope'] == 0) ? false : true;
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$scope = ($definedName['scope'] == 0) ? null : $this->phpExcel->getSheetByName($this->sheets[$definedName['scope'] - 1]['name']);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpExcel->addNamedRange(new PHPExcel_NamedRange((string)$definedName['name'], $docSheet, $extractedRange, $localOnly, $scope));
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
} else {
|
|
|
|
// Named Value
|
|
|
|
// TODO Provide support for named values
|
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->data = null;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
return $this->phpExcel;
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read record data from stream, decrypting as required
|
|
|
|
*
|
|
|
|
* @param string $data Data stream to read from
|
|
|
|
* @param int $pos Position to start reading from
|
|
|
|
* @param int $length Record data length
|
|
|
|
*
|
|
|
|
* @return string Record data
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readRecordData($data, $pos, $len)
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
$data = substr($data, $pos, $len);
|
|
|
|
|
|
|
|
// File not encrypted, or record before encryption start point
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($this->encryption == self::MS_BIFF_CRYPTO_NONE || $pos < $this->encryptionStartPos) {
|
2015-05-17 16:10:35 +00:00
|
|
|
return $data;
|
|
|
|
}
|
|
|
|
|
|
|
|
$recordData = '';
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($this->encryption == self::MS_BIFF_CRYPTO_RC4) {
|
|
|
|
$oldBlock = floor($this->rc4Pos / self::REKEY_BLOCK);
|
2015-05-17 16:10:35 +00:00
|
|
|
$block = floor($pos / self::REKEY_BLOCK);
|
|
|
|
$endBlock = floor(($pos + $len) / self::REKEY_BLOCK);
|
|
|
|
|
|
|
|
// Spin an RC4 decryptor to the right spot. If we have a decryptor sitting
|
|
|
|
// at a point earlier in the current block, re-use it as we can save some time.
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($block != $oldBlock || $pos < $this->rc4Pos || !$this->rc4Key) {
|
|
|
|
$this->rc4Key = $this->makeKey($block, $this->md5Ctxt);
|
2015-05-17 16:10:35 +00:00
|
|
|
$step = $pos % self::REKEY_BLOCK;
|
|
|
|
} else {
|
2015-05-20 18:17:17 +00:00
|
|
|
$step = $pos - $this->rc4Pos;
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->rc4Key->RC4(str_repeat("\0", $step));
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// Decrypt record data (re-keying at the end of every block)
|
|
|
|
while ($block != $endBlock) {
|
|
|
|
$step = self::REKEY_BLOCK - ($pos % self::REKEY_BLOCK);
|
2015-05-20 18:17:17 +00:00
|
|
|
$recordData .= $this->rc4Key->RC4(substr($data, 0, $step));
|
2015-05-17 16:10:35 +00:00
|
|
|
$data = substr($data, $step);
|
|
|
|
$pos += $step;
|
|
|
|
$len -= $step;
|
|
|
|
$block++;
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->rc4Key = $this->makeKey($block, $this->md5Ctxt);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
2015-05-20 18:17:17 +00:00
|
|
|
$recordData .= $this->rc4Key->RC4(substr($data, 0, $len));
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// Keep track of the position of this decryptor.
|
|
|
|
// We'll try and re-use it later if we can to speed things up
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->rc4Pos = $pos + $len;
|
|
|
|
} elseif ($this->encryption == self::MS_BIFF_CRYPTO_XOR) {
|
2015-05-17 16:10:35 +00:00
|
|
|
throw new PHPExcel_Reader_Exception('XOr encryption not supported');
|
|
|
|
}
|
|
|
|
return $recordData;
|
|
|
|
}
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Use OLE reader to extract the relevant data streams from the OLE file
|
|
|
|
*
|
|
|
|
* @param string $pFilename
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function loadOLE($pFilename)
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
// OLE reader
|
|
|
|
$ole = new PHPExcel_Shared_OLERead();
|
|
|
|
// get excel data,
|
|
|
|
$res = $ole->read($pFilename);
|
|
|
|
// Get workbook data: workbook stream + sheet streams
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->data = $ole->getStream($ole->wrkbook);
|
2015-05-17 16:10:35 +00:00
|
|
|
// Get summary information data
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->summaryInformation = $ole->getStream($ole->summaryInformation);
|
2015-05-17 16:10:35 +00:00
|
|
|
// Get additional document summary information data
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->documentSummaryInformation = $ole->getStream($ole->documentSummaryInformation);
|
2015-05-17 16:10:35 +00:00
|
|
|
// Get user-defined property data
|
2015-05-20 18:17:17 +00:00
|
|
|
// $this->userDefinedProperties = $ole->getUserDefinedProperties();
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read summary information
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readSummaryInformation()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!isset($this->summaryInformation)) {
|
2015-05-17 16:10:35 +00:00
|
|
|
return;
|
|
|
|
}
|
|
|
|
|
|
|
|
// offset: 0; size: 2; must be 0xFE 0xFF (UTF-16 LE byte order mark)
|
|
|
|
// offset: 2; size: 2;
|
|
|
|
// offset: 4; size: 2; OS version
|
|
|
|
// offset: 6; size: 2; OS indicator
|
|
|
|
// offset: 8; size: 16
|
|
|
|
// offset: 24; size: 4; section count
|
2015-05-20 18:17:17 +00:00
|
|
|
$secCount = self::getInt4d($this->summaryInformation, 24);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 28; size: 16; first section's class id: e0 85 9f f2 f9 4f 68 10 ab 91 08 00 2b 27 b3 d9
|
|
|
|
// offset: 44; size: 4
|
2015-05-20 18:17:17 +00:00
|
|
|
$secOffset = self::getInt4d($this->summaryInformation, 44);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// section header
|
|
|
|
// offset: $secOffset; size: 4; section length
|
2015-05-20 18:17:17 +00:00
|
|
|
$secLength = self::getInt4d($this->summaryInformation, $secOffset);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: $secOffset+4; size: 4; property count
|
2015-05-20 18:17:17 +00:00
|
|
|
$countProperties = self::getInt4d($this->summaryInformation, $secOffset+4);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// initialize code page (used to resolve string values)
|
|
|
|
$codePage = 'CP1252';
|
|
|
|
|
|
|
|
// offset: ($secOffset+8); size: var
|
|
|
|
// loop through property decarations and properties
|
|
|
|
for ($i = 0; $i < $countProperties; ++$i) {
|
|
|
|
// offset: ($secOffset+8) + (8 * $i); size: 4; property ID
|
2015-05-20 18:17:17 +00:00
|
|
|
$id = self::getInt4d($this->summaryInformation, ($secOffset+8) + (8 * $i));
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// Use value of property id as appropriate
|
|
|
|
// offset: ($secOffset+12) + (8 * $i); size: 4; offset from beginning of section (48)
|
2015-05-20 18:17:17 +00:00
|
|
|
$offset = self::getInt4d($this->summaryInformation, ($secOffset+12) + (8 * $i));
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$type = self::getInt4d($this->summaryInformation, $secOffset + $offset);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// initialize property value
|
|
|
|
$value = null;
|
|
|
|
|
|
|
|
// extract property value based on property type
|
|
|
|
switch ($type) {
|
|
|
|
case 0x02: // 2 byte signed integer
|
2015-05-20 18:17:17 +00:00
|
|
|
$value = self::getInt2d($this->summaryInformation, $secOffset + 4 + $offset);
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case 0x03: // 4 byte signed integer
|
2015-05-20 18:17:17 +00:00
|
|
|
$value = self::getInt4d($this->summaryInformation, $secOffset + 4 + $offset);
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case 0x13: // 4 byte unsigned integer
|
|
|
|
// not needed yet, fix later if necessary
|
|
|
|
break;
|
|
|
|
case 0x1E: // null-terminated string prepended by dword string length
|
2015-05-20 18:17:17 +00:00
|
|
|
$byteLength = self::getInt4d($this->summaryInformation, $secOffset + 4 + $offset);
|
|
|
|
$value = substr($this->summaryInformation, $secOffset + 8 + $offset, $byteLength);
|
2015-05-17 16:10:35 +00:00
|
|
|
$value = PHPExcel_Shared_String::ConvertEncoding($value, 'UTF-8', $codePage);
|
|
|
|
$value = rtrim($value);
|
|
|
|
break;
|
|
|
|
case 0x40: // Filetime (64-bit value representing the number of 100-nanosecond intervals since January 1, 1601)
|
|
|
|
// PHP-time
|
2015-05-20 18:17:17 +00:00
|
|
|
$value = PHPExcel_Shared_OLE::OLE2LocalDate(substr($this->summaryInformation, $secOffset + 4 + $offset, 8));
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case 0x47: // Clipboard format
|
|
|
|
// not needed yet, fix later if necessary
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
|
|
|
|
switch ($id) {
|
|
|
|
case 0x01: // Code Page
|
|
|
|
$codePage = PHPExcel_Shared_CodePage::NumberToName($value);
|
|
|
|
break;
|
|
|
|
case 0x02: // Title
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpExcel->getProperties()->setTitle($value);
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case 0x03: // Subject
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpExcel->getProperties()->setSubject($value);
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case 0x04: // Author (Creator)
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpExcel->getProperties()->setCreator($value);
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case 0x05: // Keywords
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpExcel->getProperties()->setKeywords($value);
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case 0x06: // Comments (Description)
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpExcel->getProperties()->setDescription($value);
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case 0x07: // Template
|
|
|
|
// Not supported by PHPExcel
|
|
|
|
break;
|
|
|
|
case 0x08: // Last Saved By (LastModifiedBy)
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpExcel->getProperties()->setLastModifiedBy($value);
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case 0x09: // Revision
|
|
|
|
// Not supported by PHPExcel
|
|
|
|
break;
|
|
|
|
case 0x0A: // Total Editing Time
|
|
|
|
// Not supported by PHPExcel
|
|
|
|
break;
|
|
|
|
case 0x0B: // Last Printed
|
|
|
|
// Not supported by PHPExcel
|
|
|
|
break;
|
|
|
|
case 0x0C: // Created Date/Time
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpExcel->getProperties()->setCreated($value);
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case 0x0D: // Modified Date/Time
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpExcel->getProperties()->setModified($value);
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case 0x0E: // Number of Pages
|
|
|
|
// Not supported by PHPExcel
|
|
|
|
break;
|
|
|
|
case 0x0F: // Number of Words
|
|
|
|
// Not supported by PHPExcel
|
|
|
|
break;
|
|
|
|
case 0x10: // Number of Characters
|
|
|
|
// Not supported by PHPExcel
|
|
|
|
break;
|
|
|
|
case 0x11: // Thumbnail
|
|
|
|
// Not supported by PHPExcel
|
|
|
|
break;
|
|
|
|
case 0x12: // Name of creating application
|
|
|
|
// Not supported by PHPExcel
|
|
|
|
break;
|
|
|
|
case 0x13: // Security
|
|
|
|
// Not supported by PHPExcel
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read additional document summary information
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readDocumentSummaryInformation()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!isset($this->documentSummaryInformation)) {
|
2015-05-17 16:10:35 +00:00
|
|
|
return;
|
|
|
|
}
|
|
|
|
|
|
|
|
// offset: 0; size: 2; must be 0xFE 0xFF (UTF-16 LE byte order mark)
|
|
|
|
// offset: 2; size: 2;
|
|
|
|
// offset: 4; size: 2; OS version
|
|
|
|
// offset: 6; size: 2; OS indicator
|
|
|
|
// offset: 8; size: 16
|
|
|
|
// offset: 24; size: 4; section count
|
2015-05-20 18:17:17 +00:00
|
|
|
$secCount = self::getInt4d($this->documentSummaryInformation, 24);
|
2015-05-17 16:10:35 +00:00
|
|
|
// echo '$secCount = ', $secCount,'<br />';
|
|
|
|
|
|
|
|
// offset: 28; size: 16; first section's class id: 02 d5 cd d5 9c 2e 1b 10 93 97 08 00 2b 2c f9 ae
|
|
|
|
// offset: 44; size: 4; first section offset
|
2015-05-20 18:17:17 +00:00
|
|
|
$secOffset = self::getInt4d($this->documentSummaryInformation, 44);
|
2015-05-17 16:10:35 +00:00
|
|
|
// echo '$secOffset = ', $secOffset,'<br />';
|
|
|
|
|
|
|
|
// section header
|
|
|
|
// offset: $secOffset; size: 4; section length
|
2015-05-20 18:17:17 +00:00
|
|
|
$secLength = self::getInt4d($this->documentSummaryInformation, $secOffset);
|
2015-05-17 16:10:35 +00:00
|
|
|
// echo '$secLength = ', $secLength,'<br />';
|
|
|
|
|
|
|
|
// offset: $secOffset+4; size: 4; property count
|
2015-05-20 18:17:17 +00:00
|
|
|
$countProperties = self::getInt4d($this->documentSummaryInformation, $secOffset+4);
|
2015-05-17 16:10:35 +00:00
|
|
|
// echo '$countProperties = ', $countProperties,'<br />';
|
|
|
|
|
|
|
|
// initialize code page (used to resolve string values)
|
|
|
|
$codePage = 'CP1252';
|
|
|
|
|
|
|
|
// offset: ($secOffset+8); size: var
|
|
|
|
// loop through property decarations and properties
|
|
|
|
for ($i = 0; $i < $countProperties; ++$i) {
|
|
|
|
// echo 'Property ', $i,'<br />';
|
|
|
|
// offset: ($secOffset+8) + (8 * $i); size: 4; property ID
|
2015-05-20 18:17:17 +00:00
|
|
|
$id = self::getInt4d($this->documentSummaryInformation, ($secOffset+8) + (8 * $i));
|
2015-05-17 16:10:35 +00:00
|
|
|
// echo 'ID is ', $id,'<br />';
|
|
|
|
|
|
|
|
// Use value of property id as appropriate
|
|
|
|
// offset: 60 + 8 * $i; size: 4; offset from beginning of section (48)
|
2015-05-20 18:17:17 +00:00
|
|
|
$offset = self::getInt4d($this->documentSummaryInformation, ($secOffset+12) + (8 * $i));
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$type = self::getInt4d($this->documentSummaryInformation, $secOffset + $offset);
|
2015-05-17 16:10:35 +00:00
|
|
|
// echo 'Type is ', $type,', ';
|
|
|
|
|
|
|
|
// initialize property value
|
|
|
|
$value = null;
|
|
|
|
|
|
|
|
// extract property value based on property type
|
|
|
|
switch ($type) {
|
|
|
|
case 0x02: // 2 byte signed integer
|
2015-05-20 18:17:17 +00:00
|
|
|
$value = self::getInt2d($this->documentSummaryInformation, $secOffset + 4 + $offset);
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case 0x03: // 4 byte signed integer
|
2015-05-20 18:17:17 +00:00
|
|
|
$value = self::getInt4d($this->documentSummaryInformation, $secOffset + 4 + $offset);
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case 0x0B: // Boolean
|
2015-05-20 18:17:17 +00:00
|
|
|
$value = self::getInt2d($this->documentSummaryInformation, $secOffset + 4 + $offset);
|
2015-05-17 16:10:35 +00:00
|
|
|
$value = ($value == 0 ? false : true);
|
|
|
|
break;
|
|
|
|
case 0x13: // 4 byte unsigned integer
|
|
|
|
// not needed yet, fix later if necessary
|
|
|
|
break;
|
|
|
|
case 0x1E: // null-terminated string prepended by dword string length
|
2015-05-20 18:17:17 +00:00
|
|
|
$byteLength = self::getInt4d($this->documentSummaryInformation, $secOffset + 4 + $offset);
|
|
|
|
$value = substr($this->documentSummaryInformation, $secOffset + 8 + $offset, $byteLength);
|
2015-05-17 16:10:35 +00:00
|
|
|
$value = PHPExcel_Shared_String::ConvertEncoding($value, 'UTF-8', $codePage);
|
|
|
|
$value = rtrim($value);
|
|
|
|
break;
|
|
|
|
case 0x40: // Filetime (64-bit value representing the number of 100-nanosecond intervals since January 1, 1601)
|
|
|
|
// PHP-Time
|
2015-05-20 18:17:17 +00:00
|
|
|
$value = PHPExcel_Shared_OLE::OLE2LocalDate(substr($this->documentSummaryInformation, $secOffset + 4 + $offset, 8));
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case 0x47: // Clipboard format
|
|
|
|
// not needed yet, fix later if necessary
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
|
|
|
|
switch ($id) {
|
|
|
|
case 0x01: // Code Page
|
|
|
|
$codePage = PHPExcel_Shared_CodePage::NumberToName($value);
|
|
|
|
break;
|
|
|
|
case 0x02: // Category
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpExcel->getProperties()->setCategory($value);
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case 0x03: // Presentation Target
|
|
|
|
// Not supported by PHPExcel
|
|
|
|
break;
|
|
|
|
case 0x04: // Bytes
|
|
|
|
// Not supported by PHPExcel
|
|
|
|
break;
|
|
|
|
case 0x05: // Lines
|
|
|
|
// Not supported by PHPExcel
|
|
|
|
break;
|
|
|
|
case 0x06: // Paragraphs
|
|
|
|
// Not supported by PHPExcel
|
|
|
|
break;
|
|
|
|
case 0x07: // Slides
|
|
|
|
// Not supported by PHPExcel
|
|
|
|
break;
|
|
|
|
case 0x08: // Notes
|
|
|
|
// Not supported by PHPExcel
|
|
|
|
break;
|
|
|
|
case 0x09: // Hidden Slides
|
|
|
|
// Not supported by PHPExcel
|
|
|
|
break;
|
|
|
|
case 0x0A: // MM Clips
|
|
|
|
// Not supported by PHPExcel
|
|
|
|
break;
|
|
|
|
case 0x0B: // Scale Crop
|
|
|
|
// Not supported by PHPExcel
|
|
|
|
break;
|
|
|
|
case 0x0C: // Heading Pairs
|
|
|
|
// Not supported by PHPExcel
|
|
|
|
break;
|
|
|
|
case 0x0D: // Titles of Parts
|
|
|
|
// Not supported by PHPExcel
|
|
|
|
break;
|
|
|
|
case 0x0E: // Manager
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpExcel->getProperties()->setManager($value);
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case 0x0F: // Company
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpExcel->getProperties()->setCompany($value);
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case 0x10: // Links up-to-date
|
|
|
|
// Not supported by PHPExcel
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Reads a general type of BIFF record. Does nothing except for moving stream pointer forward to next record.
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readDefault()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
// $recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* The NOTE record specifies a comment associated with a particular cell. In Excel 95 (BIFF7) and earlier versions,
|
|
|
|
* this record stores a note (cell note). This feature was significantly enhanced in Excel 97.
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readNote()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
// echo '<b>Read Cell Annotation</b><br />';
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
return;
|
|
|
|
}
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$cellAddress = $this->readBIFF8CellAddress(substr($recordData, 0, 4));
|
|
|
|
if ($this->version == self::XLS_BIFF8) {
|
|
|
|
$noteObjID = self::getInt2d($recordData, 6);
|
|
|
|
$noteAuthor = self::readUnicodeStringLong(substr($recordData, 8));
|
2015-05-17 16:10:35 +00:00
|
|
|
$noteAuthor = $noteAuthor['value'];
|
|
|
|
// echo 'Note Address=', $cellAddress,'<br />';
|
|
|
|
// echo 'Note Object ID=', $noteObjID,'<br />';
|
|
|
|
// echo 'Note Author=', $noteAuthor,'<hr />';
|
|
|
|
//
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->cellNotes[$noteObjID] = array(
|
2015-05-17 16:10:35 +00:00
|
|
|
'cellRef' => $cellAddress,
|
|
|
|
'objectID' => $noteObjID,
|
|
|
|
'author' => $noteAuthor
|
|
|
|
);
|
|
|
|
} else {
|
|
|
|
$extension = false;
|
|
|
|
if ($cellAddress == '$B$65536') {
|
|
|
|
// If the address row is -1 and the column is 0, (which translates as $B$65536) then this is a continuation
|
|
|
|
// note from the previous cell annotation. We're not yet handling this, so annotations longer than the
|
|
|
|
// max 2048 bytes will probably throw a wobbly.
|
2015-05-20 18:17:17 +00:00
|
|
|
$row = self::getInt2d($recordData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
$extension = true;
|
2015-05-20 18:17:17 +00:00
|
|
|
$cellAddress = array_pop(array_keys($this->phpSheet->getComments()));
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
// echo 'Note Address=', $cellAddress,'<br />';
|
|
|
|
|
|
|
|
$cellAddress = str_replace('$', '', $cellAddress);
|
2015-05-20 18:17:17 +00:00
|
|
|
$noteLength = self::getInt2d($recordData, 4);
|
2015-05-17 16:10:35 +00:00
|
|
|
$noteText = trim(substr($recordData, 6));
|
|
|
|
// echo 'Note Length=', $noteLength,'<br />';
|
|
|
|
// echo 'Note Text=', $noteText,'<br />';
|
|
|
|
|
|
|
|
if ($extension) {
|
|
|
|
// Concatenate this extension with the currently set comment for the cell
|
2015-05-20 18:17:17 +00:00
|
|
|
$comment = $this->phpSheet->getComment($cellAddress);
|
2015-05-17 16:10:35 +00:00
|
|
|
$commentText = $comment->getText()->getPlainText();
|
2015-05-20 18:17:17 +00:00
|
|
|
$comment->setText($this->parseRichText($commentText.$noteText));
|
2015-05-17 16:10:35 +00:00
|
|
|
} else {
|
|
|
|
// Set comment for the cell
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getComment($cellAddress)->setText($this->parseRichText($noteText));
|
2015-05-17 16:10:35 +00:00
|
|
|
// ->setAuthor($author)
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* The TEXT Object record contains the text associated with a cell annotation.
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readTextObject()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
return;
|
|
|
|
}
|
|
|
|
|
|
|
|
// recordData consists of an array of subrecords looking like this:
|
|
|
|
// grbit: 2 bytes; Option Flags
|
|
|
|
// rot: 2 bytes; rotation
|
|
|
|
// cchText: 2 bytes; length of the text (in the first continue record)
|
|
|
|
// cbRuns: 2 bytes; length of the formatting (in the second continue record)
|
|
|
|
// followed by the continuation records containing the actual text and formatting
|
2015-05-20 18:17:17 +00:00
|
|
|
$grbitOpts = self::getInt2d($recordData, 0);
|
|
|
|
$rot = self::getInt2d($recordData, 2);
|
|
|
|
$cchText = self::getInt2d($recordData, 10);
|
|
|
|
$cbRuns = self::getInt2d($recordData, 12);
|
|
|
|
$text = $this->getSplicedRecordData();
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->textObjects[$this->textObjRef] = array(
|
2015-05-17 16:10:35 +00:00
|
|
|
'text' => substr($text["recordData"], $text["spliceOffsets"][0]+1, $cchText),
|
|
|
|
'format' => substr($text["recordData"], $text["spliceOffsets"][1], $cbRuns),
|
|
|
|
'alignment' => $grbitOpts,
|
|
|
|
'rotation' => $rot
|
|
|
|
);
|
|
|
|
|
|
|
|
// echo '<b>_readTextObject()</b><br />';
|
2015-05-20 18:17:17 +00:00
|
|
|
// var_dump($this->textObjects[$this->textObjRef]);
|
2015-05-17 16:10:35 +00:00
|
|
|
// echo '<br />';
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read BOF
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readBof()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = substr($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 2; size: 2; type of the following data
|
2015-05-20 18:17:17 +00:00
|
|
|
$substreamType = self::getInt2d($recordData, 2);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
switch ($substreamType) {
|
|
|
|
case self::XLS_WorkbookGlobals:
|
2015-05-20 18:17:17 +00:00
|
|
|
$version = self::getInt2d($recordData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
if (($version != self::XLS_BIFF8) && ($version != self::XLS_BIFF7)) {
|
|
|
|
throw new PHPExcel_Reader_Exception('Cannot read this Excel file. Version is too old.');
|
|
|
|
}
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->version = $version;
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case self::XLS_Worksheet:
|
|
|
|
// do not use this version information for anything
|
|
|
|
// it is unreliable (OpenOffice doc, 5.8), use only version information from the global stream
|
|
|
|
break;
|
|
|
|
default:
|
|
|
|
// substream, e.g. chart
|
|
|
|
// just skip the entire substream
|
|
|
|
do {
|
2015-05-20 18:17:17 +00:00
|
|
|
$code = self::getInt2d($this->data, $this->pos);
|
|
|
|
$this->readDefault();
|
|
|
|
} while ($code != self::XLS_Type_EOF && $this->pos < $this->dataSize);
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* FILEPASS
|
|
|
|
*
|
|
|
|
* This record is part of the File Protection Block. It
|
|
|
|
* contains information about the read/write password of the
|
|
|
|
* file. All record contents following this record will be
|
|
|
|
* encrypted.
|
|
|
|
*
|
|
|
|
* -- "OpenOffice.org's Documentation of the Microsoft
|
|
|
|
* Excel File Format"
|
|
|
|
*
|
|
|
|
* The decryption functions and objects used from here on in
|
|
|
|
* are based on the source of Spreadsheet-ParseExcel:
|
|
|
|
* http://search.cpan.org/~jmcnamara/Spreadsheet-ParseExcel/
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readFilepass()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
if ($length != 54) {
|
|
|
|
throw new PHPExcel_Reader_Exception('Unexpected file pass record length');
|
|
|
|
}
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!$this->verifyPassword('VelvetSweatshop', substr($recordData, 6, 16), substr($recordData, 22, 16), substr($recordData, 38, 16), $this->md5Ctxt)) {
|
2015-05-17 16:10:35 +00:00
|
|
|
throw new PHPExcel_Reader_Exception('Decryption password incorrect');
|
|
|
|
}
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->encryption = self::MS_BIFF_CRYPTO_RC4;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// Decryption required from the record after next onwards
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->encryptionStartPos = $this->pos + self::getInt2d($this->data, $this->pos + 2);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Make an RC4 decryptor for the given block
|
|
|
|
*
|
|
|
|
* @var int $block Block for which to create decrypto
|
|
|
|
* @var string $valContext MD5 context state
|
|
|
|
*
|
|
|
|
* @return PHPExcel_Reader_Excel5_RC4
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function makeKey($block, $valContext)
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
$pwarray = str_repeat("\0", 64);
|
|
|
|
|
|
|
|
for ($i = 0; $i < 5; $i++) {
|
|
|
|
$pwarray[$i] = $valContext[$i];
|
|
|
|
}
|
|
|
|
|
|
|
|
$pwarray[5] = chr($block & 0xff);
|
|
|
|
$pwarray[6] = chr(($block >> 8) & 0xff);
|
|
|
|
$pwarray[7] = chr(($block >> 16) & 0xff);
|
|
|
|
$pwarray[8] = chr(($block >> 24) & 0xff);
|
|
|
|
|
|
|
|
$pwarray[9] = "\x80";
|
|
|
|
$pwarray[56] = "\x48";
|
|
|
|
|
|
|
|
$md5 = new PHPExcel_Reader_Excel5_MD5();
|
|
|
|
$md5->add($pwarray);
|
|
|
|
|
|
|
|
$s = $md5->getContext();
|
|
|
|
return new PHPExcel_Reader_Excel5_RC4($s);
|
|
|
|
}
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Verify RC4 file password
|
|
|
|
*
|
|
|
|
* @var string $password Password to check
|
|
|
|
* @var string $docid Document id
|
|
|
|
* @var string $salt_data Salt data
|
|
|
|
* @var string $hashedsalt_data Hashed salt data
|
|
|
|
* @var string &$valContext Set to the MD5 context of the value
|
|
|
|
*
|
|
|
|
* @return bool Success
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function verifyPassword($password, $docid, $salt_data, $hashedsalt_data, &$valContext)
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
$pwarray = str_repeat("\0", 64);
|
|
|
|
|
|
|
|
for ($i = 0; $i < strlen($password); $i++) {
|
|
|
|
$o = ord(substr($password, $i, 1));
|
|
|
|
$pwarray[2 * $i] = chr($o & 0xff);
|
|
|
|
$pwarray[2 * $i + 1] = chr(($o >> 8) & 0xff);
|
|
|
|
}
|
|
|
|
$pwarray[2 * $i] = chr(0x80);
|
|
|
|
$pwarray[56] = chr(($i << 4) & 0xff);
|
|
|
|
|
|
|
|
$md5 = new PHPExcel_Reader_Excel5_MD5();
|
|
|
|
$md5->add($pwarray);
|
|
|
|
|
|
|
|
$mdContext1 = $md5->getContext();
|
|
|
|
|
|
|
|
$offset = 0;
|
|
|
|
$keyoffset = 0;
|
|
|
|
$tocopy = 5;
|
|
|
|
|
|
|
|
$md5->reset();
|
|
|
|
|
|
|
|
while ($offset != 16) {
|
|
|
|
if ((64 - $offset) < 5) {
|
|
|
|
$tocopy = 64 - $offset;
|
|
|
|
}
|
|
|
|
for ($i = 0; $i <= $tocopy; $i++) {
|
|
|
|
$pwarray[$offset + $i] = $mdContext1[$keyoffset + $i];
|
|
|
|
}
|
|
|
|
$offset += $tocopy;
|
|
|
|
|
|
|
|
if ($offset == 64) {
|
|
|
|
$md5->add($pwarray);
|
|
|
|
$keyoffset = $tocopy;
|
|
|
|
$tocopy = 5 - $tocopy;
|
|
|
|
$offset = 0;
|
|
|
|
continue;
|
|
|
|
}
|
|
|
|
|
|
|
|
$keyoffset = 0;
|
|
|
|
$tocopy = 5;
|
|
|
|
for ($i = 0; $i < 16; $i++) {
|
|
|
|
$pwarray[$offset + $i] = $docid[$i];
|
|
|
|
}
|
|
|
|
$offset += 16;
|
|
|
|
}
|
|
|
|
|
|
|
|
$pwarray[16] = "\x80";
|
|
|
|
for ($i = 0; $i < 47; $i++) {
|
|
|
|
$pwarray[17 + $i] = "\0";
|
|
|
|
}
|
|
|
|
$pwarray[56] = "\x80";
|
|
|
|
$pwarray[57] = "\x0a";
|
|
|
|
|
|
|
|
$md5->add($pwarray);
|
|
|
|
$valContext = $md5->getContext();
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$key = $this->makeKey(0, $valContext);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
$salt = $key->RC4($salt_data);
|
|
|
|
$hashedsalt = $key->RC4($hashedsalt_data);
|
|
|
|
|
|
|
|
$salt .= "\x80" . str_repeat("\0", 47);
|
|
|
|
$salt[56] = "\x80";
|
|
|
|
|
|
|
|
$md5->reset();
|
|
|
|
$md5->add($salt);
|
|
|
|
$mdContext2 = $md5->getContext();
|
|
|
|
|
|
|
|
return $mdContext2 == $hashedsalt;
|
|
|
|
}
|
|
|
|
|
|
|
|
/**
|
|
|
|
* CODEPAGE
|
|
|
|
*
|
|
|
|
* This record stores the text encoding used to write byte
|
|
|
|
* strings, stored as MS Windows code page identifier.
|
|
|
|
*
|
|
|
|
* -- "OpenOffice.org's Documentation of the Microsoft
|
|
|
|
* Excel File Format"
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readCodepage()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 0; size: 2; code page identifier
|
2015-05-20 18:17:17 +00:00
|
|
|
$codepage = self::getInt2d($recordData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->codepage = PHPExcel_Shared_CodePage::NumberToName($codepage);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* DATEMODE
|
|
|
|
*
|
|
|
|
* This record specifies the base date for displaying date
|
|
|
|
* values. All dates are stored as count of days past this
|
|
|
|
* base date. In BIFF2-BIFF4 this record is part of the
|
|
|
|
* Calculation Settings Block. In BIFF5-BIFF8 it is
|
|
|
|
* stored in the Workbook Globals Substream.
|
|
|
|
*
|
|
|
|
* -- "OpenOffice.org's Documentation of the Microsoft
|
|
|
|
* Excel File Format"
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readDateMode()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 0; size: 2; 0 = base 1900, 1 = base 1904
|
|
|
|
PHPExcel_Shared_Date::setExcelCalendar(PHPExcel_Shared_Date::CALENDAR_WINDOWS_1900);
|
|
|
|
if (ord($recordData{0}) == 1) {
|
|
|
|
PHPExcel_Shared_Date::setExcelCalendar(PHPExcel_Shared_Date::CALENDAR_MAC_1904);
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read a FONT record
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readFont()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!$this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
$objFont = new PHPExcel_Style_Font();
|
|
|
|
|
|
|
|
// offset: 0; size: 2; height of the font (in twips = 1/20 of a point)
|
2015-05-20 18:17:17 +00:00
|
|
|
$size = self::getInt2d($recordData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
$objFont->setSize($size / 20);
|
|
|
|
|
|
|
|
// offset: 2; size: 2; option flags
|
|
|
|
// bit: 0; mask 0x0001; bold (redundant in BIFF5-BIFF8)
|
|
|
|
// bit: 1; mask 0x0002; italic
|
2015-05-20 18:17:17 +00:00
|
|
|
$isItalic = (0x0002 & self::getInt2d($recordData, 2)) >> 1;
|
2015-05-17 16:10:35 +00:00
|
|
|
if ($isItalic) {
|
|
|
|
$objFont->setItalic(true);
|
|
|
|
}
|
|
|
|
|
|
|
|
// bit: 2; mask 0x0004; underlined (redundant in BIFF5-BIFF8)
|
|
|
|
// bit: 3; mask 0x0008; strike
|
2015-05-20 18:17:17 +00:00
|
|
|
$isStrike = (0x0008 & self::getInt2d($recordData, 2)) >> 3;
|
2015-05-17 16:10:35 +00:00
|
|
|
if ($isStrike) {
|
|
|
|
$objFont->setStrikethrough(true);
|
|
|
|
}
|
|
|
|
|
|
|
|
// offset: 4; size: 2; colour index
|
2015-05-20 18:17:17 +00:00
|
|
|
$colorIndex = self::getInt2d($recordData, 4);
|
2015-05-17 16:10:35 +00:00
|
|
|
$objFont->colorIndex = $colorIndex;
|
|
|
|
|
|
|
|
// offset: 6; size: 2; font weight
|
2015-05-20 18:17:17 +00:00
|
|
|
$weight = self::getInt2d($recordData, 6);
|
2015-05-17 16:10:35 +00:00
|
|
|
switch ($weight) {
|
|
|
|
case 0x02BC:
|
|
|
|
$objFont->setBold(true);
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
|
|
|
|
// offset: 8; size: 2; escapement type
|
2015-05-20 18:17:17 +00:00
|
|
|
$escapement = self::getInt2d($recordData, 8);
|
2015-05-17 16:10:35 +00:00
|
|
|
switch ($escapement) {
|
|
|
|
case 0x0001:
|
|
|
|
$objFont->setSuperScript(true);
|
|
|
|
break;
|
|
|
|
case 0x0002:
|
|
|
|
$objFont->setSubScript(true);
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
|
|
|
|
// offset: 10; size: 1; underline type
|
|
|
|
$underlineType = ord($recordData{10});
|
|
|
|
switch ($underlineType) {
|
|
|
|
case 0x00:
|
|
|
|
break; // no underline
|
|
|
|
case 0x01:
|
|
|
|
$objFont->setUnderline(PHPExcel_Style_Font::UNDERLINE_SINGLE);
|
|
|
|
break;
|
|
|
|
case 0x02:
|
|
|
|
$objFont->setUnderline(PHPExcel_Style_Font::UNDERLINE_DOUBLE);
|
|
|
|
break;
|
|
|
|
case 0x21:
|
|
|
|
$objFont->setUnderline(PHPExcel_Style_Font::UNDERLINE_SINGLEACCOUNTING);
|
|
|
|
break;
|
|
|
|
case 0x22:
|
|
|
|
$objFont->setUnderline(PHPExcel_Style_Font::UNDERLINE_DOUBLEACCOUNTING);
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
|
|
|
|
// offset: 11; size: 1; font family
|
|
|
|
// offset: 12; size: 1; character set
|
|
|
|
// offset: 13; size: 1; not used
|
|
|
|
// offset: 14; size: var; font name
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($this->version == self::XLS_BIFF8) {
|
|
|
|
$string = self::readUnicodeStringShort(substr($recordData, 14));
|
2015-05-17 16:10:35 +00:00
|
|
|
} else {
|
2015-05-20 18:17:17 +00:00
|
|
|
$string = $this->readByteStringShort(substr($recordData, 14));
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
$objFont->setName($string['value']);
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->objFonts[] = $objFont;
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* FORMAT
|
|
|
|
*
|
|
|
|
* This record contains information about a number format.
|
|
|
|
* All FORMAT records occur together in a sequential list.
|
|
|
|
*
|
|
|
|
* In BIFF2-BIFF4 other records referencing a FORMAT record
|
|
|
|
* contain a zero-based index into this list. From BIFF5 on
|
|
|
|
* the FORMAT record contains the index itself that will be
|
|
|
|
* used by other records.
|
|
|
|
*
|
|
|
|
* -- "OpenOffice.org's Documentation of the Microsoft
|
|
|
|
* Excel File Format"
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readFormat()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!$this->readDataOnly) {
|
|
|
|
$indexCode = self::getInt2d($recordData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($this->version == self::XLS_BIFF8) {
|
|
|
|
$string = self::readUnicodeStringLong(substr($recordData, 2));
|
2015-05-17 16:10:35 +00:00
|
|
|
} else {
|
|
|
|
// BIFF7
|
2015-05-20 18:17:17 +00:00
|
|
|
$string = $this->readByteStringShort(substr($recordData, 2));
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
$formatString = $string['value'];
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->formats[$indexCode] = $formatString;
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* XF - Extended Format
|
|
|
|
*
|
|
|
|
* This record contains formatting information for cells, rows, columns or styles.
|
|
|
|
* According to http://support.microsoft.com/kb/147732 there are always at least 15 cell style XF
|
|
|
|
* and 1 cell XF.
|
|
|
|
* Inspection of Excel files generated by MS Office Excel shows that XF records 0-14 are cell style XF
|
|
|
|
* and XF record 15 is a cell XF
|
|
|
|
* We only read the first cell style XF and skip the remaining cell style XF records
|
|
|
|
* We read all cell XF records.
|
|
|
|
*
|
|
|
|
* -- "OpenOffice.org's Documentation of the Microsoft
|
|
|
|
* Excel File Format"
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readXf()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
$objStyle = new PHPExcel_Style();
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!$this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 0; size: 2; Index to FONT record
|
2015-05-20 18:17:17 +00:00
|
|
|
if (self::getInt2d($recordData, 0) < 4) {
|
|
|
|
$fontIndex = self::getInt2d($recordData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
} else {
|
|
|
|
// this has to do with that index 4 is omitted in all BIFF versions for some strange reason
|
|
|
|
// check the OpenOffice documentation of the FONT record
|
2015-05-20 18:17:17 +00:00
|
|
|
$fontIndex = self::getInt2d($recordData, 0) - 1;
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
2015-05-20 18:17:17 +00:00
|
|
|
$objStyle->setFont($this->objFonts[$fontIndex]);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 2; size: 2; Index to FORMAT record
|
2015-05-20 18:17:17 +00:00
|
|
|
$numberFormatIndex = self::getInt2d($recordData, 2);
|
|
|
|
if (isset($this->formats[$numberFormatIndex])) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// then we have user-defined format code
|
2015-05-20 18:17:17 +00:00
|
|
|
$numberformat = array('code' => $this->formats[$numberFormatIndex]);
|
2015-05-17 16:10:35 +00:00
|
|
|
} elseif (($code = PHPExcel_Style_NumberFormat::builtInFormatCode($numberFormatIndex)) !== '') {
|
|
|
|
// then we have built-in format code
|
|
|
|
$numberformat = array('code' => $code);
|
|
|
|
} else {
|
|
|
|
// we set the general format code
|
|
|
|
$numberformat = array('code' => 'General');
|
|
|
|
}
|
|
|
|
$objStyle->getNumberFormat()->setFormatCode($numberformat['code']);
|
|
|
|
|
|
|
|
// offset: 4; size: 2; XF type, cell protection, and parent style XF
|
|
|
|
// bit 2-0; mask 0x0007; XF_TYPE_PROT
|
2015-05-20 18:17:17 +00:00
|
|
|
$xfTypeProt = self::getInt2d($recordData, 4);
|
2015-05-17 16:10:35 +00:00
|
|
|
// bit 0; mask 0x01; 1 = cell is locked
|
|
|
|
$isLocked = (0x01 & $xfTypeProt) >> 0;
|
|
|
|
$objStyle->getProtection()->setLocked($isLocked ? PHPExcel_Style_Protection::PROTECTION_INHERIT : PHPExcel_Style_Protection::PROTECTION_UNPROTECTED);
|
|
|
|
|
|
|
|
// bit 1; mask 0x02; 1 = Formula is hidden
|
|
|
|
$isHidden = (0x02 & $xfTypeProt) >> 1;
|
|
|
|
$objStyle->getProtection()->setHidden($isHidden ? PHPExcel_Style_Protection::PROTECTION_PROTECTED : PHPExcel_Style_Protection::PROTECTION_UNPROTECTED);
|
|
|
|
|
|
|
|
// bit 2; mask 0x04; 0 = Cell XF, 1 = Cell Style XF
|
|
|
|
$isCellStyleXf = (0x04 & $xfTypeProt) >> 2;
|
|
|
|
|
|
|
|
// offset: 6; size: 1; Alignment and text break
|
|
|
|
// bit 2-0, mask 0x07; horizontal alignment
|
|
|
|
$horAlign = (0x07 & ord($recordData{6})) >> 0;
|
|
|
|
switch ($horAlign) {
|
|
|
|
case 0:
|
|
|
|
$objStyle->getAlignment()->setHorizontal(PHPExcel_Style_Alignment::HORIZONTAL_GENERAL);
|
|
|
|
break;
|
|
|
|
case 1:
|
|
|
|
$objStyle->getAlignment()->setHorizontal(PHPExcel_Style_Alignment::HORIZONTAL_LEFT);
|
|
|
|
break;
|
|
|
|
case 2:
|
|
|
|
$objStyle->getAlignment()->setHorizontal(PHPExcel_Style_Alignment::HORIZONTAL_CENTER);
|
|
|
|
break;
|
|
|
|
case 3:
|
|
|
|
$objStyle->getAlignment()->setHorizontal(PHPExcel_Style_Alignment::HORIZONTAL_RIGHT);
|
|
|
|
break;
|
|
|
|
case 4:
|
|
|
|
$objStyle->getAlignment()->setHorizontal(PHPExcel_Style_Alignment::HORIZONTAL_FILL);
|
|
|
|
break;
|
|
|
|
case 5:
|
|
|
|
$objStyle->getAlignment()->setHorizontal(PHPExcel_Style_Alignment::HORIZONTAL_JUSTIFY);
|
|
|
|
break;
|
|
|
|
case 6:
|
|
|
|
$objStyle->getAlignment()->setHorizontal(PHPExcel_Style_Alignment::HORIZONTAL_CENTER_CONTINUOUS);
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
// bit 3, mask 0x08; wrap text
|
|
|
|
$wrapText = (0x08 & ord($recordData{6})) >> 3;
|
|
|
|
switch ($wrapText) {
|
|
|
|
case 0:
|
|
|
|
$objStyle->getAlignment()->setWrapText(false);
|
|
|
|
break;
|
|
|
|
case 1:
|
|
|
|
$objStyle->getAlignment()->setWrapText(true);
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
// bit 6-4, mask 0x70; vertical alignment
|
|
|
|
$vertAlign = (0x70 & ord($recordData{6})) >> 4;
|
|
|
|
switch ($vertAlign) {
|
|
|
|
case 0:
|
|
|
|
$objStyle->getAlignment()->setVertical(PHPExcel_Style_Alignment::VERTICAL_TOP);
|
|
|
|
break;
|
|
|
|
case 1:
|
|
|
|
$objStyle->getAlignment()->setVertical(PHPExcel_Style_Alignment::VERTICAL_CENTER);
|
|
|
|
break;
|
|
|
|
case 2:
|
|
|
|
$objStyle->getAlignment()->setVertical(PHPExcel_Style_Alignment::VERTICAL_BOTTOM);
|
|
|
|
break;
|
|
|
|
case 3:
|
|
|
|
$objStyle->getAlignment()->setVertical(PHPExcel_Style_Alignment::VERTICAL_JUSTIFY);
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($this->version == self::XLS_BIFF8) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 7; size: 1; XF_ROTATION: Text rotation angle
|
|
|
|
$angle = ord($recordData{7});
|
|
|
|
$rotation = 0;
|
|
|
|
if ($angle <= 90) {
|
|
|
|
$rotation = $angle;
|
2015-05-18 15:39:04 +00:00
|
|
|
} elseif ($angle <= 180) {
|
2015-05-17 16:10:35 +00:00
|
|
|
$rotation = 90 - $angle;
|
2015-05-18 15:39:04 +00:00
|
|
|
} elseif ($angle == 255) {
|
2015-05-17 16:10:35 +00:00
|
|
|
$rotation = -165;
|
|
|
|
}
|
|
|
|
$objStyle->getAlignment()->setTextRotation($rotation);
|
|
|
|
|
|
|
|
// offset: 8; size: 1; Indentation, shrink to cell size, and text direction
|
|
|
|
// bit: 3-0; mask: 0x0F; indent level
|
|
|
|
$indent = (0x0F & ord($recordData{8})) >> 0;
|
|
|
|
$objStyle->getAlignment()->setIndent($indent);
|
|
|
|
|
|
|
|
// bit: 4; mask: 0x10; 1 = shrink content to fit into cell
|
|
|
|
$shrinkToFit = (0x10 & ord($recordData{8})) >> 4;
|
|
|
|
switch ($shrinkToFit) {
|
|
|
|
case 0:
|
|
|
|
$objStyle->getAlignment()->setShrinkToFit(false);
|
|
|
|
break;
|
|
|
|
case 1:
|
|
|
|
$objStyle->getAlignment()->setShrinkToFit(true);
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
|
|
|
|
// offset: 9; size: 1; Flags used for attribute groups
|
|
|
|
|
|
|
|
// offset: 10; size: 4; Cell border lines and background area
|
|
|
|
// bit: 3-0; mask: 0x0000000F; left style
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($bordersLeftStyle = self::mapBorderStyle((0x0000000F & self::getInt4d($recordData, 10)) >> 0)) {
|
2015-05-17 16:10:35 +00:00
|
|
|
$objStyle->getBorders()->getLeft()->setBorderStyle($bordersLeftStyle);
|
|
|
|
}
|
|
|
|
// bit: 7-4; mask: 0x000000F0; right style
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($bordersRightStyle = self::mapBorderStyle((0x000000F0 & self::getInt4d($recordData, 10)) >> 4)) {
|
2015-05-17 16:10:35 +00:00
|
|
|
$objStyle->getBorders()->getRight()->setBorderStyle($bordersRightStyle);
|
|
|
|
}
|
|
|
|
// bit: 11-8; mask: 0x00000F00; top style
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($bordersTopStyle = self::mapBorderStyle((0x00000F00 & self::getInt4d($recordData, 10)) >> 8)) {
|
2015-05-17 16:10:35 +00:00
|
|
|
$objStyle->getBorders()->getTop()->setBorderStyle($bordersTopStyle);
|
|
|
|
}
|
|
|
|
// bit: 15-12; mask: 0x0000F000; bottom style
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($bordersBottomStyle = self::mapBorderStyle((0x0000F000 & self::getInt4d($recordData, 10)) >> 12)) {
|
2015-05-17 16:10:35 +00:00
|
|
|
$objStyle->getBorders()->getBottom()->setBorderStyle($bordersBottomStyle);
|
|
|
|
}
|
|
|
|
// bit: 22-16; mask: 0x007F0000; left color
|
2015-05-20 18:17:17 +00:00
|
|
|
$objStyle->getBorders()->getLeft()->colorIndex = (0x007F0000 & self::getInt4d($recordData, 10)) >> 16;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 29-23; mask: 0x3F800000; right color
|
2015-05-20 18:17:17 +00:00
|
|
|
$objStyle->getBorders()->getRight()->colorIndex = (0x3F800000 & self::getInt4d($recordData, 10)) >> 23;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 30; mask: 0x40000000; 1 = diagonal line from top left to right bottom
|
2015-05-20 18:17:17 +00:00
|
|
|
$diagonalDown = (0x40000000 & self::getInt4d($recordData, 10)) >> 30 ? true : false;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 31; mask: 0x80000000; 1 = diagonal line from bottom left to top right
|
2015-05-20 18:17:17 +00:00
|
|
|
$diagonalUp = (0x80000000 & self::getInt4d($recordData, 10)) >> 31 ? true : false;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
if ($diagonalUp == false && $diagonalDown == false) {
|
|
|
|
$objStyle->getBorders()->setDiagonalDirection(PHPExcel_Style_Borders::DIAGONAL_NONE);
|
|
|
|
} elseif ($diagonalUp == true && $diagonalDown == false) {
|
|
|
|
$objStyle->getBorders()->setDiagonalDirection(PHPExcel_Style_Borders::DIAGONAL_UP);
|
|
|
|
} elseif ($diagonalUp == false && $diagonalDown == true) {
|
|
|
|
$objStyle->getBorders()->setDiagonalDirection(PHPExcel_Style_Borders::DIAGONAL_DOWN);
|
|
|
|
} elseif ($diagonalUp == true && $diagonalDown == true) {
|
|
|
|
$objStyle->getBorders()->setDiagonalDirection(PHPExcel_Style_Borders::DIAGONAL_BOTH);
|
|
|
|
}
|
|
|
|
|
|
|
|
// offset: 14; size: 4;
|
|
|
|
// bit: 6-0; mask: 0x0000007F; top color
|
2015-05-20 18:17:17 +00:00
|
|
|
$objStyle->getBorders()->getTop()->colorIndex = (0x0000007F & self::getInt4d($recordData, 14)) >> 0;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 13-7; mask: 0x00003F80; bottom color
|
2015-05-20 18:17:17 +00:00
|
|
|
$objStyle->getBorders()->getBottom()->colorIndex = (0x00003F80 & self::getInt4d($recordData, 14)) >> 7;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 20-14; mask: 0x001FC000; diagonal color
|
2015-05-20 18:17:17 +00:00
|
|
|
$objStyle->getBorders()->getDiagonal()->colorIndex = (0x001FC000 & self::getInt4d($recordData, 14)) >> 14;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 24-21; mask: 0x01E00000; diagonal style
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($bordersDiagonalStyle = self::mapBorderStyle((0x01E00000 & self::getInt4d($recordData, 14)) >> 21)) {
|
2015-05-17 16:10:35 +00:00
|
|
|
$objStyle->getBorders()->getDiagonal()->setBorderStyle($bordersDiagonalStyle);
|
|
|
|
}
|
|
|
|
|
|
|
|
// bit: 31-26; mask: 0xFC000000 fill pattern
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($fillType = self::mapFillPattern((0xFC000000 & self::getInt4d($recordData, 14)) >> 26)) {
|
2015-05-17 16:10:35 +00:00
|
|
|
$objStyle->getFill()->setFillType($fillType);
|
|
|
|
}
|
|
|
|
// offset: 18; size: 2; pattern and background colour
|
|
|
|
// bit: 6-0; mask: 0x007F; color index for pattern color
|
2015-05-20 18:17:17 +00:00
|
|
|
$objStyle->getFill()->startcolorIndex = (0x007F & self::getInt2d($recordData, 18)) >> 0;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 13-7; mask: 0x3F80; color index for pattern background
|
2015-05-20 18:17:17 +00:00
|
|
|
$objStyle->getFill()->endcolorIndex = (0x3F80 & self::getInt2d($recordData, 18)) >> 7;
|
2015-05-17 16:10:35 +00:00
|
|
|
} else {
|
|
|
|
// BIFF5
|
|
|
|
|
|
|
|
// offset: 7; size: 1; Text orientation and flags
|
|
|
|
$orientationAndFlags = ord($recordData{7});
|
|
|
|
|
|
|
|
// bit: 1-0; mask: 0x03; XF_ORIENTATION: Text orientation
|
|
|
|
$xfOrientation = (0x03 & $orientationAndFlags) >> 0;
|
|
|
|
switch ($xfOrientation) {
|
|
|
|
case 0:
|
|
|
|
$objStyle->getAlignment()->setTextRotation(0);
|
|
|
|
break;
|
|
|
|
case 1:
|
|
|
|
$objStyle->getAlignment()->setTextRotation(-165);
|
|
|
|
break;
|
|
|
|
case 2:
|
|
|
|
$objStyle->getAlignment()->setTextRotation(90);
|
|
|
|
break;
|
|
|
|
case 3:
|
|
|
|
$objStyle->getAlignment()->setTextRotation(-90);
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
|
|
|
|
// offset: 8; size: 4; cell border lines and background area
|
2015-05-20 18:17:17 +00:00
|
|
|
$borderAndBackground = self::getInt4d($recordData, 8);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 6-0; mask: 0x0000007F; color index for pattern color
|
|
|
|
$objStyle->getFill()->startcolorIndex = (0x0000007F & $borderAndBackground) >> 0;
|
|
|
|
|
|
|
|
// bit: 13-7; mask: 0x00003F80; color index for pattern background
|
|
|
|
$objStyle->getFill()->endcolorIndex = (0x00003F80 & $borderAndBackground) >> 7;
|
|
|
|
|
|
|
|
// bit: 21-16; mask: 0x003F0000; fill pattern
|
2015-05-20 18:17:17 +00:00
|
|
|
$objStyle->getFill()->setFillType(self::mapFillPattern((0x003F0000 & $borderAndBackground) >> 16));
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 24-22; mask: 0x01C00000; bottom line style
|
2015-05-20 18:17:17 +00:00
|
|
|
$objStyle->getBorders()->getBottom()->setBorderStyle(self::mapBorderStyle((0x01C00000 & $borderAndBackground) >> 22));
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 31-25; mask: 0xFE000000; bottom line color
|
|
|
|
$objStyle->getBorders()->getBottom()->colorIndex = (0xFE000000 & $borderAndBackground) >> 25;
|
|
|
|
|
|
|
|
// offset: 12; size: 4; cell border lines
|
2015-05-20 18:17:17 +00:00
|
|
|
$borderLines = self::getInt4d($recordData, 12);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 2-0; mask: 0x00000007; top line style
|
2015-05-20 18:17:17 +00:00
|
|
|
$objStyle->getBorders()->getTop()->setBorderStyle(self::mapBorderStyle((0x00000007 & $borderLines) >> 0));
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 5-3; mask: 0x00000038; left line style
|
2015-05-20 18:17:17 +00:00
|
|
|
$objStyle->getBorders()->getLeft()->setBorderStyle(self::mapBorderStyle((0x00000038 & $borderLines) >> 3));
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 8-6; mask: 0x000001C0; right line style
|
2015-05-20 18:17:17 +00:00
|
|
|
$objStyle->getBorders()->getRight()->setBorderStyle(self::mapBorderStyle((0x000001C0 & $borderLines) >> 6));
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 15-9; mask: 0x0000FE00; top line color index
|
|
|
|
$objStyle->getBorders()->getTop()->colorIndex = (0x0000FE00 & $borderLines) >> 9;
|
|
|
|
|
|
|
|
// bit: 22-16; mask: 0x007F0000; left line color index
|
|
|
|
$objStyle->getBorders()->getLeft()->colorIndex = (0x007F0000 & $borderLines) >> 16;
|
|
|
|
|
|
|
|
// bit: 29-23; mask: 0x3F800000; right line color index
|
|
|
|
$objStyle->getBorders()->getRight()->colorIndex = (0x3F800000 & $borderLines) >> 23;
|
|
|
|
}
|
|
|
|
|
|
|
|
// add cellStyleXf or cellXf and update mapping
|
|
|
|
if ($isCellStyleXf) {
|
|
|
|
// we only read one style XF record which is always the first
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($this->xfIndex == 0) {
|
|
|
|
$this->phpExcel->addCellStyleXf($objStyle);
|
|
|
|
$this->mapCellStyleXfIndex[$this->xfIndex] = 0;
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
} else {
|
|
|
|
// we read all cell XF records
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpExcel->addCellXf($objStyle);
|
|
|
|
$this->mapCellXfIndex[$this->xfIndex] = count($this->phpExcel->getCellXfCollection()) - 1;
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
// update XF index for when we read next record
|
2015-05-20 18:17:17 +00:00
|
|
|
++$this->xfIndex;
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
*
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readXfExt()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!$this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 0; size: 2; 0x087D = repeated header
|
|
|
|
|
|
|
|
// offset: 2; size: 2
|
|
|
|
|
|
|
|
// offset: 4; size: 8; not used
|
|
|
|
|
|
|
|
// offset: 12; size: 2; record version
|
|
|
|
|
|
|
|
// offset: 14; size: 2; index to XF record which this record modifies
|
2015-05-20 18:17:17 +00:00
|
|
|
$ixfe = self::getInt2d($recordData, 14);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 16; size: 2; not used
|
|
|
|
|
|
|
|
// offset: 18; size: 2; number of extension properties that follow
|
2015-05-20 18:17:17 +00:00
|
|
|
$cexts = self::getInt2d($recordData, 18);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// start reading the actual extension data
|
|
|
|
$offset = 20;
|
|
|
|
while ($offset < $length) {
|
|
|
|
// extension type
|
2015-05-20 18:17:17 +00:00
|
|
|
$extType = self::getInt2d($recordData, $offset);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// extension length
|
2015-05-20 18:17:17 +00:00
|
|
|
$cb = self::getInt2d($recordData, $offset + 2);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// extension data
|
|
|
|
$extData = substr($recordData, $offset + 4, $cb);
|
|
|
|
|
|
|
|
switch ($extType) {
|
|
|
|
case 4: // fill start color
|
2015-05-20 18:17:17 +00:00
|
|
|
$xclfType = self::getInt2d($extData, 0); // color type
|
2015-05-17 16:10:35 +00:00
|
|
|
$xclrValue = substr($extData, 4, 4); // color value (value based on color type)
|
|
|
|
|
|
|
|
if ($xclfType == 2) {
|
|
|
|
$rgb = sprintf('%02X%02X%02X', ord($xclrValue{0}), ord($xclrValue{1}), ord($xclrValue{2}));
|
|
|
|
|
|
|
|
// modify the relevant style property
|
2015-05-20 18:17:17 +00:00
|
|
|
if (isset($this->mapCellXfIndex[$ixfe])) {
|
|
|
|
$fill = $this->phpExcel->getCellXfByIndex($this->mapCellXfIndex[$ixfe])->getFill();
|
2015-05-17 16:10:35 +00:00
|
|
|
$fill->getStartColor()->setRGB($rgb);
|
|
|
|
unset($fill->startcolorIndex); // normal color index does not apply, discard
|
|
|
|
}
|
|
|
|
}
|
|
|
|
break;
|
|
|
|
case 5: // fill end color
|
2015-05-20 18:17:17 +00:00
|
|
|
$xclfType = self::getInt2d($extData, 0); // color type
|
2015-05-17 16:10:35 +00:00
|
|
|
$xclrValue = substr($extData, 4, 4); // color value (value based on color type)
|
|
|
|
|
|
|
|
if ($xclfType == 2) {
|
|
|
|
$rgb = sprintf('%02X%02X%02X', ord($xclrValue{0}), ord($xclrValue{1}), ord($xclrValue{2}));
|
|
|
|
|
|
|
|
// modify the relevant style property
|
2015-05-20 18:17:17 +00:00
|
|
|
if (isset($this->mapCellXfIndex[$ixfe])) {
|
|
|
|
$fill = $this->phpExcel->getCellXfByIndex($this->mapCellXfIndex[$ixfe])->getFill();
|
2015-05-17 16:10:35 +00:00
|
|
|
$fill->getEndColor()->setRGB($rgb);
|
|
|
|
unset($fill->endcolorIndex); // normal color index does not apply, discard
|
|
|
|
}
|
|
|
|
}
|
|
|
|
break;
|
|
|
|
case 7: // border color top
|
2015-05-20 18:17:17 +00:00
|
|
|
$xclfType = self::getInt2d($extData, 0); // color type
|
2015-05-17 16:10:35 +00:00
|
|
|
$xclrValue = substr($extData, 4, 4); // color value (value based on color type)
|
|
|
|
|
|
|
|
if ($xclfType == 2) {
|
|
|
|
$rgb = sprintf('%02X%02X%02X', ord($xclrValue{0}), ord($xclrValue{1}), ord($xclrValue{2}));
|
|
|
|
|
|
|
|
// modify the relevant style property
|
2015-05-20 18:17:17 +00:00
|
|
|
if (isset($this->mapCellXfIndex[$ixfe])) {
|
|
|
|
$top = $this->phpExcel->getCellXfByIndex($this->mapCellXfIndex[$ixfe])->getBorders()->getTop();
|
2015-05-17 16:10:35 +00:00
|
|
|
$top->getColor()->setRGB($rgb);
|
|
|
|
unset($top->colorIndex); // normal color index does not apply, discard
|
|
|
|
}
|
|
|
|
}
|
|
|
|
break;
|
|
|
|
case 8: // border color bottom
|
2015-05-20 18:17:17 +00:00
|
|
|
$xclfType = self::getInt2d($extData, 0); // color type
|
2015-05-17 16:10:35 +00:00
|
|
|
$xclrValue = substr($extData, 4, 4); // color value (value based on color type)
|
|
|
|
|
|
|
|
if ($xclfType == 2) {
|
|
|
|
$rgb = sprintf('%02X%02X%02X', ord($xclrValue{0}), ord($xclrValue{1}), ord($xclrValue{2}));
|
|
|
|
|
|
|
|
// modify the relevant style property
|
2015-05-20 18:17:17 +00:00
|
|
|
if (isset($this->mapCellXfIndex[$ixfe])) {
|
|
|
|
$bottom = $this->phpExcel->getCellXfByIndex($this->mapCellXfIndex[$ixfe])->getBorders()->getBottom();
|
2015-05-17 16:10:35 +00:00
|
|
|
$bottom->getColor()->setRGB($rgb);
|
|
|
|
unset($bottom->colorIndex); // normal color index does not apply, discard
|
|
|
|
}
|
|
|
|
}
|
|
|
|
break;
|
|
|
|
case 9: // border color left
|
2015-05-20 18:17:17 +00:00
|
|
|
$xclfType = self::getInt2d($extData, 0); // color type
|
2015-05-17 16:10:35 +00:00
|
|
|
$xclrValue = substr($extData, 4, 4); // color value (value based on color type)
|
|
|
|
|
|
|
|
if ($xclfType == 2) {
|
|
|
|
$rgb = sprintf('%02X%02X%02X', ord($xclrValue{0}), ord($xclrValue{1}), ord($xclrValue{2}));
|
|
|
|
|
|
|
|
// modify the relevant style property
|
2015-05-20 18:17:17 +00:00
|
|
|
if (isset($this->mapCellXfIndex[$ixfe])) {
|
|
|
|
$left = $this->phpExcel->getCellXfByIndex($this->mapCellXfIndex[$ixfe])->getBorders()->getLeft();
|
2015-05-17 16:10:35 +00:00
|
|
|
$left->getColor()->setRGB($rgb);
|
|
|
|
unset($left->colorIndex); // normal color index does not apply, discard
|
|
|
|
}
|
|
|
|
}
|
|
|
|
break;
|
|
|
|
case 10: // border color right
|
2015-05-20 18:17:17 +00:00
|
|
|
$xclfType = self::getInt2d($extData, 0); // color type
|
2015-05-17 16:10:35 +00:00
|
|
|
$xclrValue = substr($extData, 4, 4); // color value (value based on color type)
|
|
|
|
|
|
|
|
if ($xclfType == 2) {
|
|
|
|
$rgb = sprintf('%02X%02X%02X', ord($xclrValue{0}), ord($xclrValue{1}), ord($xclrValue{2}));
|
|
|
|
|
|
|
|
// modify the relevant style property
|
2015-05-20 18:17:17 +00:00
|
|
|
if (isset($this->mapCellXfIndex[$ixfe])) {
|
|
|
|
$right = $this->phpExcel->getCellXfByIndex($this->mapCellXfIndex[$ixfe])->getBorders()->getRight();
|
2015-05-17 16:10:35 +00:00
|
|
|
$right->getColor()->setRGB($rgb);
|
|
|
|
unset($right->colorIndex); // normal color index does not apply, discard
|
|
|
|
}
|
|
|
|
}
|
|
|
|
break;
|
|
|
|
case 11: // border color diagonal
|
2015-05-20 18:17:17 +00:00
|
|
|
$xclfType = self::getInt2d($extData, 0); // color type
|
2015-05-17 16:10:35 +00:00
|
|
|
$xclrValue = substr($extData, 4, 4); // color value (value based on color type)
|
|
|
|
|
|
|
|
if ($xclfType == 2) {
|
|
|
|
$rgb = sprintf('%02X%02X%02X', ord($xclrValue{0}), ord($xclrValue{1}), ord($xclrValue{2}));
|
|
|
|
|
|
|
|
// modify the relevant style property
|
2015-05-20 18:17:17 +00:00
|
|
|
if (isset($this->mapCellXfIndex[$ixfe])) {
|
|
|
|
$diagonal = $this->phpExcel->getCellXfByIndex($this->mapCellXfIndex[$ixfe])->getBorders()->getDiagonal();
|
2015-05-17 16:10:35 +00:00
|
|
|
$diagonal->getColor()->setRGB($rgb);
|
|
|
|
unset($diagonal->colorIndex); // normal color index does not apply, discard
|
|
|
|
}
|
|
|
|
}
|
|
|
|
break;
|
|
|
|
case 13: // font color
|
2015-05-20 18:17:17 +00:00
|
|
|
$xclfType = self::getInt2d($extData, 0); // color type
|
2015-05-17 16:10:35 +00:00
|
|
|
$xclrValue = substr($extData, 4, 4); // color value (value based on color type)
|
|
|
|
|
|
|
|
if ($xclfType == 2) {
|
|
|
|
$rgb = sprintf('%02X%02X%02X', ord($xclrValue{0}), ord($xclrValue{1}), ord($xclrValue{2}));
|
|
|
|
|
|
|
|
// modify the relevant style property
|
2015-05-20 18:17:17 +00:00
|
|
|
if (isset($this->mapCellXfIndex[$ixfe])) {
|
|
|
|
$font = $this->phpExcel->getCellXfByIndex($this->mapCellXfIndex[$ixfe])->getFont();
|
2015-05-17 16:10:35 +00:00
|
|
|
$font->getColor()->setRGB($rgb);
|
|
|
|
unset($font->colorIndex); // normal color index does not apply, discard
|
|
|
|
}
|
|
|
|
}
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
|
|
|
|
$offset += $cb;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read STYLE record
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readStyle()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!$this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 0; size: 2; index to XF record and flag for built-in style
|
2015-05-20 18:17:17 +00:00
|
|
|
$ixfe = self::getInt2d($recordData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 11-0; mask 0x0FFF; index to XF record
|
|
|
|
$xfIndex = (0x0FFF & $ixfe) >> 0;
|
|
|
|
|
|
|
|
// bit: 15; mask 0x8000; 0 = user-defined style, 1 = built-in style
|
|
|
|
$isBuiltIn = (bool) ((0x8000 & $ixfe) >> 15);
|
|
|
|
|
|
|
|
if ($isBuiltIn) {
|
|
|
|
// offset: 2; size: 1; identifier for built-in style
|
|
|
|
$builtInId = ord($recordData{2});
|
|
|
|
|
|
|
|
switch ($builtInId) {
|
|
|
|
case 0x00:
|
|
|
|
// currently, we are not using this for anything
|
|
|
|
break;
|
|
|
|
default:
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
} else {
|
|
|
|
// user-defined; not supported by PHPExcel
|
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read PALETTE record
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readPalette()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!$this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 0; size: 2; number of following colors
|
2015-05-20 18:17:17 +00:00
|
|
|
$nm = self::getInt2d($recordData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// list of RGB colors
|
|
|
|
for ($i = 0; $i < $nm; ++$i) {
|
|
|
|
$rgb = substr($recordData, 2 + 4 * $i, 4);
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->palette[] = self::readRGB($rgb);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* SHEET
|
|
|
|
*
|
|
|
|
* This record is located in the Workbook Globals
|
|
|
|
* Substream and represents a sheet inside the workbook.
|
|
|
|
* One SHEET record is written for each sheet. It stores the
|
|
|
|
* sheet name and a stream offset to the BOF record of the
|
|
|
|
* respective Sheet Substream within the Workbook Stream.
|
|
|
|
*
|
|
|
|
* -- "OpenOffice.org's Documentation of the Microsoft
|
|
|
|
* Excel File Format"
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readSheet()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 0; size: 4; absolute stream position of the BOF record of the sheet
|
|
|
|
// NOTE: not encrypted
|
2015-05-20 18:17:17 +00:00
|
|
|
$rec_offset = self::getInt4d($this->data, $this->pos + 4);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 4; size: 1; sheet state
|
|
|
|
switch (ord($recordData{4})) {
|
|
|
|
case 0x00:
|
|
|
|
$sheetState = PHPExcel_Worksheet::SHEETSTATE_VISIBLE;
|
|
|
|
break;
|
|
|
|
case 0x01:
|
|
|
|
$sheetState = PHPExcel_Worksheet::SHEETSTATE_HIDDEN;
|
|
|
|
break;
|
|
|
|
case 0x02:
|
|
|
|
$sheetState = PHPExcel_Worksheet::SHEETSTATE_VERYHIDDEN;
|
|
|
|
break;
|
|
|
|
default:
|
|
|
|
$sheetState = PHPExcel_Worksheet::SHEETSTATE_VISIBLE;
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
|
|
|
|
// offset: 5; size: 1; sheet type
|
|
|
|
$sheetType = ord($recordData{5});
|
|
|
|
|
|
|
|
// offset: 6; size: var; sheet name
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($this->version == self::XLS_BIFF8) {
|
|
|
|
$string = self::readUnicodeStringShort(substr($recordData, 6));
|
2015-05-17 16:10:35 +00:00
|
|
|
$rec_name = $string['value'];
|
2015-05-20 18:17:17 +00:00
|
|
|
} elseif ($this->version == self::XLS_BIFF7) {
|
|
|
|
$string = $this->readByteStringShort(substr($recordData, 6));
|
2015-05-17 16:10:35 +00:00
|
|
|
$rec_name = $string['value'];
|
|
|
|
}
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->sheets[] = array(
|
2015-05-17 16:10:35 +00:00
|
|
|
'name' => $rec_name,
|
|
|
|
'offset' => $rec_offset,
|
|
|
|
'sheetState' => $sheetState,
|
|
|
|
'sheetType' => $sheetType,
|
|
|
|
);
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read EXTERNALBOOK record
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readExternalBook()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset within record data
|
|
|
|
$offset = 0;
|
|
|
|
|
|
|
|
// there are 4 types of records
|
|
|
|
if (strlen($recordData) > 4) {
|
|
|
|
// external reference
|
|
|
|
// offset: 0; size: 2; number of sheet names ($nm)
|
2015-05-20 18:17:17 +00:00
|
|
|
$nm = self::getInt2d($recordData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
$offset += 2;
|
|
|
|
|
|
|
|
// offset: 2; size: var; encoded URL without sheet name (Unicode string, 16-bit length)
|
2015-05-20 18:17:17 +00:00
|
|
|
$encodedUrlString = self::readUnicodeStringLong(substr($recordData, 2));
|
2015-05-17 16:10:35 +00:00
|
|
|
$offset += $encodedUrlString['size'];
|
|
|
|
|
|
|
|
// offset: var; size: var; list of $nm sheet names (Unicode strings, 16-bit length)
|
|
|
|
$externalSheetNames = array();
|
|
|
|
for ($i = 0; $i < $nm; ++$i) {
|
2015-05-20 18:17:17 +00:00
|
|
|
$externalSheetNameString = self::readUnicodeStringLong(substr($recordData, $offset));
|
2015-05-17 16:10:35 +00:00
|
|
|
$externalSheetNames[] = $externalSheetNameString['value'];
|
|
|
|
$offset += $externalSheetNameString['size'];
|
|
|
|
}
|
|
|
|
|
|
|
|
// store the record data
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->externalBooks[] = array(
|
2015-05-17 16:10:35 +00:00
|
|
|
'type' => 'external',
|
|
|
|
'encodedUrl' => $encodedUrlString['value'],
|
|
|
|
'externalSheetNames' => $externalSheetNames,
|
|
|
|
);
|
|
|
|
} elseif (substr($recordData, 2, 2) == pack('CC', 0x01, 0x04)) {
|
|
|
|
// internal reference
|
|
|
|
// offset: 0; size: 2; number of sheet in this document
|
|
|
|
// offset: 2; size: 2; 0x01 0x04
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->externalBooks[] = array(
|
2015-05-17 16:10:35 +00:00
|
|
|
'type' => 'internal',
|
|
|
|
);
|
|
|
|
} elseif (substr($recordData, 0, 4) == pack('vCC', 0x0001, 0x01, 0x3A)) {
|
|
|
|
// add-in function
|
|
|
|
// offset: 0; size: 2; 0x0001
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->externalBooks[] = array(
|
2015-05-17 16:10:35 +00:00
|
|
|
'type' => 'addInFunction',
|
|
|
|
);
|
|
|
|
} elseif (substr($recordData, 0, 2) == pack('v', 0x0000)) {
|
|
|
|
// DDE links, OLE links
|
|
|
|
// offset: 0; size: 2; 0x0000
|
|
|
|
// offset: 2; size: var; encoded source document name
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->externalBooks[] = array(
|
2015-05-17 16:10:35 +00:00
|
|
|
'type' => 'DDEorOLE',
|
|
|
|
);
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read EXTERNNAME record.
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readExternName()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// external sheet references provided for named cells
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($this->version == self::XLS_BIFF8) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 0; size: 2; options
|
2015-05-20 18:17:17 +00:00
|
|
|
$options = self::getInt2d($recordData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 2; size: 2;
|
|
|
|
|
|
|
|
// offset: 4; size: 2; not used
|
|
|
|
|
|
|
|
// offset: 6; size: var
|
2015-05-20 18:17:17 +00:00
|
|
|
$nameString = self::readUnicodeStringShort(substr($recordData, 6));
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: var; size: var; formula data
|
|
|
|
$offset = 6 + $nameString['size'];
|
2015-05-20 18:17:17 +00:00
|
|
|
$formula = $this->getFormulaFromStructure(substr($recordData, $offset));
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->externalNames[] = array(
|
2015-05-17 16:10:35 +00:00
|
|
|
'name' => $nameString['value'],
|
|
|
|
'formula' => $formula,
|
|
|
|
);
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read EXTERNSHEET record
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readExternSheet()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// external sheet references provided for named cells
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($this->version == self::XLS_BIFF8) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 0; size: 2; number of following ref structures
|
2015-05-20 18:17:17 +00:00
|
|
|
$nm = self::getInt2d($recordData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
for ($i = 0; $i < $nm; ++$i) {
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->ref[] = array(
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 2 + 6 * $i; index to EXTERNALBOOK record
|
2015-05-20 18:17:17 +00:00
|
|
|
'externalBookIndex' => self::getInt2d($recordData, 2 + 6 * $i),
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 4 + 6 * $i; index to first sheet in EXTERNALBOOK record
|
2015-05-20 18:17:17 +00:00
|
|
|
'firstSheetIndex' => self::getInt2d($recordData, 4 + 6 * $i),
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 6 + 6 * $i; index to last sheet in EXTERNALBOOK record
|
2015-05-20 18:17:17 +00:00
|
|
|
'lastSheetIndex' => self::getInt2d($recordData, 6 + 6 * $i),
|
2015-05-17 16:10:35 +00:00
|
|
|
);
|
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* DEFINEDNAME
|
|
|
|
*
|
|
|
|
* This record is part of a Link Table. It contains the name
|
|
|
|
* and the token array of an internal defined name. Token
|
|
|
|
* arrays of defined names contain tokens with aberrant
|
|
|
|
* token classes.
|
|
|
|
*
|
|
|
|
* -- "OpenOffice.org's Documentation of the Microsoft
|
|
|
|
* Excel File Format"
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readDefinedName()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($this->version == self::XLS_BIFF8) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// retrieves named cells
|
|
|
|
|
|
|
|
// offset: 0; size: 2; option flags
|
2015-05-20 18:17:17 +00:00
|
|
|
$opts = self::getInt2d($recordData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 5; mask: 0x0020; 0 = user-defined name, 1 = built-in-name
|
|
|
|
$isBuiltInName = (0x0020 & $opts) >> 5;
|
|
|
|
|
|
|
|
// offset: 2; size: 1; keyboard shortcut
|
|
|
|
|
|
|
|
// offset: 3; size: 1; length of the name (character count)
|
|
|
|
$nlen = ord($recordData{3});
|
|
|
|
|
|
|
|
// offset: 4; size: 2; size of the formula data (it can happen that this is zero)
|
|
|
|
// note: there can also be additional data, this is not included in $flen
|
2015-05-20 18:17:17 +00:00
|
|
|
$flen = self::getInt2d($recordData, 4);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 8; size: 2; 0=Global name, otherwise index to sheet (1-based)
|
2015-05-20 18:17:17 +00:00
|
|
|
$scope = self::getInt2d($recordData, 8);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 14; size: var; Name (Unicode string without length field)
|
2015-05-20 18:17:17 +00:00
|
|
|
$string = self::readUnicodeString(substr($recordData, 14), $nlen);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: var; size: $flen; formula data
|
|
|
|
$offset = 14 + $string['size'];
|
|
|
|
$formulaStructure = pack('v', $flen) . substr($recordData, $offset);
|
|
|
|
|
|
|
|
try {
|
2015-05-20 18:17:17 +00:00
|
|
|
$formula = $this->getFormulaFromStructure($formulaStructure);
|
2015-05-17 16:10:35 +00:00
|
|
|
} catch (PHPExcel_Exception $e) {
|
|
|
|
$formula = '';
|
|
|
|
}
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->definedname[] = array(
|
2015-05-17 16:10:35 +00:00
|
|
|
'isBuiltInName' => $isBuiltInName,
|
|
|
|
'name' => $string['value'],
|
|
|
|
'formula' => $formula,
|
|
|
|
'scope' => $scope,
|
|
|
|
);
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read MSODRAWINGGROUP record
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readMsoDrawingGroup()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// get spliced record data
|
2015-05-20 18:17:17 +00:00
|
|
|
$splicedRecordData = $this->getSplicedRecordData();
|
2015-05-17 16:10:35 +00:00
|
|
|
$recordData = $splicedRecordData['recordData'];
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->drawingGroupData .= $recordData;
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* SST - Shared String Table
|
|
|
|
*
|
|
|
|
* This record contains a list of all strings used anywhere
|
|
|
|
* in the workbook. Each string occurs only once. The
|
|
|
|
* workbook uses indexes into the list to reference the
|
|
|
|
* strings.
|
|
|
|
*
|
|
|
|
* -- "OpenOffice.org's Documentation of the Microsoft
|
|
|
|
* Excel File Format"
|
|
|
|
**/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readSst()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
// offset within (spliced) record data
|
|
|
|
$pos = 0;
|
|
|
|
|
|
|
|
// get spliced record data
|
2015-05-20 18:17:17 +00:00
|
|
|
$splicedRecordData = $this->getSplicedRecordData();
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
$recordData = $splicedRecordData['recordData'];
|
|
|
|
$spliceOffsets = $splicedRecordData['spliceOffsets'];
|
|
|
|
|
|
|
|
// offset: 0; size: 4; total number of strings in the workbook
|
|
|
|
$pos += 4;
|
|
|
|
|
|
|
|
// offset: 4; size: 4; number of following strings ($nm)
|
2015-05-20 18:17:17 +00:00
|
|
|
$nm = self::getInt4d($recordData, 4);
|
2015-05-17 16:10:35 +00:00
|
|
|
$pos += 4;
|
|
|
|
|
|
|
|
// loop through the Unicode strings (16-bit length)
|
|
|
|
for ($i = 0; $i < $nm; ++$i) {
|
|
|
|
// number of characters in the Unicode string
|
2015-05-20 18:17:17 +00:00
|
|
|
$numChars = self::getInt2d($recordData, $pos);
|
2015-05-17 16:10:35 +00:00
|
|
|
$pos += 2;
|
|
|
|
|
|
|
|
// option flags
|
|
|
|
$optionFlags = ord($recordData{$pos});
|
|
|
|
++$pos;
|
|
|
|
|
|
|
|
// bit: 0; mask: 0x01; 0 = compressed; 1 = uncompressed
|
|
|
|
$isCompressed = (($optionFlags & 0x01) == 0) ;
|
|
|
|
|
|
|
|
// bit: 2; mask: 0x02; 0 = ordinary; 1 = Asian phonetic
|
|
|
|
$hasAsian = (($optionFlags & 0x04) != 0);
|
|
|
|
|
|
|
|
// bit: 3; mask: 0x03; 0 = ordinary; 1 = Rich-Text
|
|
|
|
$hasRichText = (($optionFlags & 0x08) != 0);
|
|
|
|
|
|
|
|
if ($hasRichText) {
|
|
|
|
// number of Rich-Text formatting runs
|
2015-05-20 18:17:17 +00:00
|
|
|
$formattingRuns = self::getInt2d($recordData, $pos);
|
2015-05-17 16:10:35 +00:00
|
|
|
$pos += 2;
|
|
|
|
}
|
|
|
|
|
|
|
|
if ($hasAsian) {
|
|
|
|
// size of Asian phonetic setting
|
2015-05-20 18:17:17 +00:00
|
|
|
$extendedRunLength = self::getInt4d($recordData, $pos);
|
2015-05-17 16:10:35 +00:00
|
|
|
$pos += 4;
|
|
|
|
}
|
|
|
|
|
|
|
|
// expected byte length of character array if not split
|
|
|
|
$len = ($isCompressed) ? $numChars : $numChars * 2;
|
|
|
|
|
|
|
|
// look up limit position
|
|
|
|
foreach ($spliceOffsets as $spliceOffset) {
|
|
|
|
// it can happen that the string is empty, therefore we need
|
|
|
|
// <= and not just <
|
|
|
|
if ($pos <= $spliceOffset) {
|
|
|
|
$limitpos = $spliceOffset;
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
if ($pos + $len <= $limitpos) {
|
|
|
|
// character array is not split between records
|
|
|
|
|
|
|
|
$retstr = substr($recordData, $pos, $len);
|
|
|
|
$pos += $len;
|
|
|
|
} else {
|
|
|
|
// character array is split between records
|
|
|
|
|
|
|
|
// first part of character array
|
|
|
|
$retstr = substr($recordData, $pos, $limitpos - $pos);
|
|
|
|
|
|
|
|
$bytesRead = $limitpos - $pos;
|
|
|
|
|
|
|
|
// remaining characters in Unicode string
|
|
|
|
$charsLeft = $numChars - (($isCompressed) ? $bytesRead : ($bytesRead / 2));
|
|
|
|
|
|
|
|
$pos = $limitpos;
|
|
|
|
|
|
|
|
// keep reading the characters
|
|
|
|
while ($charsLeft > 0) {
|
|
|
|
// look up next limit position, in case the string span more than one continue record
|
|
|
|
foreach ($spliceOffsets as $spliceOffset) {
|
|
|
|
if ($pos < $spliceOffset) {
|
|
|
|
$limitpos = $spliceOffset;
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
// repeated option flags
|
|
|
|
// OpenOffice.org documentation 5.21
|
|
|
|
$option = ord($recordData{$pos});
|
|
|
|
++$pos;
|
|
|
|
|
|
|
|
if ($isCompressed && ($option == 0)) {
|
|
|
|
// 1st fragment compressed
|
|
|
|
// this fragment compressed
|
|
|
|
$len = min($charsLeft, $limitpos - $pos);
|
|
|
|
$retstr .= substr($recordData, $pos, $len);
|
|
|
|
$charsLeft -= $len;
|
|
|
|
$isCompressed = true;
|
|
|
|
} elseif (!$isCompressed && ($option != 0)) {
|
|
|
|
// 1st fragment uncompressed
|
|
|
|
// this fragment uncompressed
|
|
|
|
$len = min($charsLeft * 2, $limitpos - $pos);
|
|
|
|
$retstr .= substr($recordData, $pos, $len);
|
|
|
|
$charsLeft -= $len / 2;
|
|
|
|
$isCompressed = false;
|
|
|
|
} elseif (!$isCompressed && ($option == 0)) {
|
|
|
|
// 1st fragment uncompressed
|
|
|
|
// this fragment compressed
|
|
|
|
$len = min($charsLeft, $limitpos - $pos);
|
|
|
|
for ($j = 0; $j < $len; ++$j) {
|
|
|
|
$retstr .= $recordData{$pos + $j} . chr(0);
|
|
|
|
}
|
|
|
|
$charsLeft -= $len;
|
|
|
|
$isCompressed = false;
|
|
|
|
} else {
|
|
|
|
// 1st fragment compressed
|
|
|
|
// this fragment uncompressed
|
|
|
|
$newstr = '';
|
|
|
|
for ($j = 0; $j < strlen($retstr); ++$j) {
|
|
|
|
$newstr .= $retstr[$j] . chr(0);
|
|
|
|
}
|
|
|
|
$retstr = $newstr;
|
|
|
|
$len = min($charsLeft * 2, $limitpos - $pos);
|
|
|
|
$retstr .= substr($recordData, $pos, $len);
|
|
|
|
$charsLeft -= $len / 2;
|
|
|
|
$isCompressed = false;
|
|
|
|
}
|
|
|
|
|
|
|
|
$pos += $len;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
// convert to UTF-8
|
2015-05-20 18:17:17 +00:00
|
|
|
$retstr = self::encodeUTF16($retstr, $isCompressed);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// read additional Rich-Text information, if any
|
|
|
|
$fmtRuns = array();
|
|
|
|
if ($hasRichText) {
|
|
|
|
// list of formatting runs
|
|
|
|
for ($j = 0; $j < $formattingRuns; ++$j) {
|
|
|
|
// first formatted character; zero-based
|
2015-05-20 18:17:17 +00:00
|
|
|
$charPos = self::getInt2d($recordData, $pos + $j * 4);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// index to font record
|
2015-05-20 18:17:17 +00:00
|
|
|
$fontIndex = self::getInt2d($recordData, $pos + 2 + $j * 4);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
$fmtRuns[] = array(
|
|
|
|
'charPos' => $charPos,
|
|
|
|
'fontIndex' => $fontIndex,
|
|
|
|
);
|
|
|
|
}
|
|
|
|
$pos += 4 * $formattingRuns;
|
|
|
|
}
|
|
|
|
|
|
|
|
// read additional Asian phonetics information, if any
|
|
|
|
if ($hasAsian) {
|
|
|
|
// For Asian phonetic settings, we skip the extended string data
|
|
|
|
$pos += $extendedRunLength;
|
|
|
|
}
|
|
|
|
|
|
|
|
// store the shared sting
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->sst[] = array(
|
2015-05-17 16:10:35 +00:00
|
|
|
'value' => $retstr,
|
|
|
|
'fmtRuns' => $fmtRuns,
|
|
|
|
);
|
|
|
|
}
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
// getSplicedRecordData() takes care of moving current position in data stream
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read PRINTGRIDLINES record
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readPrintGridlines()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($this->version == self::XLS_BIFF8 && !$this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 0; size: 2; 0 = do not print sheet grid lines; 1 = print sheet gridlines
|
2015-05-20 18:17:17 +00:00
|
|
|
$printGridlines = (bool) self::getInt2d($recordData, 0);
|
|
|
|
$this->phpSheet->setPrintGridlines($printGridlines);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read DEFAULTROWHEIGHT record
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readDefaultRowHeight()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 0; size: 2; option flags
|
|
|
|
// offset: 2; size: 2; default height for unused rows, (twips 1/20 point)
|
2015-05-20 18:17:17 +00:00
|
|
|
$height = self::getInt2d($recordData, 2);
|
|
|
|
$this->phpSheet->getDefaultRowDimension()->setRowHeight($height / 20);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read SHEETPR record
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readSheetPr()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 0; size: 2
|
|
|
|
|
|
|
|
// bit: 6; mask: 0x0040; 0 = outline buttons above outline group
|
2015-05-20 18:17:17 +00:00
|
|
|
$isSummaryBelow = (0x0040 & self::getInt2d($recordData, 0)) >> 6;
|
|
|
|
$this->phpSheet->setShowSummaryBelow($isSummaryBelow);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 7; mask: 0x0080; 0 = outline buttons left of outline group
|
2015-05-20 18:17:17 +00:00
|
|
|
$isSummaryRight = (0x0080 & self::getInt2d($recordData, 0)) >> 7;
|
|
|
|
$this->phpSheet->setShowSummaryRight($isSummaryRight);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 8; mask: 0x100; 0 = scale printout in percent, 1 = fit printout to number of pages
|
|
|
|
// this corresponds to radio button setting in page setup dialog in Excel
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->isFitToPages = (bool) ((0x0100 & self::getInt2d($recordData, 0)) >> 8);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read HORIZONTALPAGEBREAKS record
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readHorizontalPageBreaks()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($this->version == self::XLS_BIFF8 && !$this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 0; size: 2; number of the following row index structures
|
2015-05-20 18:17:17 +00:00
|
|
|
$nm = self::getInt2d($recordData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 2; size: 6 * $nm; list of $nm row index structures
|
|
|
|
for ($i = 0; $i < $nm; ++$i) {
|
2015-05-20 18:17:17 +00:00
|
|
|
$r = self::getInt2d($recordData, 2 + 6 * $i);
|
|
|
|
$cf = self::getInt2d($recordData, 2 + 6 * $i + 2);
|
|
|
|
$cl = self::getInt2d($recordData, 2 + 6 * $i + 4);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// not sure why two column indexes are necessary?
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->setBreakByColumnAndRow($cf, $r, PHPExcel_Worksheet::BREAK_ROW);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read VERTICALPAGEBREAKS record
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readVerticalPageBreaks()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($this->version == self::XLS_BIFF8 && !$this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 0; size: 2; number of the following column index structures
|
2015-05-20 18:17:17 +00:00
|
|
|
$nm = self::getInt2d($recordData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 2; size: 6 * $nm; list of $nm row index structures
|
|
|
|
for ($i = 0; $i < $nm; ++$i) {
|
2015-05-20 18:17:17 +00:00
|
|
|
$c = self::getInt2d($recordData, 2 + 6 * $i);
|
|
|
|
$rf = self::getInt2d($recordData, 2 + 6 * $i + 2);
|
|
|
|
$rl = self::getInt2d($recordData, 2 + 6 * $i + 4);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// not sure why two row indexes are necessary?
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->setBreakByColumnAndRow($c, $rf, PHPExcel_Worksheet::BREAK_COLUMN);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read HEADER record
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readHeader()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!$this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 0; size: var
|
|
|
|
// realized that $recordData can be empty even when record exists
|
|
|
|
if ($recordData) {
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($this->version == self::XLS_BIFF8) {
|
|
|
|
$string = self::readUnicodeStringLong($recordData);
|
2015-05-17 16:10:35 +00:00
|
|
|
} else {
|
2015-05-20 18:17:17 +00:00
|
|
|
$string = $this->readByteStringShort($recordData);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getHeaderFooter()->setOddHeader($string['value']);
|
|
|
|
$this->phpSheet->getHeaderFooter()->setEvenHeader($string['value']);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read FOOTER record
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readFooter()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!$this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 0; size: var
|
|
|
|
// realized that $recordData can be empty even when record exists
|
|
|
|
if ($recordData) {
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($this->version == self::XLS_BIFF8) {
|
|
|
|
$string = self::readUnicodeStringLong($recordData);
|
2015-05-17 16:10:35 +00:00
|
|
|
} else {
|
2015-05-20 18:17:17 +00:00
|
|
|
$string = $this->readByteStringShort($recordData);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getHeaderFooter()->setOddFooter($string['value']);
|
|
|
|
$this->phpSheet->getHeaderFooter()->setEvenFooter($string['value']);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read HCENTER record
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readHcenter()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!$this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 0; size: 2; 0 = print sheet left aligned, 1 = print sheet centered horizontally
|
2015-05-20 18:17:17 +00:00
|
|
|
$isHorizontalCentered = (bool) self::getInt2d($recordData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getPageSetup()->setHorizontalCentered($isHorizontalCentered);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read VCENTER record
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readVcenter()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!$this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 0; size: 2; 0 = print sheet aligned at top page border, 1 = print sheet vertically centered
|
2015-05-20 18:17:17 +00:00
|
|
|
$isVerticalCentered = (bool) self::getInt2d($recordData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getPageSetup()->setVerticalCentered($isVerticalCentered);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read LEFTMARGIN record
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readLeftMargin()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!$this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 0; size: 8
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getPageMargins()->setLeft(self::extractNumber($recordData));
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read RIGHTMARGIN record
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readRightMargin()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!$this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 0; size: 8
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getPageMargins()->setRight(self::extractNumber($recordData));
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read TOPMARGIN record
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readTopMargin()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!$this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 0; size: 8
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getPageMargins()->setTop(self::extractNumber($recordData));
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read BOTTOMMARGIN record
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readBottomMargin()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!$this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 0; size: 8
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getPageMargins()->setBottom(self::extractNumber($recordData));
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read PAGESETUP record
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readPageSetup()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!$this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 0; size: 2; paper size
|
2015-05-20 18:17:17 +00:00
|
|
|
$paperSize = self::getInt2d($recordData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 2; size: 2; scaling factor
|
2015-05-20 18:17:17 +00:00
|
|
|
$scale = self::getInt2d($recordData, 2);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 6; size: 2; fit worksheet width to this number of pages, 0 = use as many as needed
|
2015-05-20 18:17:17 +00:00
|
|
|
$fitToWidth = self::getInt2d($recordData, 6);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 8; size: 2; fit worksheet height to this number of pages, 0 = use as many as needed
|
2015-05-20 18:17:17 +00:00
|
|
|
$fitToHeight = self::getInt2d($recordData, 8);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 10; size: 2; option flags
|
|
|
|
|
|
|
|
// bit: 1; mask: 0x0002; 0=landscape, 1=portrait
|
2015-05-20 18:17:17 +00:00
|
|
|
$isPortrait = (0x0002 & self::getInt2d($recordData, 10)) >> 1;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 2; mask: 0x0004; 1= paper size, scaling factor, paper orient. not init
|
|
|
|
// when this bit is set, do not use flags for those properties
|
2015-05-20 18:17:17 +00:00
|
|
|
$isNotInit = (0x0004 & self::getInt2d($recordData, 10)) >> 2;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
if (!$isNotInit) {
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getPageSetup()->setPaperSize($paperSize);
|
2015-05-17 16:10:35 +00:00
|
|
|
switch ($isPortrait) {
|
|
|
|
case 0:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getPageSetup()->setOrientation(PHPExcel_Worksheet_PageSetup::ORIENTATION_LANDSCAPE);
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case 1:
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getPageSetup()->setOrientation(PHPExcel_Worksheet_PageSetup::ORIENTATION_PORTRAIT);
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
}
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getPageSetup()->setScale($scale, false);
|
|
|
|
$this->phpSheet->getPageSetup()->setFitToPage((bool) $this->isFitToPages);
|
|
|
|
$this->phpSheet->getPageSetup()->setFitToWidth($fitToWidth, false);
|
|
|
|
$this->phpSheet->getPageSetup()->setFitToHeight($fitToHeight, false);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
// offset: 16; size: 8; header margin (IEEE 754 floating-point value)
|
2015-05-20 18:17:17 +00:00
|
|
|
$marginHeader = self::extractNumber(substr($recordData, 16, 8));
|
|
|
|
$this->phpSheet->getPageMargins()->setHeader($marginHeader);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 24; size: 8; footer margin (IEEE 754 floating-point value)
|
2015-05-20 18:17:17 +00:00
|
|
|
$marginFooter = self::extractNumber(substr($recordData, 24, 8));
|
|
|
|
$this->phpSheet->getPageMargins()->setFooter($marginFooter);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* PROTECT - Sheet protection (BIFF2 through BIFF8)
|
|
|
|
* if this record is omitted, then it also means no sheet protection
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readProtect()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
return;
|
|
|
|
}
|
|
|
|
|
|
|
|
// offset: 0; size: 2;
|
|
|
|
|
|
|
|
// bit 0, mask 0x01; 1 = sheet is protected
|
2015-05-20 18:17:17 +00:00
|
|
|
$bool = (0x01 & self::getInt2d($recordData, 0)) >> 0;
|
|
|
|
$this->phpSheet->getProtection()->setSheet((bool)$bool);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* SCENPROTECT
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readScenProtect()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
return;
|
|
|
|
}
|
|
|
|
|
|
|
|
// offset: 0; size: 2;
|
|
|
|
|
|
|
|
// bit: 0, mask 0x01; 1 = scenarios are protected
|
2015-05-20 18:17:17 +00:00
|
|
|
$bool = (0x01 & self::getInt2d($recordData, 0)) >> 0;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getProtection()->setScenarios((bool)$bool);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* OBJECTPROTECT
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readObjectProtect()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
return;
|
|
|
|
}
|
|
|
|
|
|
|
|
// offset: 0; size: 2;
|
|
|
|
|
|
|
|
// bit: 0, mask 0x01; 1 = objects are protected
|
2015-05-20 18:17:17 +00:00
|
|
|
$bool = (0x01 & self::getInt2d($recordData, 0)) >> 0;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getProtection()->setObjects((bool)$bool);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* PASSWORD - Sheet protection (hashed) password (BIFF2 through BIFF8)
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readPassword()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!$this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 0; size: 2; 16-bit hash value of password
|
2015-05-20 18:17:17 +00:00
|
|
|
$password = strtoupper(dechex(self::getInt2d($recordData, 0))); // the hashed password
|
|
|
|
$this->phpSheet->getProtection()->setPassword($password, true);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read DEFCOLWIDTH record
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readDefColWidth()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 0; size: 2; default column width
|
2015-05-20 18:17:17 +00:00
|
|
|
$width = self::getInt2d($recordData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
if ($width != 8) {
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getDefaultColumnDimension()->setWidth($width);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read COLINFO record
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readColInfo()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!$this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 0; size: 2; index to first column in range
|
2015-05-20 18:17:17 +00:00
|
|
|
$fc = self::getInt2d($recordData, 0); // first column index
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 2; size: 2; index to last column in range
|
2015-05-20 18:17:17 +00:00
|
|
|
$lc = self::getInt2d($recordData, 2); // first column index
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 4; size: 2; width of the column in 1/256 of the width of the zero character
|
2015-05-20 18:17:17 +00:00
|
|
|
$width = self::getInt2d($recordData, 4);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 6; size: 2; index to XF record for default column formatting
|
2015-05-20 18:17:17 +00:00
|
|
|
$xfIndex = self::getInt2d($recordData, 6);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 8; size: 2; option flags
|
|
|
|
// bit: 0; mask: 0x0001; 1= columns are hidden
|
2015-05-20 18:17:17 +00:00
|
|
|
$isHidden = (0x0001 & self::getInt2d($recordData, 8)) >> 0;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 10-8; mask: 0x0700; outline level of the columns (0 = no outline)
|
2015-05-20 18:17:17 +00:00
|
|
|
$level = (0x0700 & self::getInt2d($recordData, 8)) >> 8;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 12; mask: 0x1000; 1 = collapsed
|
2015-05-20 18:17:17 +00:00
|
|
|
$isCollapsed = (0x1000 & self::getInt2d($recordData, 8)) >> 12;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 10; size: 2; not used
|
|
|
|
|
|
|
|
for ($i = $fc; $i <= $lc; ++$i) {
|
|
|
|
if ($lc == 255 || $lc == 256) {
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getDefaultColumnDimension()->setWidth($width / 256);
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
}
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getColumnDimensionByColumn($i)->setWidth($width / 256);
|
|
|
|
$this->phpSheet->getColumnDimensionByColumn($i)->setVisible(!$isHidden);
|
|
|
|
$this->phpSheet->getColumnDimensionByColumn($i)->setOutlineLevel($level);
|
|
|
|
$this->phpSheet->getColumnDimensionByColumn($i)->setCollapsed($isCollapsed);
|
|
|
|
$this->phpSheet->getColumnDimensionByColumn($i)->setXfIndex($this->mapCellXfIndex[$xfIndex]);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* ROW
|
|
|
|
*
|
|
|
|
* This record contains the properties of a single row in a
|
|
|
|
* sheet. Rows and cells in a sheet are divided into blocks
|
|
|
|
* of 32 rows.
|
|
|
|
*
|
|
|
|
* -- "OpenOffice.org's Documentation of the Microsoft
|
|
|
|
* Excel File Format"
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readRow()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!$this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 0; size: 2; index of this row
|
2015-05-20 18:17:17 +00:00
|
|
|
$r = self::getInt2d($recordData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 2; size: 2; index to column of the first cell which is described by a cell record
|
|
|
|
|
|
|
|
// offset: 4; size: 2; index to column of the last cell which is described by a cell record, increased by 1
|
|
|
|
|
|
|
|
// offset: 6; size: 2;
|
|
|
|
|
|
|
|
// bit: 14-0; mask: 0x7FFF; height of the row, in twips = 1/20 of a point
|
2015-05-20 18:17:17 +00:00
|
|
|
$height = (0x7FFF & self::getInt2d($recordData, 6)) >> 0;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 15: mask: 0x8000; 0 = row has custom height; 1= row has default height
|
2015-05-20 18:17:17 +00:00
|
|
|
$useDefaultHeight = (0x8000 & self::getInt2d($recordData, 6)) >> 15;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
if (!$useDefaultHeight) {
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getRowDimension($r + 1)->setRowHeight($height / 20);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
// offset: 8; size: 2; not used
|
|
|
|
|
|
|
|
// offset: 10; size: 2; not used in BIFF5-BIFF8
|
|
|
|
|
|
|
|
// offset: 12; size: 4; option flags and default row formatting
|
|
|
|
|
|
|
|
// bit: 2-0: mask: 0x00000007; outline level of the row
|
2015-05-20 18:17:17 +00:00
|
|
|
$level = (0x00000007 & self::getInt4d($recordData, 12)) >> 0;
|
|
|
|
$this->phpSheet->getRowDimension($r + 1)->setOutlineLevel($level);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 4; mask: 0x00000010; 1 = outline group start or ends here... and is collapsed
|
2015-05-20 18:17:17 +00:00
|
|
|
$isCollapsed = (0x00000010 & self::getInt4d($recordData, 12)) >> 4;
|
|
|
|
$this->phpSheet->getRowDimension($r + 1)->setCollapsed($isCollapsed);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 5; mask: 0x00000020; 1 = row is hidden
|
2015-05-20 18:17:17 +00:00
|
|
|
$isHidden = (0x00000020 & self::getInt4d($recordData, 12)) >> 5;
|
|
|
|
$this->phpSheet->getRowDimension($r + 1)->setVisible(!$isHidden);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 7; mask: 0x00000080; 1 = row has explicit format
|
2015-05-20 18:17:17 +00:00
|
|
|
$hasExplicitFormat = (0x00000080 & self::getInt4d($recordData, 12)) >> 7;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 27-16; mask: 0x0FFF0000; only applies when hasExplicitFormat = 1; index to XF record
|
2015-05-20 18:17:17 +00:00
|
|
|
$xfIndex = (0x0FFF0000 & self::getInt4d($recordData, 12)) >> 16;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
if ($hasExplicitFormat) {
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getRowDimension($r + 1)->setXfIndex($this->mapCellXfIndex[$xfIndex]);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read RK record
|
|
|
|
* This record represents a cell that contains an RK value
|
|
|
|
* (encoded integer or floating-point value). If a
|
|
|
|
* floating-point value cannot be encoded to an RK value,
|
|
|
|
* a NUMBER record will be written. This record replaces the
|
|
|
|
* record INTEGER written in BIFF2.
|
|
|
|
*
|
|
|
|
* -- "OpenOffice.org's Documentation of the Microsoft
|
|
|
|
* Excel File Format"
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readRk()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 0; size: 2; index to row
|
2015-05-20 18:17:17 +00:00
|
|
|
$row = self::getInt2d($recordData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 2; size: 2; index to column
|
2015-05-20 18:17:17 +00:00
|
|
|
$column = self::getInt2d($recordData, 2);
|
2015-05-17 16:10:35 +00:00
|
|
|
$columnString = PHPExcel_Cell::stringFromColumnIndex($column);
|
|
|
|
|
|
|
|
// Read cell?
|
2015-05-20 18:17:17 +00:00
|
|
|
if (($this->getReadFilter() !== null) && $this->getReadFilter()->readCell($columnString, $row + 1, $this->phpSheet->getTitle())) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 4; size: 2; index to XF record
|
2015-05-20 18:17:17 +00:00
|
|
|
$xfIndex = self::getInt2d($recordData, 4);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 6; size: 4; RK value
|
2015-05-20 18:17:17 +00:00
|
|
|
$rknum = self::getInt4d($recordData, 6);
|
|
|
|
$numValue = self::getIEEE754($rknum);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$cell = $this->phpSheet->getCell($columnString . ($row + 1));
|
|
|
|
if (!$this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// add style information
|
2015-05-20 18:17:17 +00:00
|
|
|
$cell->setXfIndex($this->mapCellXfIndex[$xfIndex]);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
// add cell
|
|
|
|
$cell->setValueExplicit($numValue, PHPExcel_Cell_DataType::TYPE_NUMERIC);
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read LABELSST record
|
|
|
|
* This record represents a cell that contains a string. It
|
|
|
|
* replaces the LABEL record and RSTRING record used in
|
|
|
|
* BIFF2-BIFF5.
|
|
|
|
*
|
|
|
|
* -- "OpenOffice.org's Documentation of the Microsoft
|
|
|
|
* Excel File Format"
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readLabelSst()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 0; size: 2; index to row
|
2015-05-20 18:17:17 +00:00
|
|
|
$row = self::getInt2d($recordData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 2; size: 2; index to column
|
2015-05-20 18:17:17 +00:00
|
|
|
$column = self::getInt2d($recordData, 2);
|
2015-05-17 16:10:35 +00:00
|
|
|
$columnString = PHPExcel_Cell::stringFromColumnIndex($column);
|
|
|
|
|
|
|
|
// Read cell?
|
2015-05-20 18:17:17 +00:00
|
|
|
if (($this->getReadFilter() !== null) && $this->getReadFilter()->readCell($columnString, $row + 1, $this->phpSheet->getTitle())) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 4; size: 2; index to XF record
|
2015-05-20 18:17:17 +00:00
|
|
|
$xfIndex = self::getInt2d($recordData, 4);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 6; size: 4; index to SST record
|
2015-05-20 18:17:17 +00:00
|
|
|
$index = self::getInt4d($recordData, 6);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// add cell
|
2015-05-20 18:17:17 +00:00
|
|
|
if (($fmtRuns = $this->sst[$index]['fmtRuns']) && !$this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// then we should treat as rich text
|
|
|
|
$richText = new PHPExcel_RichText();
|
|
|
|
$charPos = 0;
|
2015-05-20 18:17:17 +00:00
|
|
|
$sstCount = count($this->sst[$index]['fmtRuns']);
|
2015-05-17 16:10:35 +00:00
|
|
|
for ($i = 0; $i <= $sstCount; ++$i) {
|
|
|
|
if (isset($fmtRuns[$i])) {
|
2015-05-20 18:17:17 +00:00
|
|
|
$text = PHPExcel_Shared_String::Substring($this->sst[$index]['value'], $charPos, $fmtRuns[$i]['charPos'] - $charPos);
|
2015-05-17 16:10:35 +00:00
|
|
|
$charPos = $fmtRuns[$i]['charPos'];
|
|
|
|
} else {
|
2015-05-20 18:17:17 +00:00
|
|
|
$text = PHPExcel_Shared_String::Substring($this->sst[$index]['value'], $charPos, PHPExcel_Shared_String::CountCharacters($this->sst[$index]['value']));
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
if (PHPExcel_Shared_String::CountCharacters($text) > 0) {
|
|
|
|
if ($i == 0) { // first text run, no style
|
|
|
|
$richText->createText($text);
|
|
|
|
} else {
|
|
|
|
$textRun = $richText->createTextRun($text);
|
|
|
|
if (isset($fmtRuns[$i - 1])) {
|
|
|
|
if ($fmtRuns[$i - 1]['fontIndex'] < 4) {
|
|
|
|
$fontIndex = $fmtRuns[$i - 1]['fontIndex'];
|
|
|
|
} else {
|
|
|
|
// this has to do with that index 4 is omitted in all BIFF versions for some strange reason
|
|
|
|
// check the OpenOffice documentation of the FONT record
|
|
|
|
$fontIndex = $fmtRuns[$i - 1]['fontIndex'] - 1;
|
|
|
|
}
|
2015-05-20 18:17:17 +00:00
|
|
|
$textRun->setFont(clone $this->objFonts[$fontIndex]);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
2015-05-20 18:17:17 +00:00
|
|
|
$cell = $this->phpSheet->getCell($columnString . ($row + 1));
|
2015-05-17 16:10:35 +00:00
|
|
|
$cell->setValueExplicit($richText, PHPExcel_Cell_DataType::TYPE_STRING);
|
|
|
|
} else {
|
2015-05-20 18:17:17 +00:00
|
|
|
$cell = $this->phpSheet->getCell($columnString . ($row + 1));
|
|
|
|
$cell->setValueExplicit($this->sst[$index]['value'], PHPExcel_Cell_DataType::TYPE_STRING);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!$this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// add style information
|
2015-05-20 18:17:17 +00:00
|
|
|
$cell->setXfIndex($this->mapCellXfIndex[$xfIndex]);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read MULRK record
|
|
|
|
* This record represents a cell range containing RK value
|
|
|
|
* cells. All cells are located in the same row.
|
|
|
|
*
|
|
|
|
* -- "OpenOffice.org's Documentation of the Microsoft
|
|
|
|
* Excel File Format"
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readMulRk()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 0; size: 2; index to row
|
2015-05-20 18:17:17 +00:00
|
|
|
$row = self::getInt2d($recordData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 2; size: 2; index to first column
|
2015-05-20 18:17:17 +00:00
|
|
|
$colFirst = self::getInt2d($recordData, 2);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: var; size: 2; index to last column
|
2015-05-20 18:17:17 +00:00
|
|
|
$colLast = self::getInt2d($recordData, $length - 2);
|
2015-05-17 16:10:35 +00:00
|
|
|
$columns = $colLast - $colFirst + 1;
|
|
|
|
|
|
|
|
// offset within record data
|
|
|
|
$offset = 4;
|
|
|
|
|
|
|
|
for ($i = 0; $i < $columns; ++$i) {
|
|
|
|
$columnString = PHPExcel_Cell::stringFromColumnIndex($colFirst + $i);
|
|
|
|
|
|
|
|
// Read cell?
|
2015-05-20 18:17:17 +00:00
|
|
|
if (($this->getReadFilter() !== null) && $this->getReadFilter()->readCell($columnString, $row + 1, $this->phpSheet->getTitle())) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: var; size: 2; index to XF record
|
2015-05-20 18:17:17 +00:00
|
|
|
$xfIndex = self::getInt2d($recordData, $offset);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: var; size: 4; RK value
|
2015-05-20 18:17:17 +00:00
|
|
|
$numValue = self::getIEEE754(self::getInt4d($recordData, $offset + 2));
|
|
|
|
$cell = $this->phpSheet->getCell($columnString . ($row + 1));
|
|
|
|
if (!$this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// add style
|
2015-05-20 18:17:17 +00:00
|
|
|
$cell->setXfIndex($this->mapCellXfIndex[$xfIndex]);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
// add cell value
|
|
|
|
$cell->setValueExplicit($numValue, PHPExcel_Cell_DataType::TYPE_NUMERIC);
|
|
|
|
}
|
|
|
|
|
|
|
|
$offset += 6;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read NUMBER record
|
|
|
|
* This record represents a cell that contains a
|
|
|
|
* floating-point value.
|
|
|
|
*
|
|
|
|
* -- "OpenOffice.org's Documentation of the Microsoft
|
|
|
|
* Excel File Format"
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readNumber()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 0; size: 2; index to row
|
2015-05-20 18:17:17 +00:00
|
|
|
$row = self::getInt2d($recordData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 2; size 2; index to column
|
2015-05-20 18:17:17 +00:00
|
|
|
$column = self::getInt2d($recordData, 2);
|
2015-05-17 16:10:35 +00:00
|
|
|
$columnString = PHPExcel_Cell::stringFromColumnIndex($column);
|
|
|
|
|
|
|
|
// Read cell?
|
2015-05-20 18:17:17 +00:00
|
|
|
if (($this->getReadFilter() !== null) && $this->getReadFilter()->readCell($columnString, $row + 1, $this->phpSheet->getTitle())) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset 4; size: 2; index to XF record
|
2015-05-20 18:17:17 +00:00
|
|
|
$xfIndex = self::getInt2d($recordData, 4);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$numValue = self::extractNumber(substr($recordData, 6, 8));
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$cell = $this->phpSheet->getCell($columnString . ($row + 1));
|
|
|
|
if (!$this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// add cell style
|
2015-05-20 18:17:17 +00:00
|
|
|
$cell->setXfIndex($this->mapCellXfIndex[$xfIndex]);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
// add cell value
|
|
|
|
$cell->setValueExplicit($numValue, PHPExcel_Cell_DataType::TYPE_NUMERIC);
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read FORMULA record + perhaps a following STRING record if formula result is a string
|
|
|
|
* This record contains the token array and the result of a
|
|
|
|
* formula cell.
|
|
|
|
*
|
|
|
|
* -- "OpenOffice.org's Documentation of the Microsoft
|
|
|
|
* Excel File Format"
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readFormula()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 0; size: 2; row index
|
2015-05-20 18:17:17 +00:00
|
|
|
$row = self::getInt2d($recordData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 2; size: 2; col index
|
2015-05-20 18:17:17 +00:00
|
|
|
$column = self::getInt2d($recordData, 2);
|
2015-05-17 16:10:35 +00:00
|
|
|
$columnString = PHPExcel_Cell::stringFromColumnIndex($column);
|
|
|
|
|
|
|
|
// offset: 20: size: variable; formula structure
|
|
|
|
$formulaStructure = substr($recordData, 20);
|
|
|
|
|
|
|
|
// offset: 14: size: 2; option flags, recalculate always, recalculate on open etc.
|
2015-05-20 18:17:17 +00:00
|
|
|
$options = self::getInt2d($recordData, 14);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 0; mask: 0x0001; 1 = recalculate always
|
|
|
|
// bit: 1; mask: 0x0002; 1 = calculate on open
|
|
|
|
// bit: 2; mask: 0x0008; 1 = part of a shared formula
|
|
|
|
$isPartOfSharedFormula = (bool) (0x0008 & $options);
|
|
|
|
|
|
|
|
// WARNING:
|
|
|
|
// We can apparently not rely on $isPartOfSharedFormula. Even when $isPartOfSharedFormula = true
|
|
|
|
// the formula data may be ordinary formula data, therefore we need to check
|
|
|
|
// explicitly for the tExp token (0x01)
|
|
|
|
$isPartOfSharedFormula = $isPartOfSharedFormula && ord($formulaStructure{2}) == 0x01;
|
|
|
|
|
|
|
|
if ($isPartOfSharedFormula) {
|
|
|
|
// part of shared formula which means there will be a formula with a tExp token and nothing else
|
|
|
|
// get the base cell, grab tExp token
|
2015-05-20 18:17:17 +00:00
|
|
|
$baseRow = self::getInt2d($formulaStructure, 3);
|
|
|
|
$baseCol = self::getInt2d($formulaStructure, 5);
|
2015-05-17 16:10:35 +00:00
|
|
|
$this->_baseCell = PHPExcel_Cell::stringFromColumnIndex($baseCol). ($baseRow + 1);
|
|
|
|
}
|
|
|
|
|
|
|
|
// Read cell?
|
2015-05-20 18:17:17 +00:00
|
|
|
if (($this->getReadFilter() !== null) && $this->getReadFilter()->readCell($columnString, $row + 1, $this->phpSheet->getTitle())) {
|
2015-05-17 16:10:35 +00:00
|
|
|
if ($isPartOfSharedFormula) {
|
|
|
|
// formula is added to this cell after the sheet has been read
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->sharedFormulaParts[$columnString . ($row + 1)] = $this->_baseCell;
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
// offset: 16: size: 4; not used
|
|
|
|
|
|
|
|
// offset: 4; size: 2; XF index
|
2015-05-20 18:17:17 +00:00
|
|
|
$xfIndex = self::getInt2d($recordData, 4);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 6; size: 8; result of the formula
|
|
|
|
if ((ord($recordData{6}) == 0) && (ord($recordData{12}) == 255) && (ord($recordData{13}) == 255)) {
|
|
|
|
// String formula. Result follows in appended STRING record
|
|
|
|
$dataType = PHPExcel_Cell_DataType::TYPE_STRING;
|
|
|
|
|
|
|
|
// read possible SHAREDFMLA record
|
2015-05-20 18:17:17 +00:00
|
|
|
$code = self::getInt2d($this->data, $this->pos);
|
2015-05-17 16:10:35 +00:00
|
|
|
if ($code == self::XLS_Type_SHAREDFMLA) {
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->readSharedFmla();
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
// read STRING record
|
2015-05-20 18:17:17 +00:00
|
|
|
$value = $this->readString();
|
2015-05-17 16:10:35 +00:00
|
|
|
} elseif ((ord($recordData{6}) == 1)
|
|
|
|
&& (ord($recordData{12}) == 255)
|
|
|
|
&& (ord($recordData{13}) == 255)) {
|
|
|
|
// Boolean formula. Result is in +2; 0=false, 1=true
|
|
|
|
$dataType = PHPExcel_Cell_DataType::TYPE_BOOL;
|
|
|
|
$value = (bool) ord($recordData{8});
|
|
|
|
} elseif ((ord($recordData{6}) == 2)
|
|
|
|
&& (ord($recordData{12}) == 255)
|
|
|
|
&& (ord($recordData{13}) == 255)) {
|
|
|
|
// Error formula. Error code is in +2
|
|
|
|
$dataType = PHPExcel_Cell_DataType::TYPE_ERROR;
|
2015-05-20 18:17:17 +00:00
|
|
|
$value = self::mapErrorCode(ord($recordData{8}));
|
2015-05-17 16:10:35 +00:00
|
|
|
} elseif ((ord($recordData{6}) == 3)
|
|
|
|
&& (ord($recordData{12}) == 255)
|
|
|
|
&& (ord($recordData{13}) == 255)) {
|
|
|
|
// Formula result is a null string
|
|
|
|
$dataType = PHPExcel_Cell_DataType::TYPE_NULL;
|
|
|
|
$value = '';
|
|
|
|
} else {
|
|
|
|
// forumla result is a number, first 14 bytes like _NUMBER record
|
|
|
|
$dataType = PHPExcel_Cell_DataType::TYPE_NUMERIC;
|
2015-05-20 18:17:17 +00:00
|
|
|
$value = self::extractNumber(substr($recordData, 6, 8));
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$cell = $this->phpSheet->getCell($columnString . ($row + 1));
|
|
|
|
if (!$this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// add cell style
|
2015-05-20 18:17:17 +00:00
|
|
|
$cell->setXfIndex($this->mapCellXfIndex[$xfIndex]);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
// store the formula
|
|
|
|
if (!$isPartOfSharedFormula) {
|
|
|
|
// not part of shared formula
|
|
|
|
// add cell value. If we can read formula, populate with formula, otherwise just used cached value
|
|
|
|
try {
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($this->version != self::XLS_BIFF8) {
|
2015-05-17 16:10:35 +00:00
|
|
|
throw new PHPExcel_Reader_Exception('Not BIFF8. Can only read BIFF8 formulas');
|
|
|
|
}
|
2015-05-20 18:17:17 +00:00
|
|
|
$formula = $this->getFormulaFromStructure($formulaStructure); // get formula in human language
|
2015-05-17 16:10:35 +00:00
|
|
|
$cell->setValueExplicit('=' . $formula, PHPExcel_Cell_DataType::TYPE_FORMULA);
|
|
|
|
|
|
|
|
} catch (PHPExcel_Exception $e) {
|
|
|
|
$cell->setValueExplicit($value, $dataType);
|
|
|
|
}
|
|
|
|
} else {
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($this->version == self::XLS_BIFF8) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// do nothing at this point, formula id added later in the code
|
|
|
|
} else {
|
|
|
|
$cell->setValueExplicit($value, $dataType);
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
// store the cached calculated value
|
|
|
|
$cell->setCalculatedValue($value);
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read a SHAREDFMLA record. This function just stores the binary shared formula in the reader,
|
|
|
|
* which usually contains relative references.
|
|
|
|
* These will be used to construct the formula in each shared formula part after the sheet is read.
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readSharedFmla()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 0, size: 6; cell range address of the area used by the shared formula, not used for anything
|
|
|
|
$cellRange = substr($recordData, 0, 6);
|
2015-05-20 18:17:17 +00:00
|
|
|
$cellRange = $this->readBIFF5CellRangeAddressFixed($cellRange); // note: even BIFF8 uses BIFF5 syntax
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 6, size: 1; not used
|
|
|
|
|
|
|
|
// offset: 7, size: 1; number of existing FORMULA records for this shared formula
|
|
|
|
$no = ord($recordData{7});
|
|
|
|
|
|
|
|
// offset: 8, size: var; Binary token array of the shared formula
|
|
|
|
$formula = substr($recordData, 8);
|
|
|
|
|
|
|
|
// at this point we only store the shared formula for later use
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->sharedFormulas[$this->_baseCell] = $formula;
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read a STRING record from current stream position and advance the stream pointer to next record
|
|
|
|
* This record is used for storing result from FORMULA record when it is a string, and
|
|
|
|
* it occurs directly after the FORMULA record
|
|
|
|
*
|
|
|
|
* @return string The string contents as UTF-8
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readString()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($this->version == self::XLS_BIFF8) {
|
|
|
|
$string = self::readUnicodeStringLong($recordData);
|
2015-05-17 16:10:35 +00:00
|
|
|
$value = $string['value'];
|
|
|
|
} else {
|
2015-05-20 18:17:17 +00:00
|
|
|
$string = $this->readByteStringLong($recordData);
|
2015-05-17 16:10:35 +00:00
|
|
|
$value = $string['value'];
|
|
|
|
}
|
|
|
|
|
|
|
|
return $value;
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read BOOLERR record
|
|
|
|
* This record represents a Boolean value or error value
|
|
|
|
* cell.
|
|
|
|
*
|
|
|
|
* -- "OpenOffice.org's Documentation of the Microsoft
|
|
|
|
* Excel File Format"
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readBoolErr()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 0; size: 2; row index
|
2015-05-20 18:17:17 +00:00
|
|
|
$row = self::getInt2d($recordData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 2; size: 2; column index
|
2015-05-20 18:17:17 +00:00
|
|
|
$column = self::getInt2d($recordData, 2);
|
2015-05-17 16:10:35 +00:00
|
|
|
$columnString = PHPExcel_Cell::stringFromColumnIndex($column);
|
|
|
|
|
|
|
|
// Read cell?
|
2015-05-20 18:17:17 +00:00
|
|
|
if (($this->getReadFilter() !== null) && $this->getReadFilter()->readCell($columnString, $row + 1, $this->phpSheet->getTitle())) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 4; size: 2; index to XF record
|
2015-05-20 18:17:17 +00:00
|
|
|
$xfIndex = self::getInt2d($recordData, 4);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 6; size: 1; the boolean value or error value
|
|
|
|
$boolErr = ord($recordData{6});
|
|
|
|
|
|
|
|
// offset: 7; size: 1; 0=boolean; 1=error
|
|
|
|
$isError = ord($recordData{7});
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$cell = $this->phpSheet->getCell($columnString . ($row + 1));
|
2015-05-17 16:10:35 +00:00
|
|
|
switch ($isError) {
|
|
|
|
case 0: // boolean
|
|
|
|
$value = (bool) $boolErr;
|
|
|
|
|
|
|
|
// add cell value
|
|
|
|
$cell->setValueExplicit($value, PHPExcel_Cell_DataType::TYPE_BOOL);
|
|
|
|
break;
|
|
|
|
case 1: // error type
|
2015-05-20 18:17:17 +00:00
|
|
|
$value = self::mapErrorCode($boolErr);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// add cell value
|
|
|
|
$cell->setValueExplicit($value, PHPExcel_Cell_DataType::TYPE_ERROR);
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!$this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// add cell style
|
2015-05-20 18:17:17 +00:00
|
|
|
$cell->setXfIndex($this->mapCellXfIndex[$xfIndex]);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read MULBLANK record
|
|
|
|
* This record represents a cell range of empty cells. All
|
|
|
|
* cells are located in the same row
|
|
|
|
*
|
|
|
|
* -- "OpenOffice.org's Documentation of the Microsoft
|
|
|
|
* Excel File Format"
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readMulBlank()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 0; size: 2; index to row
|
2015-05-20 18:17:17 +00:00
|
|
|
$row = self::getInt2d($recordData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 2; size: 2; index to first column
|
2015-05-20 18:17:17 +00:00
|
|
|
$fc = self::getInt2d($recordData, 2);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 4; size: 2 x nc; list of indexes to XF records
|
|
|
|
// add style information
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!$this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
for ($i = 0; $i < $length / 2 - 3; ++$i) {
|
|
|
|
$columnString = PHPExcel_Cell::stringFromColumnIndex($fc + $i);
|
|
|
|
|
|
|
|
// Read cell?
|
2015-05-20 18:17:17 +00:00
|
|
|
if (($this->getReadFilter() !== null) && $this->getReadFilter()->readCell($columnString, $row + 1, $this->phpSheet->getTitle())) {
|
|
|
|
$xfIndex = self::getInt2d($recordData, 4 + 2 * $i);
|
|
|
|
$this->phpSheet->getCell($columnString . ($row + 1))->setXfIndex($this->mapCellXfIndex[$xfIndex]);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
// offset: 6; size 2; index to last column (not needed)
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read LABEL record
|
|
|
|
* This record represents a cell that contains a string. In
|
|
|
|
* BIFF8 it is usually replaced by the LABELSST record.
|
|
|
|
* Excel still uses this record, if it copies unformatted
|
|
|
|
* text cells to the clipboard.
|
|
|
|
*
|
|
|
|
* -- "OpenOffice.org's Documentation of the Microsoft
|
|
|
|
* Excel File Format"
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readLabel()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 0; size: 2; index to row
|
2015-05-20 18:17:17 +00:00
|
|
|
$row = self::getInt2d($recordData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 2; size: 2; index to column
|
2015-05-20 18:17:17 +00:00
|
|
|
$column = self::getInt2d($recordData, 2);
|
2015-05-17 16:10:35 +00:00
|
|
|
$columnString = PHPExcel_Cell::stringFromColumnIndex($column);
|
|
|
|
|
|
|
|
// Read cell?
|
2015-05-20 18:17:17 +00:00
|
|
|
if (($this->getReadFilter() !== null) && $this->getReadFilter()->readCell($columnString, $row + 1, $this->phpSheet->getTitle())) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 4; size: 2; XF index
|
2015-05-20 18:17:17 +00:00
|
|
|
$xfIndex = self::getInt2d($recordData, 4);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// add cell value
|
|
|
|
// todo: what if string is very long? continue record
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($this->version == self::XLS_BIFF8) {
|
|
|
|
$string = self::readUnicodeStringLong(substr($recordData, 6));
|
2015-05-17 16:10:35 +00:00
|
|
|
$value = $string['value'];
|
|
|
|
} else {
|
2015-05-20 18:17:17 +00:00
|
|
|
$string = $this->readByteStringLong(substr($recordData, 6));
|
2015-05-17 16:10:35 +00:00
|
|
|
$value = $string['value'];
|
|
|
|
}
|
2015-05-20 18:17:17 +00:00
|
|
|
$cell = $this->phpSheet->getCell($columnString . ($row + 1));
|
2015-05-17 16:10:35 +00:00
|
|
|
$cell->setValueExplicit($value, PHPExcel_Cell_DataType::TYPE_STRING);
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!$this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// add cell style
|
2015-05-20 18:17:17 +00:00
|
|
|
$cell->setXfIndex($this->mapCellXfIndex[$xfIndex]);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read BLANK record
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readBlank()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 0; size: 2; row index
|
2015-05-20 18:17:17 +00:00
|
|
|
$row = self::getInt2d($recordData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 2; size: 2; col index
|
2015-05-20 18:17:17 +00:00
|
|
|
$col = self::getInt2d($recordData, 2);
|
2015-05-17 16:10:35 +00:00
|
|
|
$columnString = PHPExcel_Cell::stringFromColumnIndex($col);
|
|
|
|
|
|
|
|
// Read cell?
|
2015-05-20 18:17:17 +00:00
|
|
|
if (($this->getReadFilter() !== null) && $this->getReadFilter()->readCell($columnString, $row + 1, $this->phpSheet->getTitle())) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 4; size: 2; XF index
|
2015-05-20 18:17:17 +00:00
|
|
|
$xfIndex = self::getInt2d($recordData, 4);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// add style information
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!$this->readDataOnly) {
|
|
|
|
$this->phpSheet->getCell($columnString . ($row + 1))->setXfIndex($this->mapCellXfIndex[$xfIndex]);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read MSODRAWING record
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readMsoDrawing()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// get spliced record data
|
2015-05-20 18:17:17 +00:00
|
|
|
$splicedRecordData = $this->getSplicedRecordData();
|
2015-05-17 16:10:35 +00:00
|
|
|
$recordData = $splicedRecordData['recordData'];
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->drawingData .= $recordData;
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read OBJ record
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readObj()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($this->readDataOnly || $this->version != self::XLS_BIFF8) {
|
2015-05-17 16:10:35 +00:00
|
|
|
return;
|
|
|
|
}
|
|
|
|
|
|
|
|
// recordData consists of an array of subrecords looking like this:
|
|
|
|
// ft: 2 bytes; ftCmo type (0x15)
|
|
|
|
// cb: 2 bytes; size in bytes of ftCmo data
|
|
|
|
// ot: 2 bytes; Object Type
|
|
|
|
// id: 2 bytes; Object id number
|
|
|
|
// grbit: 2 bytes; Option Flags
|
|
|
|
// data: var; subrecord data
|
|
|
|
|
|
|
|
// for now, we are just interested in the second subrecord containing the object type
|
2015-05-20 18:17:17 +00:00
|
|
|
$ftCmoType = self::getInt2d($recordData, 0);
|
|
|
|
$cbCmoSize = self::getInt2d($recordData, 2);
|
|
|
|
$otObjType = self::getInt2d($recordData, 4);
|
|
|
|
$idObjID = self::getInt2d($recordData, 6);
|
|
|
|
$grbitOpts = self::getInt2d($recordData, 6);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->objs[] = array(
|
2015-05-17 16:10:35 +00:00
|
|
|
'ftCmoType' => $ftCmoType,
|
|
|
|
'cbCmoSize' => $cbCmoSize,
|
|
|
|
'otObjType' => $otObjType,
|
|
|
|
'idObjID' => $idObjID,
|
|
|
|
'grbitOpts' => $grbitOpts
|
|
|
|
);
|
|
|
|
$this->textObjRef = $idObjID;
|
|
|
|
|
|
|
|
// echo '<b>_readObj()</b><br />';
|
2015-05-20 18:17:17 +00:00
|
|
|
// var_dump(end($this->objs));
|
2015-05-17 16:10:35 +00:00
|
|
|
// echo '<br />';
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read WINDOW2 record
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readWindow2()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 0; size: 2; option flags
|
2015-05-20 18:17:17 +00:00
|
|
|
$options = self::getInt2d($recordData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 2; size: 2; index to first visible row
|
2015-05-20 18:17:17 +00:00
|
|
|
$firstVisibleRow = self::getInt2d($recordData, 2);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 4; size: 2; index to first visible colum
|
2015-05-20 18:17:17 +00:00
|
|
|
$firstVisibleColumn = self::getInt2d($recordData, 4);
|
|
|
|
if ($this->version === self::XLS_BIFF8) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 8; size: 2; not used
|
|
|
|
// offset: 10; size: 2; cached magnification factor in page break preview (in percent); 0 = Default (60%)
|
|
|
|
// offset: 12; size: 2; cached magnification factor in normal view (in percent); 0 = Default (100%)
|
|
|
|
// offset: 14; size: 4; not used
|
2015-05-20 18:17:17 +00:00
|
|
|
$zoomscaleInPageBreakPreview = self::getInt2d($recordData, 10);
|
2015-05-17 16:10:35 +00:00
|
|
|
if ($zoomscaleInPageBreakPreview === 0) {
|
|
|
|
$zoomscaleInPageBreakPreview = 60;
|
|
|
|
}
|
2015-05-20 18:17:17 +00:00
|
|
|
$zoomscaleInNormalView = self::getInt2d($recordData, 12);
|
2015-05-17 16:10:35 +00:00
|
|
|
if ($zoomscaleInNormalView === 0) {
|
|
|
|
$zoomscaleInNormalView = 100;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
// bit: 1; mask: 0x0002; 0 = do not show gridlines, 1 = show gridlines
|
|
|
|
$showGridlines = (bool) ((0x0002 & $options) >> 1);
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->setShowGridlines($showGridlines);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 2; mask: 0x0004; 0 = do not show headers, 1 = show headers
|
|
|
|
$showRowColHeaders = (bool) ((0x0004 & $options) >> 2);
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->setShowRowColHeaders($showRowColHeaders);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 3; mask: 0x0008; 0 = panes are not frozen, 1 = panes are frozen
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->frozen = (bool) ((0x0008 & $options) >> 3);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 6; mask: 0x0040; 0 = columns from left to right, 1 = columns from right to left
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->setRightToLeft((bool)((0x0040 & $options) >> 6));
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 10; mask: 0x0400; 0 = sheet not active, 1 = sheet active
|
|
|
|
$isActive = (bool) ((0x0400 & $options) >> 10);
|
|
|
|
if ($isActive) {
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpExcel->setActiveSheetIndex($this->phpExcel->getIndex($this->phpSheet));
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
// bit: 11; mask: 0x0800; 0 = normal view, 1 = page break view
|
|
|
|
$isPageBreakPreview = (bool) ((0x0800 & $options) >> 11);
|
|
|
|
|
|
|
|
//FIXME: set $firstVisibleRow and $firstVisibleColumn
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($this->phpSheet->getSheetView()->getView() !== PHPExcel_Worksheet_SheetView::SHEETVIEW_PAGE_LAYOUT) {
|
2015-05-17 16:10:35 +00:00
|
|
|
//NOTE: this setting is inferior to page layout view(Excel2007-)
|
|
|
|
$view = $isPageBreakPreview ? PHPExcel_Worksheet_SheetView::SHEETVIEW_PAGE_BREAK_PREVIEW : PHPExcel_Worksheet_SheetView::SHEETVIEW_NORMAL;
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getSheetView()->setView($view);
|
|
|
|
if ($this->version === self::XLS_BIFF8) {
|
2015-05-17 16:10:35 +00:00
|
|
|
$zoomScale = $isPageBreakPreview ? $zoomscaleInPageBreakPreview : $zoomscaleInNormalView;
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getSheetView()->setZoomScale($zoomScale);
|
|
|
|
$this->phpSheet->getSheetView()->setZoomScaleNormal($zoomscaleInNormalView);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read PLV Record(Created by Excel2007 or upper)
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readPageLayoutView()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
//var_dump(unpack("vrt/vgrbitFrt/V2reserved/vwScalePLV/vgrbit", $recordData));
|
|
|
|
|
|
|
|
// offset: 0; size: 2; rt
|
|
|
|
//->ignore
|
2015-05-20 18:17:17 +00:00
|
|
|
$rt = self::getInt2d($recordData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 2; size: 2; grbitfr
|
|
|
|
//->ignore
|
2015-05-20 18:17:17 +00:00
|
|
|
$grbitFrt = self::getInt2d($recordData, 2);
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 4; size: 8; reserved
|
|
|
|
//->ignore
|
|
|
|
|
|
|
|
// offset: 12; size 2; zoom scale
|
2015-05-20 18:17:17 +00:00
|
|
|
$wScalePLV = self::getInt2d($recordData, 12);
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 14; size 2; grbit
|
2015-05-20 18:17:17 +00:00
|
|
|
$grbit = self::getInt2d($recordData, 14);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// decomprise grbit
|
|
|
|
$fPageLayoutView = $grbit & 0x01;
|
|
|
|
$fRulerVisible = ($grbit >> 1) & 0x01; //no support
|
|
|
|
$fWhitespaceHidden = ($grbit >> 3) & 0x01; //no support
|
|
|
|
|
|
|
|
if ($fPageLayoutView === 1) {
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getSheetView()->setView(PHPExcel_Worksheet_SheetView::SHEETVIEW_PAGE_LAYOUT);
|
|
|
|
$this->phpSheet->getSheetView()->setZoomScale($wScalePLV); //set by Excel2007 only if SHEETVIEW_PAGE_LAYOUT
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
//otherwise, we cannot know whether SHEETVIEW_PAGE_LAYOUT or SHEETVIEW_PAGE_BREAK_PREVIEW.
|
|
|
|
}
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read SCL record
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readScl()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 0; size: 2; numerator of the view magnification
|
2015-05-20 18:17:17 +00:00
|
|
|
$numerator = self::getInt2d($recordData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 2; size: 2; numerator of the view magnification
|
2015-05-20 18:17:17 +00:00
|
|
|
$denumerator = self::getInt2d($recordData, 2);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// set the zoom scale (in percent)
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getSheetView()->setZoomScale($numerator * 100 / $denumerator);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read PANE record
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readPane()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!$this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 0; size: 2; position of vertical split
|
2015-05-20 18:17:17 +00:00
|
|
|
$px = self::getInt2d($recordData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 2; size: 2; position of horizontal split
|
2015-05-20 18:17:17 +00:00
|
|
|
$py = self::getInt2d($recordData, 2);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($this->frozen) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// frozen panes
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->freezePane(PHPExcel_Cell::stringFromColumnIndex($px) . ($py + 1));
|
2015-05-17 16:10:35 +00:00
|
|
|
} else {
|
|
|
|
// unfrozen panes; split windows; not supported by PHPExcel core
|
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read SELECTION record. There is one such record for each pane in the sheet.
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readSelection()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!$this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 0; size: 1; pane identifier
|
|
|
|
$paneId = ord($recordData{0});
|
|
|
|
|
|
|
|
// offset: 1; size: 2; index to row of the active cell
|
2015-05-20 18:17:17 +00:00
|
|
|
$r = self::getInt2d($recordData, 1);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 3; size: 2; index to column of the active cell
|
2015-05-20 18:17:17 +00:00
|
|
|
$c = self::getInt2d($recordData, 3);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 5; size: 2; index into the following cell range list to the
|
|
|
|
// entry that contains the active cell
|
2015-05-20 18:17:17 +00:00
|
|
|
$index = self::getInt2d($recordData, 5);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 7; size: var; cell range address list containing all selected cell ranges
|
|
|
|
$data = substr($recordData, 7);
|
2015-05-20 18:17:17 +00:00
|
|
|
$cellRangeAddressList = $this->readBIFF5CellRangeAddressList($data); // note: also BIFF8 uses BIFF5 syntax
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
$selectedCells = $cellRangeAddressList['cellRangeAddresses'][0];
|
|
|
|
|
|
|
|
// first row '1' + last row '16384' indicates that full column is selected (apparently also in BIFF8!)
|
|
|
|
if (preg_match('/^([A-Z]+1\:[A-Z]+)16384$/', $selectedCells)) {
|
|
|
|
$selectedCells = preg_replace('/^([A-Z]+1\:[A-Z]+)16384$/', '${1}1048576', $selectedCells);
|
|
|
|
}
|
|
|
|
|
|
|
|
// first row '1' + last row '65536' indicates that full column is selected
|
|
|
|
if (preg_match('/^([A-Z]+1\:[A-Z]+)65536$/', $selectedCells)) {
|
|
|
|
$selectedCells = preg_replace('/^([A-Z]+1\:[A-Z]+)65536$/', '${1}1048576', $selectedCells);
|
|
|
|
}
|
|
|
|
|
|
|
|
// first column 'A' + last column 'IV' indicates that full row is selected
|
|
|
|
if (preg_match('/^(A[0-9]+\:)IV([0-9]+)$/', $selectedCells)) {
|
|
|
|
$selectedCells = preg_replace('/^(A[0-9]+\:)IV([0-9]+)$/', '${1}XFD${2}', $selectedCells);
|
|
|
|
}
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->setSelectedCells($selectedCells);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
private function includeCellRangeFiltered($cellRangeAddress)
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
$includeCellRange = true;
|
|
|
|
if ($this->getReadFilter() !== null) {
|
|
|
|
$includeCellRange = false;
|
|
|
|
$rangeBoundaries = PHPExcel_Cell::getRangeBoundaries($cellRangeAddress);
|
|
|
|
$rangeBoundaries[1][0]++;
|
|
|
|
for ($row = $rangeBoundaries[0][1]; $row <= $rangeBoundaries[1][1]; $row++) {
|
|
|
|
for ($column = $rangeBoundaries[0][0]; $column != $rangeBoundaries[1][0]; $column++) {
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($this->getReadFilter()->readCell($column, $row, $this->phpSheet->getTitle())) {
|
2015-05-17 16:10:35 +00:00
|
|
|
$includeCellRange = true;
|
|
|
|
break 2;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
return $includeCellRange;
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* MERGEDCELLS
|
|
|
|
*
|
|
|
|
* This record contains the addresses of merged cell ranges
|
|
|
|
* in the current sheet.
|
|
|
|
*
|
|
|
|
* -- "OpenOffice.org's Documentation of the Microsoft
|
|
|
|
* Excel File Format"
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readMergedCells()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($this->version == self::XLS_BIFF8 && !$this->readDataOnly) {
|
|
|
|
$cellRangeAddressList = $this->readBIFF8CellRangeAddressList($recordData);
|
2015-05-17 16:10:35 +00:00
|
|
|
foreach ($cellRangeAddressList['cellRangeAddresses'] as $cellRangeAddress) {
|
|
|
|
if ((strpos($cellRangeAddress, ':') !== false) &&
|
2015-05-20 18:17:17 +00:00
|
|
|
($this->includeCellRangeFiltered($cellRangeAddress))) {
|
|
|
|
$this->phpSheet->mergeCells($cellRangeAddress);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read HYPERLINK record
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readHyperLink()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer forward to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!$this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 0; size: 8; cell range address of all cells containing this hyperlink
|
|
|
|
try {
|
2015-05-20 18:17:17 +00:00
|
|
|
$cellRange = $this->readBIFF8CellRangeAddressFixed($recordData, 0, 8);
|
2015-05-17 16:10:35 +00:00
|
|
|
} catch (PHPExcel_Exception $e) {
|
|
|
|
return;
|
|
|
|
}
|
|
|
|
|
|
|
|
// offset: 8, size: 16; GUID of StdLink
|
|
|
|
|
|
|
|
// offset: 24, size: 4; unknown value
|
|
|
|
|
|
|
|
// offset: 28, size: 4; option flags
|
|
|
|
// bit: 0; mask: 0x00000001; 0 = no link or extant, 1 = file link or URL
|
2015-05-20 18:17:17 +00:00
|
|
|
$isFileLinkOrUrl = (0x00000001 & self::getInt2d($recordData, 28)) >> 0;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 1; mask: 0x00000002; 0 = relative path, 1 = absolute path or URL
|
2015-05-20 18:17:17 +00:00
|
|
|
$isAbsPathOrUrl = (0x00000001 & self::getInt2d($recordData, 28)) >> 1;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 2 (and 4); mask: 0x00000014; 0 = no description
|
2015-05-20 18:17:17 +00:00
|
|
|
$hasDesc = (0x00000014 & self::getInt2d($recordData, 28)) >> 2;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 3; mask: 0x00000008; 0 = no text, 1 = has text
|
2015-05-20 18:17:17 +00:00
|
|
|
$hasText = (0x00000008 & self::getInt2d($recordData, 28)) >> 3;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 7; mask: 0x00000080; 0 = no target frame, 1 = has target frame
|
2015-05-20 18:17:17 +00:00
|
|
|
$hasFrame = (0x00000080 & self::getInt2d($recordData, 28)) >> 7;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 8; mask: 0x00000100; 0 = file link or URL, 1 = UNC path (inc. server name)
|
2015-05-20 18:17:17 +00:00
|
|
|
$isUNC = (0x00000100 & self::getInt2d($recordData, 28)) >> 8;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset within record data
|
|
|
|
$offset = 32;
|
|
|
|
|
|
|
|
if ($hasDesc) {
|
|
|
|
// offset: 32; size: var; character count of description text
|
2015-05-20 18:17:17 +00:00
|
|
|
$dl = self::getInt4d($recordData, 32);
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 36; size: var; character array of description text, no Unicode string header, always 16-bit characters, zero terminated
|
2015-05-20 18:17:17 +00:00
|
|
|
$desc = self::encodeUTF16(substr($recordData, 36, 2 * ($dl - 1)), false);
|
2015-05-17 16:10:35 +00:00
|
|
|
$offset += 4 + 2 * $dl;
|
|
|
|
}
|
|
|
|
if ($hasFrame) {
|
2015-05-20 18:17:17 +00:00
|
|
|
$fl = self::getInt4d($recordData, $offset);
|
2015-05-17 16:10:35 +00:00
|
|
|
$offset += 4 + 2 * $fl;
|
|
|
|
}
|
|
|
|
|
|
|
|
// detect type of hyperlink (there are 4 types)
|
|
|
|
$hyperlinkType = null;
|
|
|
|
|
|
|
|
if ($isUNC) {
|
|
|
|
$hyperlinkType = 'UNC';
|
2015-05-18 15:39:04 +00:00
|
|
|
} elseif (!$isFileLinkOrUrl) {
|
2015-05-17 16:10:35 +00:00
|
|
|
$hyperlinkType = 'workbook';
|
2015-05-18 15:39:04 +00:00
|
|
|
} elseif (ord($recordData{$offset}) == 0x03) {
|
2015-05-17 16:10:35 +00:00
|
|
|
$hyperlinkType = 'local';
|
2015-05-18 15:39:04 +00:00
|
|
|
} elseif (ord($recordData{$offset}) == 0xE0) {
|
2015-05-17 16:10:35 +00:00
|
|
|
$hyperlinkType = 'URL';
|
|
|
|
}
|
|
|
|
|
|
|
|
switch ($hyperlinkType) {
|
|
|
|
case 'URL':
|
|
|
|
// section 5.58.2: Hyperlink containing a URL
|
|
|
|
// e.g. http://example.org/index.php
|
|
|
|
|
|
|
|
// offset: var; size: 16; GUID of URL Moniker
|
|
|
|
$offset += 16;
|
|
|
|
// offset: var; size: 4; size (in bytes) of character array of the URL including trailing zero word
|
2015-05-20 18:17:17 +00:00
|
|
|
$us = self::getInt4d($recordData, $offset);
|
2015-05-17 16:10:35 +00:00
|
|
|
$offset += 4;
|
|
|
|
// offset: var; size: $us; character array of the URL, no Unicode string header, always 16-bit characters, zero-terminated
|
2015-05-20 18:17:17 +00:00
|
|
|
$url = self::encodeUTF16(substr($recordData, $offset, $us - 2), false);
|
2015-05-17 16:10:35 +00:00
|
|
|
$nullOffset = strpos($url, 0x00);
|
|
|
|
if ($nullOffset) {
|
|
|
|
$url = substr($url, 0, $nullOffset);
|
|
|
|
}
|
|
|
|
$url .= $hasText ? '#' : '';
|
|
|
|
$offset += $us;
|
|
|
|
break;
|
|
|
|
case 'local':
|
|
|
|
// section 5.58.3: Hyperlink to local file
|
|
|
|
// examples:
|
|
|
|
// mydoc.txt
|
|
|
|
// ../../somedoc.xls#Sheet!A1
|
|
|
|
|
|
|
|
// offset: var; size: 16; GUI of File Moniker
|
|
|
|
$offset += 16;
|
|
|
|
|
|
|
|
// offset: var; size: 2; directory up-level count.
|
2015-05-20 18:17:17 +00:00
|
|
|
$upLevelCount = self::getInt2d($recordData, $offset);
|
2015-05-17 16:10:35 +00:00
|
|
|
$offset += 2;
|
|
|
|
|
|
|
|
// offset: var; size: 4; character count of the shortened file path and name, including trailing zero word
|
2015-05-20 18:17:17 +00:00
|
|
|
$sl = self::getInt4d($recordData, $offset);
|
2015-05-17 16:10:35 +00:00
|
|
|
$offset += 4;
|
|
|
|
|
|
|
|
// offset: var; size: sl; character array of the shortened file path and name in 8.3-DOS-format (compressed Unicode string)
|
|
|
|
$shortenedFilePath = substr($recordData, $offset, $sl);
|
2015-05-20 18:17:17 +00:00
|
|
|
$shortenedFilePath = self::encodeUTF16($shortenedFilePath, true);
|
2015-05-17 16:10:35 +00:00
|
|
|
$shortenedFilePath = substr($shortenedFilePath, 0, -1); // remove trailing zero
|
|
|
|
|
|
|
|
$offset += $sl;
|
|
|
|
|
|
|
|
// offset: var; size: 24; unknown sequence
|
|
|
|
$offset += 24;
|
|
|
|
|
|
|
|
// extended file path
|
|
|
|
// offset: var; size: 4; size of the following file link field including string lenth mark
|
2015-05-20 18:17:17 +00:00
|
|
|
$sz = self::getInt4d($recordData, $offset);
|
2015-05-17 16:10:35 +00:00
|
|
|
$offset += 4;
|
|
|
|
|
|
|
|
// only present if $sz > 0
|
|
|
|
if ($sz > 0) {
|
|
|
|
// offset: var; size: 4; size of the character array of the extended file path and name
|
2015-05-20 18:17:17 +00:00
|
|
|
$xl = self::getInt4d($recordData, $offset);
|
2015-05-17 16:10:35 +00:00
|
|
|
$offset += 4;
|
|
|
|
|
|
|
|
// offset: var; size 2; unknown
|
|
|
|
$offset += 2;
|
|
|
|
|
|
|
|
// offset: var; size $xl; character array of the extended file path and name.
|
|
|
|
$extendedFilePath = substr($recordData, $offset, $xl);
|
2015-05-20 18:17:17 +00:00
|
|
|
$extendedFilePath = self::encodeUTF16($extendedFilePath, false);
|
2015-05-17 16:10:35 +00:00
|
|
|
$offset += $xl;
|
|
|
|
}
|
|
|
|
|
|
|
|
// construct the path
|
|
|
|
$url = str_repeat('..\\', $upLevelCount);
|
|
|
|
$url .= ($sz > 0) ? $extendedFilePath : $shortenedFilePath; // use extended path if available
|
|
|
|
$url .= $hasText ? '#' : '';
|
|
|
|
|
|
|
|
break;
|
|
|
|
case 'UNC':
|
|
|
|
// section 5.58.4: Hyperlink to a File with UNC (Universal Naming Convention) Path
|
|
|
|
// todo: implement
|
|
|
|
return;
|
|
|
|
case 'workbook':
|
|
|
|
// section 5.58.5: Hyperlink to the Current Workbook
|
|
|
|
// e.g. Sheet2!B1:C2, stored in text mark field
|
|
|
|
$url = 'sheet://';
|
|
|
|
break;
|
|
|
|
default:
|
|
|
|
return;
|
|
|
|
}
|
|
|
|
|
|
|
|
if ($hasText) {
|
|
|
|
// offset: var; size: 4; character count of text mark including trailing zero word
|
2015-05-20 18:17:17 +00:00
|
|
|
$tl = self::getInt4d($recordData, $offset);
|
2015-05-17 16:10:35 +00:00
|
|
|
$offset += 4;
|
|
|
|
// offset: var; size: var; character array of the text mark without the # sign, no Unicode header, always 16-bit characters, zero-terminated
|
2015-05-20 18:17:17 +00:00
|
|
|
$text = self::encodeUTF16(substr($recordData, $offset, 2 * ($tl - 1)), false);
|
2015-05-17 16:10:35 +00:00
|
|
|
$url .= $text;
|
|
|
|
}
|
|
|
|
|
|
|
|
// apply the hyperlink to all the relevant cells
|
|
|
|
foreach (PHPExcel_Cell::extractAllCellReferencesInRange($cellRange) as $coordinate) {
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getCell($coordinate)->getHyperLink()->setUrl($url);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read DATAVALIDATIONS record
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readDataValidations()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer forward to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read DATAVALIDATION record
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readDataValidation()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer forward to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
return;
|
|
|
|
}
|
|
|
|
|
|
|
|
// offset: 0; size: 4; Options
|
2015-05-20 18:17:17 +00:00
|
|
|
$options = self::getInt4d($recordData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 0-3; mask: 0x0000000F; type
|
|
|
|
$type = (0x0000000F & $options) >> 0;
|
|
|
|
switch ($type) {
|
|
|
|
case 0x00:
|
|
|
|
$type = PHPExcel_Cell_DataValidation::TYPE_NONE;
|
|
|
|
break;
|
|
|
|
case 0x01:
|
|
|
|
$type = PHPExcel_Cell_DataValidation::TYPE_WHOLE;
|
|
|
|
break;
|
|
|
|
case 0x02:
|
|
|
|
$type = PHPExcel_Cell_DataValidation::TYPE_DECIMAL;
|
|
|
|
break;
|
|
|
|
case 0x03:
|
|
|
|
$type = PHPExcel_Cell_DataValidation::TYPE_LIST;
|
|
|
|
break;
|
|
|
|
case 0x04:
|
|
|
|
$type = PHPExcel_Cell_DataValidation::TYPE_DATE;
|
|
|
|
break;
|
|
|
|
case 0x05:
|
|
|
|
$type = PHPExcel_Cell_DataValidation::TYPE_TIME;
|
|
|
|
break;
|
|
|
|
case 0x06:
|
|
|
|
$type = PHPExcel_Cell_DataValidation::TYPE_TEXTLENGTH;
|
|
|
|
break;
|
|
|
|
case 0x07:
|
|
|
|
$type = PHPExcel_Cell_DataValidation::TYPE_CUSTOM;
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
|
|
|
|
// bit: 4-6; mask: 0x00000070; error type
|
|
|
|
$errorStyle = (0x00000070 & $options) >> 4;
|
|
|
|
switch ($errorStyle) {
|
|
|
|
case 0x00:
|
|
|
|
$errorStyle = PHPExcel_Cell_DataValidation::STYLE_STOP;
|
|
|
|
break;
|
|
|
|
case 0x01:
|
|
|
|
$errorStyle = PHPExcel_Cell_DataValidation::STYLE_WARNING;
|
|
|
|
break;
|
|
|
|
case 0x02:
|
|
|
|
$errorStyle = PHPExcel_Cell_DataValidation::STYLE_INFORMATION;
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
|
|
|
|
// bit: 7; mask: 0x00000080; 1= formula is explicit (only applies to list)
|
|
|
|
// I have only seen cases where this is 1
|
|
|
|
$explicitFormula = (0x00000080 & $options) >> 7;
|
|
|
|
|
|
|
|
// bit: 8; mask: 0x00000100; 1= empty cells allowed
|
|
|
|
$allowBlank = (0x00000100 & $options) >> 8;
|
|
|
|
|
|
|
|
// bit: 9; mask: 0x00000200; 1= suppress drop down arrow in list type validity
|
|
|
|
$suppressDropDown = (0x00000200 & $options) >> 9;
|
|
|
|
|
|
|
|
// bit: 18; mask: 0x00040000; 1= show prompt box if cell selected
|
|
|
|
$showInputMessage = (0x00040000 & $options) >> 18;
|
|
|
|
|
|
|
|
// bit: 19; mask: 0x00080000; 1= show error box if invalid values entered
|
|
|
|
$showErrorMessage = (0x00080000 & $options) >> 19;
|
|
|
|
|
|
|
|
// bit: 20-23; mask: 0x00F00000; condition operator
|
|
|
|
$operator = (0x00F00000 & $options) >> 20;
|
|
|
|
switch ($operator) {
|
|
|
|
case 0x00:
|
|
|
|
$operator = PHPExcel_Cell_DataValidation::OPERATOR_BETWEEN;
|
|
|
|
break;
|
|
|
|
case 0x01:
|
|
|
|
$operator = PHPExcel_Cell_DataValidation::OPERATOR_NOTBETWEEN;
|
|
|
|
break;
|
|
|
|
case 0x02:
|
|
|
|
$operator = PHPExcel_Cell_DataValidation::OPERATOR_EQUAL;
|
|
|
|
break;
|
|
|
|
case 0x03:
|
|
|
|
$operator = PHPExcel_Cell_DataValidation::OPERATOR_NOTEQUAL;
|
|
|
|
break;
|
|
|
|
case 0x04:
|
|
|
|
$operator = PHPExcel_Cell_DataValidation::OPERATOR_GREATERTHAN;
|
|
|
|
break;
|
|
|
|
case 0x05:
|
|
|
|
$operator = PHPExcel_Cell_DataValidation::OPERATOR_LESSTHAN;
|
|
|
|
break;
|
|
|
|
case 0x06:
|
|
|
|
$operator = PHPExcel_Cell_DataValidation::OPERATOR_GREATERTHANOREQUAL;
|
|
|
|
break;
|
|
|
|
case 0x07:
|
|
|
|
$operator = PHPExcel_Cell_DataValidation::OPERATOR_LESSTHANOREQUAL;
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
|
|
|
|
// offset: 4; size: var; title of the prompt box
|
|
|
|
$offset = 4;
|
2015-05-20 18:17:17 +00:00
|
|
|
$string = self::readUnicodeStringLong(substr($recordData, $offset));
|
2015-05-17 16:10:35 +00:00
|
|
|
$promptTitle = $string['value'] !== chr(0) ? $string['value'] : '';
|
|
|
|
$offset += $string['size'];
|
|
|
|
|
|
|
|
// offset: var; size: var; title of the error box
|
2015-05-20 18:17:17 +00:00
|
|
|
$string = self::readUnicodeStringLong(substr($recordData, $offset));
|
2015-05-17 16:10:35 +00:00
|
|
|
$errorTitle = $string['value'] !== chr(0) ? $string['value'] : '';
|
|
|
|
$offset += $string['size'];
|
|
|
|
|
|
|
|
// offset: var; size: var; text of the prompt box
|
2015-05-20 18:17:17 +00:00
|
|
|
$string = self::readUnicodeStringLong(substr($recordData, $offset));
|
2015-05-17 16:10:35 +00:00
|
|
|
$prompt = $string['value'] !== chr(0) ? $string['value'] : '';
|
|
|
|
$offset += $string['size'];
|
|
|
|
|
|
|
|
// offset: var; size: var; text of the error box
|
2015-05-20 18:17:17 +00:00
|
|
|
$string = self::readUnicodeStringLong(substr($recordData, $offset));
|
2015-05-17 16:10:35 +00:00
|
|
|
$error = $string['value'] !== chr(0) ? $string['value'] : '';
|
|
|
|
$offset += $string['size'];
|
|
|
|
|
|
|
|
// offset: var; size: 2; size of the formula data for the first condition
|
2015-05-20 18:17:17 +00:00
|
|
|
$sz1 = self::getInt2d($recordData, $offset);
|
2015-05-17 16:10:35 +00:00
|
|
|
$offset += 2;
|
|
|
|
|
|
|
|
// offset: var; size: 2; not used
|
|
|
|
$offset += 2;
|
|
|
|
|
|
|
|
// offset: var; size: $sz1; formula data for first condition (without size field)
|
|
|
|
$formula1 = substr($recordData, $offset, $sz1);
|
|
|
|
$formula1 = pack('v', $sz1) . $formula1; // prepend the length
|
|
|
|
try {
|
2015-05-20 18:17:17 +00:00
|
|
|
$formula1 = $this->getFormulaFromStructure($formula1);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// in list type validity, null characters are used as item separators
|
|
|
|
if ($type == PHPExcel_Cell_DataValidation::TYPE_LIST) {
|
|
|
|
$formula1 = str_replace(chr(0), ',', $formula1);
|
|
|
|
}
|
|
|
|
} catch (PHPExcel_Exception $e) {
|
|
|
|
return;
|
|
|
|
}
|
|
|
|
$offset += $sz1;
|
|
|
|
|
|
|
|
// offset: var; size: 2; size of the formula data for the first condition
|
2015-05-20 18:17:17 +00:00
|
|
|
$sz2 = self::getInt2d($recordData, $offset);
|
2015-05-17 16:10:35 +00:00
|
|
|
$offset += 2;
|
|
|
|
|
|
|
|
// offset: var; size: 2; not used
|
|
|
|
$offset += 2;
|
|
|
|
|
|
|
|
// offset: var; size: $sz2; formula data for second condition (without size field)
|
|
|
|
$formula2 = substr($recordData, $offset, $sz2);
|
|
|
|
$formula2 = pack('v', $sz2) . $formula2; // prepend the length
|
|
|
|
try {
|
2015-05-20 18:17:17 +00:00
|
|
|
$formula2 = $this->getFormulaFromStructure($formula2);
|
2015-05-17 16:10:35 +00:00
|
|
|
} catch (PHPExcel_Exception $e) {
|
|
|
|
return;
|
|
|
|
}
|
|
|
|
$offset += $sz2;
|
|
|
|
|
|
|
|
// offset: var; size: var; cell range address list with
|
2015-05-20 18:17:17 +00:00
|
|
|
$cellRangeAddressList = $this->readBIFF8CellRangeAddressList(substr($recordData, $offset));
|
2015-05-17 16:10:35 +00:00
|
|
|
$cellRangeAddresses = $cellRangeAddressList['cellRangeAddresses'];
|
|
|
|
|
|
|
|
foreach ($cellRangeAddresses as $cellRange) {
|
2015-05-20 18:17:17 +00:00
|
|
|
$stRange = $this->phpSheet->shrinkRangeToFit($cellRange);
|
2015-05-17 16:10:35 +00:00
|
|
|
$stRange = PHPExcel_Cell::extractAllCellReferencesInRange($stRange);
|
|
|
|
foreach ($stRange as $coordinate) {
|
2015-05-20 18:17:17 +00:00
|
|
|
$objValidation = $this->phpSheet->getCell($coordinate)->getDataValidation();
|
2015-05-17 16:10:35 +00:00
|
|
|
$objValidation->setType($type);
|
|
|
|
$objValidation->setErrorStyle($errorStyle);
|
|
|
|
$objValidation->setAllowBlank((bool)$allowBlank);
|
|
|
|
$objValidation->setShowInputMessage((bool)$showInputMessage);
|
|
|
|
$objValidation->setShowErrorMessage((bool)$showErrorMessage);
|
|
|
|
$objValidation->setShowDropDown(!$suppressDropDown);
|
|
|
|
$objValidation->setOperator($operator);
|
|
|
|
$objValidation->setErrorTitle($errorTitle);
|
|
|
|
$objValidation->setError($error);
|
|
|
|
$objValidation->setPromptTitle($promptTitle);
|
|
|
|
$objValidation->setPrompt($prompt);
|
|
|
|
$objValidation->setFormula1($formula1);
|
|
|
|
$objValidation->setFormula2($formula2);
|
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read SHEETLAYOUT record. Stores sheet tab color information.
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readSheetLayout()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// local pointer in record data
|
|
|
|
$offset = 0;
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!$this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 0; size: 2; repeated record identifier 0x0862
|
|
|
|
|
|
|
|
// offset: 2; size: 10; not used
|
|
|
|
|
|
|
|
// offset: 12; size: 4; size of record data
|
|
|
|
// Excel 2003 uses size of 0x14 (documented), Excel 2007 uses size of 0x28 (not documented?)
|
2015-05-20 18:17:17 +00:00
|
|
|
$sz = self::getInt4d($recordData, 12);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
switch ($sz) {
|
|
|
|
case 0x14:
|
|
|
|
// offset: 16; size: 2; color index for sheet tab
|
2015-05-20 18:17:17 +00:00
|
|
|
$colorIndex = self::getInt2d($recordData, 16);
|
|
|
|
$color = self::readColor($colorIndex, $this->palette, $this->version);
|
|
|
|
$this->phpSheet->getTabColor()->setRGB($color['rgb']);
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case 0x28:
|
|
|
|
// TODO: Investigate structure for .xls SHEETLAYOUT record as saved by MS Office Excel 2007
|
|
|
|
return;
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read SHEETPROTECTION record (FEATHEADR)
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readSheetProtection()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
return;
|
|
|
|
}
|
|
|
|
|
|
|
|
// offset: 0; size: 2; repeated record header
|
|
|
|
|
|
|
|
// offset: 2; size: 2; FRT cell reference flag (=0 currently)
|
|
|
|
|
|
|
|
// offset: 4; size: 8; Currently not used and set to 0
|
|
|
|
|
|
|
|
// offset: 12; size: 2; Shared feature type index (2=Enhanced Protetion, 4=SmartTag)
|
2015-05-20 18:17:17 +00:00
|
|
|
$isf = self::getInt2d($recordData, 12);
|
2015-05-17 16:10:35 +00:00
|
|
|
if ($isf != 2) {
|
|
|
|
return;
|
|
|
|
}
|
|
|
|
|
|
|
|
// offset: 14; size: 1; =1 since this is a feat header
|
|
|
|
|
|
|
|
// offset: 15; size: 4; size of rgbHdrSData
|
|
|
|
|
|
|
|
// rgbHdrSData, assume "Enhanced Protection"
|
|
|
|
// offset: 19; size: 2; option flags
|
2015-05-20 18:17:17 +00:00
|
|
|
$options = self::getInt2d($recordData, 19);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 0; mask 0x0001; 1 = user may edit objects, 0 = users must not edit objects
|
|
|
|
$bool = (0x0001 & $options) >> 0;
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getProtection()->setObjects(!$bool);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 1; mask 0x0002; edit scenarios
|
|
|
|
$bool = (0x0002 & $options) >> 1;
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getProtection()->setScenarios(!$bool);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 2; mask 0x0004; format cells
|
|
|
|
$bool = (0x0004 & $options) >> 2;
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getProtection()->setFormatCells(!$bool);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 3; mask 0x0008; format columns
|
|
|
|
$bool = (0x0008 & $options) >> 3;
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getProtection()->setFormatColumns(!$bool);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 4; mask 0x0010; format rows
|
|
|
|
$bool = (0x0010 & $options) >> 4;
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getProtection()->setFormatRows(!$bool);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 5; mask 0x0020; insert columns
|
|
|
|
$bool = (0x0020 & $options) >> 5;
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getProtection()->setInsertColumns(!$bool);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 6; mask 0x0040; insert rows
|
|
|
|
$bool = (0x0040 & $options) >> 6;
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getProtection()->setInsertRows(!$bool);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 7; mask 0x0080; insert hyperlinks
|
|
|
|
$bool = (0x0080 & $options) >> 7;
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getProtection()->setInsertHyperlinks(!$bool);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 8; mask 0x0100; delete columns
|
|
|
|
$bool = (0x0100 & $options) >> 8;
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getProtection()->setDeleteColumns(!$bool);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 9; mask 0x0200; delete rows
|
|
|
|
$bool = (0x0200 & $options) >> 9;
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getProtection()->setDeleteRows(!$bool);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 10; mask 0x0400; select locked cells
|
|
|
|
$bool = (0x0400 & $options) >> 10;
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getProtection()->setSelectLockedCells(!$bool);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 11; mask 0x0800; sort cell range
|
|
|
|
$bool = (0x0800 & $options) >> 11;
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getProtection()->setSort(!$bool);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 12; mask 0x1000; auto filter
|
|
|
|
$bool = (0x1000 & $options) >> 12;
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getProtection()->setAutoFilter(!$bool);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 13; mask 0x2000; pivot tables
|
|
|
|
$bool = (0x2000 & $options) >> 13;
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getProtection()->setPivotTables(!$bool);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 14; mask 0x4000; select unlocked cells
|
|
|
|
$bool = (0x4000 & $options) >> 14;
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->getProtection()->setSelectUnlockedCells(!$bool);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 21; size: 2; not used
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read RANGEPROTECTION record
|
|
|
|
* Reading of this record is based on Microsoft Office Excel 97-2000 Binary File Format Specification,
|
|
|
|
* where it is referred to as FEAT record
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readRangeProtection()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// local pointer in record data
|
|
|
|
$offset = 0;
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!$this->readDataOnly) {
|
2015-05-17 16:10:35 +00:00
|
|
|
$offset += 12;
|
|
|
|
|
|
|
|
// offset: 12; size: 2; shared feature type, 2 = enhanced protection, 4 = smart tag
|
2015-05-20 18:17:17 +00:00
|
|
|
$isf = self::getInt2d($recordData, 12);
|
2015-05-17 16:10:35 +00:00
|
|
|
if ($isf != 2) {
|
|
|
|
// we only read FEAT records of type 2
|
|
|
|
return;
|
|
|
|
}
|
|
|
|
$offset += 2;
|
|
|
|
|
|
|
|
$offset += 5;
|
|
|
|
|
|
|
|
// offset: 19; size: 2; count of ref ranges this feature is on
|
2015-05-20 18:17:17 +00:00
|
|
|
$cref = self::getInt2d($recordData, 19);
|
2015-05-17 16:10:35 +00:00
|
|
|
$offset += 2;
|
|
|
|
|
|
|
|
$offset += 6;
|
|
|
|
|
|
|
|
// offset: 27; size: 8 * $cref; list of cell ranges (like in hyperlink record)
|
|
|
|
$cellRanges = array();
|
|
|
|
for ($i = 0; $i < $cref; ++$i) {
|
|
|
|
try {
|
2015-05-20 18:17:17 +00:00
|
|
|
$cellRange = $this->readBIFF8CellRangeAddressFixed(substr($recordData, 27 + 8 * $i, 8));
|
2015-05-17 16:10:35 +00:00
|
|
|
} catch (PHPExcel_Exception $e) {
|
|
|
|
return;
|
|
|
|
}
|
|
|
|
$cellRanges[] = $cellRange;
|
|
|
|
$offset += 8;
|
|
|
|
}
|
|
|
|
|
|
|
|
// offset: var; size: var; variable length of feature specific data
|
|
|
|
$rgbFeat = substr($recordData, $offset);
|
|
|
|
$offset += 4;
|
|
|
|
|
|
|
|
// offset: var; size: 4; the encrypted password (only 16-bit although field is 32-bit)
|
2015-05-20 18:17:17 +00:00
|
|
|
$wPassword = self::getInt4d($recordData, $offset);
|
2015-05-17 16:10:35 +00:00
|
|
|
$offset += 4;
|
|
|
|
|
|
|
|
// Apply range protection to sheet
|
|
|
|
if ($cellRanges) {
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->phpSheet->protectCells(implode(' ', $cellRanges), strtoupper(dechex($wPassword)), true);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read IMDATA record
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readImData()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// get spliced record data
|
2015-05-20 18:17:17 +00:00
|
|
|
$splicedRecordData = $this->getSplicedRecordData();
|
2015-05-17 16:10:35 +00:00
|
|
|
$recordData = $splicedRecordData['recordData'];
|
|
|
|
|
|
|
|
// UNDER CONSTRUCTION
|
|
|
|
|
|
|
|
// offset: 0; size: 2; image format
|
2015-05-20 18:17:17 +00:00
|
|
|
$cf = self::getInt2d($recordData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 2; size: 2; environment from which the file was written
|
2015-05-20 18:17:17 +00:00
|
|
|
$env = self::getInt2d($recordData, 2);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 4; size: 4; length of the image data
|
2015-05-20 18:17:17 +00:00
|
|
|
$lcb = self::getInt4d($recordData, 4);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 8; size: var; image data
|
|
|
|
$iData = substr($recordData, 8);
|
|
|
|
|
|
|
|
switch ($cf) {
|
|
|
|
case 0x09: // Windows bitmap format
|
|
|
|
// BITMAPCOREINFO
|
|
|
|
// 1. BITMAPCOREHEADER
|
|
|
|
// offset: 0; size: 4; bcSize, Specifies the number of bytes required by the structure
|
2015-05-20 18:17:17 +00:00
|
|
|
$bcSize = self::getInt4d($iData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
// var_dump($bcSize);
|
|
|
|
|
|
|
|
// offset: 4; size: 2; bcWidth, specifies the width of the bitmap, in pixels
|
2015-05-20 18:17:17 +00:00
|
|
|
$bcWidth = self::getInt2d($iData, 4);
|
2015-05-17 16:10:35 +00:00
|
|
|
// var_dump($bcWidth);
|
|
|
|
|
|
|
|
// offset: 6; size: 2; bcHeight, specifies the height of the bitmap, in pixels.
|
2015-05-20 18:17:17 +00:00
|
|
|
$bcHeight = self::getInt2d($iData, 6);
|
2015-05-17 16:10:35 +00:00
|
|
|
// var_dump($bcHeight);
|
|
|
|
$ih = imagecreatetruecolor($bcWidth, $bcHeight);
|
|
|
|
|
|
|
|
// offset: 8; size: 2; bcPlanes, specifies the number of planes for the target device. This value must be 1
|
|
|
|
|
|
|
|
// offset: 10; size: 2; bcBitCount specifies the number of bits-per-pixel. This value must be 1, 4, 8, or 24
|
2015-05-20 18:17:17 +00:00
|
|
|
$bcBitCount = self::getInt2d($iData, 10);
|
2015-05-17 16:10:35 +00:00
|
|
|
// var_dump($bcBitCount);
|
|
|
|
|
|
|
|
$rgbString = substr($iData, 12);
|
|
|
|
$rgbTriples = array();
|
|
|
|
while (strlen($rgbString) > 0) {
|
|
|
|
$rgbTriples[] = unpack('Cb/Cg/Cr', $rgbString);
|
|
|
|
$rgbString = substr($rgbString, 3);
|
|
|
|
}
|
|
|
|
$x = 0;
|
|
|
|
$y = 0;
|
|
|
|
foreach ($rgbTriples as $i => $rgbTriple) {
|
|
|
|
$color = imagecolorallocate($ih, $rgbTriple['r'], $rgbTriple['g'], $rgbTriple['b']);
|
|
|
|
imagesetpixel($ih, $x, $bcHeight - 1 - $y, $color);
|
|
|
|
$x = ($x + 1) % $bcWidth;
|
|
|
|
$y = $y + floor(($x + 1) / $bcWidth);
|
|
|
|
}
|
|
|
|
//imagepng($ih, 'image.png');
|
|
|
|
|
|
|
|
$drawing = new PHPExcel_Worksheet_Drawing();
|
|
|
|
$drawing->setPath($filename);
|
2015-05-20 18:17:17 +00:00
|
|
|
$drawing->setWorksheet($this->phpSheet);
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case 0x02: // Windows metafile or Macintosh PICT format
|
|
|
|
case 0x0e: // native format
|
|
|
|
default:
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
// getSplicedRecordData() takes care of moving current position in data stream
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read a free CONTINUE record. Free CONTINUE record may be a camouflaged MSODRAWING record
|
|
|
|
* When MSODRAWING data on a sheet exceeds 8224 bytes, CONTINUE records are used instead. Undocumented.
|
|
|
|
* In this case, we must treat the CONTINUE record as a MSODRAWING record
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readContinue()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$recordData = $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// check if we are reading drawing data
|
|
|
|
// this is in case a free CONTINUE record occurs in other circumstances we are unaware of
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($this->drawingData == '') {
|
2015-05-17 16:10:35 +00:00
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
return;
|
|
|
|
}
|
|
|
|
|
|
|
|
// check if record data is at least 4 bytes long, otherwise there is no chance this is MSODRAWING data
|
|
|
|
if ($length < 4) {
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
return;
|
|
|
|
}
|
|
|
|
|
|
|
|
// dirty check to see if CONTINUE record could be a camouflaged MSODRAWING record
|
|
|
|
// look inside CONTINUE record to see if it looks like a part of an Escher stream
|
|
|
|
// we know that Escher stream may be split at least at
|
|
|
|
// 0xF003 MsofbtSpgrContainer
|
|
|
|
// 0xF004 MsofbtSpContainer
|
|
|
|
// 0xF00D MsofbtClientTextbox
|
|
|
|
$validSplitPoints = array(0xF003, 0xF004, 0xF00D); // add identifiers if we find more
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$splitPoint = self::getInt2d($recordData, 2);
|
2015-05-17 16:10:35 +00:00
|
|
|
if (in_array($splitPoint, $validSplitPoints)) {
|
|
|
|
// get spliced record data (and move pointer to next record)
|
2015-05-20 18:17:17 +00:00
|
|
|
$splicedRecordData = $this->getSplicedRecordData();
|
|
|
|
$this->drawingData .= $splicedRecordData['recordData'];
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
return;
|
|
|
|
}
|
|
|
|
|
|
|
|
// move stream pointer to next record
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Reads a record from current position in data stream and continues reading data as long as CONTINUE
|
|
|
|
* records are found. Splices the record data pieces and returns the combined string as if record data
|
|
|
|
* is in one piece.
|
|
|
|
* Moves to next current position in data stream to start of next record different from a CONtINUE record
|
|
|
|
*
|
|
|
|
* @return array
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function getSplicedRecordData()
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
$data = '';
|
|
|
|
$spliceOffsets = array();
|
|
|
|
|
|
|
|
$i = 0;
|
|
|
|
$spliceOffsets[0] = 0;
|
|
|
|
|
|
|
|
do {
|
|
|
|
++$i;
|
|
|
|
|
|
|
|
// offset: 0; size: 2; identifier
|
2015-05-20 18:17:17 +00:00
|
|
|
$identifier = self::getInt2d($this->data, $this->pos);
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 2; size: 2; length
|
2015-05-20 18:17:17 +00:00
|
|
|
$length = self::getInt2d($this->data, $this->pos + 2);
|
|
|
|
$data .= $this->readRecordData($this->data, $this->pos + 4, $length);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
$spliceOffsets[$i] = $spliceOffsets[$i - 1] + $length;
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$this->pos += 4 + $length;
|
|
|
|
$nextIdentifier = self::getInt2d($this->data, $this->pos);
|
2015-05-17 16:10:35 +00:00
|
|
|
} while ($nextIdentifier == self::XLS_Type_CONTINUE);
|
|
|
|
|
|
|
|
$splicedData = array(
|
|
|
|
'recordData' => $data,
|
|
|
|
'spliceOffsets' => $spliceOffsets,
|
|
|
|
);
|
|
|
|
|
|
|
|
return $splicedData;
|
|
|
|
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Convert formula structure into human readable Excel formula like 'A3+A5*5'
|
|
|
|
*
|
|
|
|
* @param string $formulaStructure The complete binary data for the formula
|
|
|
|
* @param string $baseCell Base cell, only needed when formula contains tRefN tokens, e.g. with shared formulas
|
|
|
|
* @return string Human readable formula
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function getFormulaFromStructure($formulaStructure, $baseCell = 'A1')
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
// offset: 0; size: 2; size of the following formula data
|
2015-05-20 18:17:17 +00:00
|
|
|
$sz = self::getInt2d($formulaStructure, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 2; size: sz
|
|
|
|
$formulaData = substr($formulaStructure, 2, $sz);
|
|
|
|
|
|
|
|
// for debug: dump the formula data
|
|
|
|
//echo '<xmp>';
|
|
|
|
//echo 'size: ' . $sz . "\n";
|
|
|
|
//echo 'the entire formula data: ';
|
|
|
|
//Debug::dump($formulaData);
|
|
|
|
//echo "\n----\n";
|
|
|
|
|
|
|
|
// offset: 2 + sz; size: variable (optional)
|
|
|
|
if (strlen($formulaStructure) > 2 + $sz) {
|
|
|
|
$additionalData = substr($formulaStructure, 2 + $sz);
|
|
|
|
|
|
|
|
// for debug: dump the additional data
|
|
|
|
//echo 'the entire additional data: ';
|
|
|
|
//Debug::dump($additionalData);
|
|
|
|
//echo "\n----\n";
|
|
|
|
} else {
|
|
|
|
$additionalData = '';
|
|
|
|
}
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
return $this->getFormulaFromData($formulaData, $additionalData, $baseCell);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Take formula data and additional data for formula and return human readable formula
|
|
|
|
*
|
|
|
|
* @param string $formulaData The binary data for the formula itself
|
|
|
|
* @param string $additionalData Additional binary data going with the formula
|
|
|
|
* @param string $baseCell Base cell, only needed when formula contains tRefN tokens, e.g. with shared formulas
|
|
|
|
* @return string Human readable formula
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function getFormulaFromData($formulaData, $additionalData = '', $baseCell = 'A1')
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
// start parsing the formula data
|
|
|
|
$tokens = array();
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
while (strlen($formulaData) > 0 and $token = $this->getNextToken($formulaData, $baseCell)) {
|
2015-05-17 16:10:35 +00:00
|
|
|
$tokens[] = $token;
|
|
|
|
$formulaData = substr($formulaData, $token['size']);
|
|
|
|
|
|
|
|
// for debug: dump the token
|
|
|
|
//var_dump($token);
|
|
|
|
}
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$formulaString = $this->createFormulaFromTokens($tokens, $additionalData);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
return $formulaString;
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Take array of tokens together with additional data for formula and return human readable formula
|
|
|
|
*
|
|
|
|
* @param array $tokens
|
|
|
|
* @param array $additionalData Additional binary data going with the formula
|
|
|
|
* @param string $baseCell Base cell, only needed when formula contains tRefN tokens, e.g. with shared formulas
|
|
|
|
* @return string Human readable formula
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function createFormulaFromTokens($tokens, $additionalData)
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
// empty formula?
|
|
|
|
if (empty($tokens)) {
|
|
|
|
return '';
|
|
|
|
}
|
|
|
|
|
|
|
|
$formulaStrings = array();
|
|
|
|
foreach ($tokens as $token) {
|
|
|
|
// initialize spaces
|
|
|
|
$space0 = isset($space0) ? $space0 : ''; // spaces before next token, not tParen
|
|
|
|
$space1 = isset($space1) ? $space1 : ''; // carriage returns before next token, not tParen
|
|
|
|
$space2 = isset($space2) ? $space2 : ''; // spaces before opening parenthesis
|
|
|
|
$space3 = isset($space3) ? $space3 : ''; // carriage returns before opening parenthesis
|
|
|
|
$space4 = isset($space4) ? $space4 : ''; // spaces before closing parenthesis
|
|
|
|
$space5 = isset($space5) ? $space5 : ''; // carriage returns before closing parenthesis
|
|
|
|
|
|
|
|
switch ($token['name']) {
|
|
|
|
case 'tAdd': // addition
|
|
|
|
case 'tConcat': // addition
|
|
|
|
case 'tDiv': // division
|
|
|
|
case 'tEQ': // equality
|
|
|
|
case 'tGE': // greater than or equal
|
|
|
|
case 'tGT': // greater than
|
|
|
|
case 'tIsect': // intersection
|
|
|
|
case 'tLE': // less than or equal
|
|
|
|
case 'tList': // less than or equal
|
|
|
|
case 'tLT': // less than
|
|
|
|
case 'tMul': // multiplication
|
|
|
|
case 'tNE': // multiplication
|
|
|
|
case 'tPower': // power
|
|
|
|
case 'tRange': // range
|
|
|
|
case 'tSub': // subtraction
|
|
|
|
$op2 = array_pop($formulaStrings);
|
|
|
|
$op1 = array_pop($formulaStrings);
|
|
|
|
$formulaStrings[] = "$op1$space1$space0{$token['data']}$op2";
|
|
|
|
unset($space0, $space1);
|
|
|
|
break;
|
|
|
|
case 'tUplus': // unary plus
|
|
|
|
case 'tUminus': // unary minus
|
|
|
|
$op = array_pop($formulaStrings);
|
|
|
|
$formulaStrings[] = "$space1$space0{$token['data']}$op";
|
|
|
|
unset($space0, $space1);
|
|
|
|
break;
|
|
|
|
case 'tPercent': // percent sign
|
|
|
|
$op = array_pop($formulaStrings);
|
|
|
|
$formulaStrings[] = "$op$space1$space0{$token['data']}";
|
|
|
|
unset($space0, $space1);
|
|
|
|
break;
|
|
|
|
case 'tAttrVolatile': // indicates volatile function
|
|
|
|
case 'tAttrIf':
|
|
|
|
case 'tAttrSkip':
|
|
|
|
case 'tAttrChoose':
|
|
|
|
// token is only important for Excel formula evaluator
|
|
|
|
// do nothing
|
|
|
|
break;
|
|
|
|
case 'tAttrSpace': // space / carriage return
|
|
|
|
// space will be used when next token arrives, do not alter formulaString stack
|
|
|
|
switch ($token['data']['spacetype']) {
|
|
|
|
case 'type0':
|
|
|
|
$space0 = str_repeat(' ', $token['data']['spacecount']);
|
|
|
|
break;
|
|
|
|
case 'type1':
|
|
|
|
$space1 = str_repeat("\n", $token['data']['spacecount']);
|
|
|
|
break;
|
|
|
|
case 'type2':
|
|
|
|
$space2 = str_repeat(' ', $token['data']['spacecount']);
|
|
|
|
break;
|
|
|
|
case 'type3':
|
|
|
|
$space3 = str_repeat("\n", $token['data']['spacecount']);
|
|
|
|
break;
|
|
|
|
case 'type4':
|
|
|
|
$space4 = str_repeat(' ', $token['data']['spacecount']);
|
|
|
|
break;
|
|
|
|
case 'type5':
|
|
|
|
$space5 = str_repeat("\n", $token['data']['spacecount']);
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
break;
|
|
|
|
case 'tAttrSum': // SUM function with one parameter
|
|
|
|
$op = array_pop($formulaStrings);
|
|
|
|
$formulaStrings[] = "{$space1}{$space0}SUM($op)";
|
|
|
|
unset($space0, $space1);
|
|
|
|
break;
|
|
|
|
case 'tFunc': // function with fixed number of arguments
|
|
|
|
case 'tFuncV': // function with variable number of arguments
|
|
|
|
if ($token['data']['function'] != '') {
|
|
|
|
// normal function
|
|
|
|
$ops = array(); // array of operators
|
|
|
|
for ($i = 0; $i < $token['data']['args']; ++$i) {
|
|
|
|
$ops[] = array_pop($formulaStrings);
|
|
|
|
}
|
|
|
|
$ops = array_reverse($ops);
|
|
|
|
$formulaStrings[] = "$space1$space0{$token['data']['function']}(" . implode(',', $ops) . ")";
|
|
|
|
unset($space0, $space1);
|
|
|
|
} else {
|
|
|
|
// add-in function
|
|
|
|
$ops = array(); // array of operators
|
|
|
|
for ($i = 0; $i < $token['data']['args'] - 1; ++$i) {
|
|
|
|
$ops[] = array_pop($formulaStrings);
|
|
|
|
}
|
|
|
|
$ops = array_reverse($ops);
|
|
|
|
$function = array_pop($formulaStrings);
|
|
|
|
$formulaStrings[] = "$space1$space0$function(" . implode(',', $ops) . ")";
|
|
|
|
unset($space0, $space1);
|
|
|
|
}
|
|
|
|
break;
|
|
|
|
case 'tParen': // parenthesis
|
|
|
|
$expression = array_pop($formulaStrings);
|
|
|
|
$formulaStrings[] = "$space3$space2($expression$space5$space4)";
|
|
|
|
unset($space2, $space3, $space4, $space5);
|
|
|
|
break;
|
|
|
|
case 'tArray': // array constant
|
|
|
|
$constantArray = self::_readBIFF8ConstantArray($additionalData);
|
|
|
|
$formulaStrings[] = $space1 . $space0 . $constantArray['value'];
|
|
|
|
$additionalData = substr($additionalData, $constantArray['size']); // bite of chunk of additional data
|
|
|
|
unset($space0, $space1);
|
|
|
|
break;
|
|
|
|
case 'tMemArea':
|
|
|
|
// bite off chunk of additional data
|
2015-05-20 18:17:17 +00:00
|
|
|
$cellRangeAddressList = $this->readBIFF8CellRangeAddressList($additionalData);
|
2015-05-17 16:10:35 +00:00
|
|
|
$additionalData = substr($additionalData, $cellRangeAddressList['size']);
|
|
|
|
$formulaStrings[] = "$space1$space0{$token['data']}";
|
|
|
|
unset($space0, $space1);
|
|
|
|
break;
|
|
|
|
case 'tArea': // cell range address
|
|
|
|
case 'tBool': // boolean
|
|
|
|
case 'tErr': // error code
|
|
|
|
case 'tInt': // integer
|
|
|
|
case 'tMemErr':
|
|
|
|
case 'tMemFunc':
|
|
|
|
case 'tMissArg':
|
|
|
|
case 'tName':
|
|
|
|
case 'tNameX':
|
|
|
|
case 'tNum': // number
|
|
|
|
case 'tRef': // single cell reference
|
|
|
|
case 'tRef3d': // 3d cell reference
|
|
|
|
case 'tArea3d': // 3d cell range reference
|
|
|
|
case 'tRefN':
|
|
|
|
case 'tAreaN':
|
|
|
|
case 'tStr': // string
|
|
|
|
$formulaStrings[] = "$space1$space0{$token['data']}";
|
|
|
|
unset($space0, $space1);
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
$formulaString = $formulaStrings[0];
|
|
|
|
|
|
|
|
// for debug: dump the human readable formula
|
|
|
|
//echo '----' . "\n";
|
|
|
|
//echo 'Formula: ' . $formulaString;
|
|
|
|
|
|
|
|
return $formulaString;
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Fetch next token from binary formula data
|
|
|
|
*
|
|
|
|
* @param string Formula data
|
|
|
|
* @param string $baseCell Base cell, only needed when formula contains tRefN tokens, e.g. with shared formulas
|
|
|
|
* @return array
|
|
|
|
* @throws PHPExcel_Reader_Exception
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function getNextToken($formulaData, $baseCell = 'A1')
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
// offset: 0; size: 1; token id
|
|
|
|
$id = ord($formulaData[0]); // token id
|
|
|
|
$name = false; // initialize token name
|
|
|
|
|
|
|
|
switch ($id) {
|
|
|
|
case 0x03:
|
|
|
|
$name = 'tAdd';
|
|
|
|
$size = 1;
|
|
|
|
$data = '+';
|
|
|
|
break;
|
|
|
|
case 0x04:
|
|
|
|
$name = 'tSub';
|
|
|
|
$size = 1;
|
|
|
|
$data = '-';
|
|
|
|
break;
|
|
|
|
case 0x05:
|
|
|
|
$name = 'tMul';
|
|
|
|
$size = 1;
|
|
|
|
$data = '*';
|
|
|
|
break;
|
|
|
|
case 0x06:
|
|
|
|
$name = 'tDiv';
|
|
|
|
$size = 1;
|
|
|
|
$data = '/';
|
|
|
|
break;
|
|
|
|
case 0x07:
|
|
|
|
$name = 'tPower';
|
|
|
|
$size = 1;
|
|
|
|
$data = '^';
|
|
|
|
break;
|
|
|
|
case 0x08:
|
|
|
|
$name = 'tConcat';
|
|
|
|
$size = 1;
|
|
|
|
$data = '&';
|
|
|
|
break;
|
|
|
|
case 0x09:
|
|
|
|
$name = 'tLT';
|
|
|
|
$size = 1;
|
|
|
|
$data = '<';
|
|
|
|
break;
|
|
|
|
case 0x0A:
|
|
|
|
$name = 'tLE';
|
|
|
|
$size = 1;
|
|
|
|
$data = '<=';
|
|
|
|
break;
|
|
|
|
case 0x0B:
|
|
|
|
$name = 'tEQ';
|
|
|
|
$size = 1;
|
|
|
|
$data = '=';
|
|
|
|
break;
|
|
|
|
case 0x0C:
|
|
|
|
$name = 'tGE';
|
|
|
|
$size = 1;
|
|
|
|
$data = '>=';
|
|
|
|
break;
|
|
|
|
case 0x0D:
|
|
|
|
$name = 'tGT';
|
|
|
|
$size = 1;
|
|
|
|
$data = '>';
|
|
|
|
break;
|
|
|
|
case 0x0E:
|
|
|
|
$name = 'tNE';
|
|
|
|
$size = 1;
|
|
|
|
$data = '<>';
|
|
|
|
break;
|
|
|
|
case 0x0F:
|
|
|
|
$name = 'tIsect';
|
|
|
|
$size = 1;
|
|
|
|
$data = ' ';
|
|
|
|
break;
|
|
|
|
case 0x10:
|
|
|
|
$name = 'tList';
|
|
|
|
$size = 1;
|
|
|
|
$data = ',';
|
|
|
|
break;
|
|
|
|
case 0x11:
|
|
|
|
$name = 'tRange';
|
|
|
|
$size = 1;
|
|
|
|
$data = ':';
|
|
|
|
break;
|
|
|
|
case 0x12:
|
|
|
|
$name = 'tUplus';
|
|
|
|
$size = 1;
|
|
|
|
$data = '+';
|
|
|
|
break;
|
|
|
|
case 0x13:
|
|
|
|
$name = 'tUminus';
|
|
|
|
$size = 1;
|
|
|
|
$data = '-';
|
|
|
|
break;
|
|
|
|
case 0x14:
|
|
|
|
$name = 'tPercent';
|
|
|
|
$size = 1;
|
|
|
|
$data = '%';
|
|
|
|
break;
|
|
|
|
case 0x15: // parenthesis
|
|
|
|
$name = 'tParen';
|
|
|
|
$size = 1;
|
|
|
|
$data = null;
|
|
|
|
break;
|
|
|
|
case 0x16: // missing argument
|
|
|
|
$name = 'tMissArg';
|
|
|
|
$size = 1;
|
|
|
|
$data = '';
|
|
|
|
break;
|
|
|
|
case 0x17: // string
|
|
|
|
$name = 'tStr';
|
|
|
|
// offset: 1; size: var; Unicode string, 8-bit string length
|
2015-05-20 18:17:17 +00:00
|
|
|
$string = self::readUnicodeStringShort(substr($formulaData, 1));
|
2015-05-17 16:10:35 +00:00
|
|
|
$size = 1 + $string['size'];
|
2015-05-20 18:17:17 +00:00
|
|
|
$data = self::UTF8toExcelDoubleQuoted($string['value']);
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case 0x19: // Special attribute
|
|
|
|
// offset: 1; size: 1; attribute type flags:
|
|
|
|
switch (ord($formulaData[1])) {
|
|
|
|
case 0x01:
|
|
|
|
$name = 'tAttrVolatile';
|
|
|
|
$size = 4;
|
|
|
|
$data = null;
|
|
|
|
break;
|
|
|
|
case 0x02:
|
|
|
|
$name = 'tAttrIf';
|
|
|
|
$size = 4;
|
|
|
|
$data = null;
|
|
|
|
break;
|
|
|
|
case 0x04:
|
|
|
|
$name = 'tAttrChoose';
|
|
|
|
// offset: 2; size: 2; number of choices in the CHOOSE function ($nc, number of parameters decreased by 1)
|
2015-05-20 18:17:17 +00:00
|
|
|
$nc = self::getInt2d($formulaData, 2);
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 4; size: 2 * $nc
|
|
|
|
// offset: 4 + 2 * $nc; size: 2
|
|
|
|
$size = 2 * $nc + 6;
|
|
|
|
$data = null;
|
|
|
|
break;
|
|
|
|
case 0x08:
|
|
|
|
$name = 'tAttrSkip';
|
|
|
|
$size = 4;
|
|
|
|
$data = null;
|
|
|
|
break;
|
|
|
|
case 0x10:
|
|
|
|
$name = 'tAttrSum';
|
|
|
|
$size = 4;
|
|
|
|
$data = null;
|
|
|
|
break;
|
|
|
|
case 0x40:
|
|
|
|
case 0x41:
|
|
|
|
$name = 'tAttrSpace';
|
|
|
|
$size = 4;
|
|
|
|
// offset: 2; size: 2; space type and position
|
|
|
|
switch (ord($formulaData[2])) {
|
|
|
|
case 0x00:
|
|
|
|
$spacetype = 'type0';
|
|
|
|
break;
|
|
|
|
case 0x01:
|
|
|
|
$spacetype = 'type1';
|
|
|
|
break;
|
|
|
|
case 0x02:
|
|
|
|
$spacetype = 'type2';
|
|
|
|
break;
|
|
|
|
case 0x03:
|
|
|
|
$spacetype = 'type3';
|
|
|
|
break;
|
|
|
|
case 0x04:
|
|
|
|
$spacetype = 'type4';
|
|
|
|
break;
|
|
|
|
case 0x05:
|
|
|
|
$spacetype = 'type5';
|
|
|
|
break;
|
|
|
|
default:
|
|
|
|
throw new PHPExcel_Reader_Exception('Unrecognized space type in tAttrSpace token');
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
// offset: 3; size: 1; number of inserted spaces/carriage returns
|
|
|
|
$spacecount = ord($formulaData[3]);
|
|
|
|
|
|
|
|
$data = array('spacetype' => $spacetype, 'spacecount' => $spacecount);
|
|
|
|
break;
|
|
|
|
default:
|
|
|
|
throw new PHPExcel_Reader_Exception('Unrecognized attribute flag in tAttr token');
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
break;
|
|
|
|
case 0x1C: // error code
|
|
|
|
// offset: 1; size: 1; error code
|
|
|
|
$name = 'tErr';
|
|
|
|
$size = 2;
|
2015-05-20 18:17:17 +00:00
|
|
|
$data = self::mapErrorCode(ord($formulaData[1]));
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case 0x1D: // boolean
|
|
|
|
// offset: 1; size: 1; 0 = false, 1 = true;
|
|
|
|
$name = 'tBool';
|
|
|
|
$size = 2;
|
|
|
|
$data = ord($formulaData[1]) ? 'TRUE' : 'FALSE';
|
|
|
|
break;
|
|
|
|
case 0x1E: // integer
|
|
|
|
// offset: 1; size: 2; unsigned 16-bit integer
|
|
|
|
$name = 'tInt';
|
|
|
|
$size = 3;
|
2015-05-20 18:17:17 +00:00
|
|
|
$data = self::getInt2d($formulaData, 1);
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case 0x1F: // number
|
|
|
|
// offset: 1; size: 8;
|
|
|
|
$name = 'tNum';
|
|
|
|
$size = 9;
|
2015-05-20 18:17:17 +00:00
|
|
|
$data = self::extractNumber(substr($formulaData, 1));
|
2015-05-17 16:10:35 +00:00
|
|
|
$data = str_replace(',', '.', (string)$data); // in case non-English locale
|
|
|
|
break;
|
|
|
|
case 0x20: // array constant
|
|
|
|
case 0x40:
|
|
|
|
case 0x60:
|
|
|
|
// offset: 1; size: 7; not used
|
|
|
|
$name = 'tArray';
|
|
|
|
$size = 8;
|
|
|
|
$data = null;
|
|
|
|
break;
|
|
|
|
case 0x21: // function with fixed number of arguments
|
|
|
|
case 0x41:
|
|
|
|
case 0x61:
|
|
|
|
$name = 'tFunc';
|
|
|
|
$size = 3;
|
|
|
|
// offset: 1; size: 2; index to built-in sheet function
|
2015-05-20 18:17:17 +00:00
|
|
|
switch (self::getInt2d($formulaData, 1)) {
|
2015-05-17 16:10:35 +00:00
|
|
|
case 2:
|
|
|
|
$function = 'ISNA';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 3:
|
|
|
|
$function = 'ISERROR';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 10:
|
|
|
|
$function = 'NA';
|
|
|
|
$args = 0;
|
|
|
|
break;
|
|
|
|
case 15:
|
|
|
|
$function = 'SIN';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 16:
|
|
|
|
$function = 'COS';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 17:
|
|
|
|
$function = 'TAN';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 18:
|
|
|
|
$function = 'ATAN';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 19:
|
|
|
|
$function = 'PI';
|
|
|
|
$args = 0;
|
|
|
|
break;
|
|
|
|
case 20:
|
|
|
|
$function = 'SQRT';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 21:
|
|
|
|
$function = 'EXP';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 22:
|
|
|
|
$function = 'LN';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 23:
|
|
|
|
$function = 'LOG10';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 24:
|
|
|
|
$function = 'ABS';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 25:
|
|
|
|
$function = 'INT';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 26:
|
|
|
|
$function = 'SIGN';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 27:
|
|
|
|
$function = 'ROUND';
|
|
|
|
$args = 2;
|
|
|
|
break;
|
|
|
|
case 30:
|
|
|
|
$function = 'REPT';
|
|
|
|
$args = 2;
|
|
|
|
break;
|
|
|
|
case 31:
|
|
|
|
$function = 'MID';
|
|
|
|
$args = 3;
|
|
|
|
break;
|
|
|
|
case 32:
|
|
|
|
$function = 'LEN';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 33:
|
|
|
|
$function = 'VALUE';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 34:
|
|
|
|
$function = 'TRUE';
|
|
|
|
$args = 0;
|
|
|
|
break;
|
|
|
|
case 35:
|
|
|
|
$function = 'FALSE';
|
|
|
|
$args = 0;
|
|
|
|
break;
|
|
|
|
case 38:
|
|
|
|
$function = 'NOT';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 39:
|
|
|
|
$function = 'MOD';
|
|
|
|
$args = 2;
|
|
|
|
break;
|
|
|
|
case 40:
|
|
|
|
$function = 'DCOUNT';
|
|
|
|
$args = 3;
|
|
|
|
break;
|
|
|
|
case 41:
|
|
|
|
$function = 'DSUM';
|
|
|
|
$args = 3;
|
|
|
|
break;
|
|
|
|
case 42:
|
|
|
|
$function = 'DAVERAGE';
|
|
|
|
$args = 3;
|
|
|
|
break;
|
|
|
|
case 43:
|
|
|
|
$function = 'DMIN';
|
|
|
|
$args = 3;
|
|
|
|
break;
|
|
|
|
case 44:
|
|
|
|
$function = 'DMAX';
|
|
|
|
$args = 3;
|
|
|
|
break;
|
|
|
|
case 45:
|
|
|
|
$function = 'DSTDEV';
|
|
|
|
$args = 3;
|
|
|
|
break;
|
|
|
|
case 48:
|
|
|
|
$function = 'TEXT';
|
|
|
|
$args = 2;
|
|
|
|
break;
|
|
|
|
case 61:
|
|
|
|
$function = 'MIRR';
|
|
|
|
$args = 3;
|
|
|
|
break;
|
|
|
|
case 63:
|
|
|
|
$function = 'RAND';
|
|
|
|
$args = 0;
|
|
|
|
break;
|
|
|
|
case 65:
|
|
|
|
$function = 'DATE';
|
|
|
|
$args = 3;
|
|
|
|
break;
|
|
|
|
case 66:
|
|
|
|
$function = 'TIME';
|
|
|
|
$args = 3;
|
|
|
|
break;
|
|
|
|
case 67:
|
|
|
|
$function = 'DAY';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 68:
|
|
|
|
$function = 'MONTH';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 69:
|
|
|
|
$function = 'YEAR';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 71:
|
|
|
|
$function = 'HOUR';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 72:
|
|
|
|
$function = 'MINUTE';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 73:
|
|
|
|
$function = 'SECOND';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 74:
|
|
|
|
$function = 'NOW';
|
|
|
|
$args = 0;
|
|
|
|
break;
|
|
|
|
case 75:
|
|
|
|
$function = 'AREAS';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 76:
|
|
|
|
$function = 'ROWS';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 77:
|
|
|
|
$function = 'COLUMNS';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 83:
|
|
|
|
$function = 'TRANSPOSE';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 86:
|
|
|
|
$function = 'TYPE';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 97:
|
|
|
|
$function = 'ATAN2';
|
|
|
|
$args = 2;
|
|
|
|
break;
|
|
|
|
case 98:
|
|
|
|
$function = 'ASIN';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 99:
|
|
|
|
$function = 'ACOS';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 105:
|
|
|
|
$function = 'ISREF';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 111:
|
|
|
|
$function = 'CHAR';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 112:
|
|
|
|
$function = 'LOWER';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 113:
|
|
|
|
$function = 'UPPER';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 114:
|
|
|
|
$function = 'PROPER';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 117:
|
|
|
|
$function = 'EXACT';
|
|
|
|
$args = 2;
|
|
|
|
break;
|
|
|
|
case 118:
|
|
|
|
$function = 'TRIM';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 119:
|
|
|
|
$function = 'REPLACE';
|
|
|
|
$args = 4;
|
|
|
|
break;
|
|
|
|
case 121:
|
|
|
|
$function = 'CODE';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 126:
|
|
|
|
$function = 'ISERR';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 127:
|
|
|
|
$function = 'ISTEXT';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 128:
|
|
|
|
$function = 'ISNUMBER';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 129:
|
|
|
|
$function = 'ISBLANK';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 130:
|
|
|
|
$function = 'T';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 131:
|
|
|
|
$function = 'N';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 140:
|
|
|
|
$function = 'DATEVALUE';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 141:
|
|
|
|
$function = 'TIMEVALUE';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 142:
|
|
|
|
$function = 'SLN';
|
|
|
|
$args = 3;
|
|
|
|
break;
|
|
|
|
case 143:
|
|
|
|
$function = 'SYD';
|
|
|
|
$args = 4;
|
|
|
|
break;
|
|
|
|
case 162:
|
|
|
|
$function = 'CLEAN';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 163:
|
|
|
|
$function = 'MDETERM';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 164:
|
|
|
|
$function = 'MINVERSE';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 165:
|
|
|
|
$function = 'MMULT';
|
|
|
|
$args = 2;
|
|
|
|
break;
|
|
|
|
case 184:
|
|
|
|
$function = 'FACT';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 189:
|
|
|
|
$function = 'DPRODUCT';
|
|
|
|
$args = 3;
|
|
|
|
break;
|
|
|
|
case 190:
|
|
|
|
$function = 'ISNONTEXT';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 195:
|
|
|
|
$function = 'DSTDEVP';
|
|
|
|
$args = 3;
|
|
|
|
break;
|
|
|
|
case 196:
|
|
|
|
$function = 'DVARP';
|
|
|
|
$args = 3;
|
|
|
|
break;
|
|
|
|
case 198:
|
|
|
|
$function = 'ISLOGICAL';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 199:
|
|
|
|
$function = 'DCOUNTA';
|
|
|
|
$args = 3;
|
|
|
|
break;
|
|
|
|
case 207:
|
|
|
|
$function = 'REPLACEB';
|
|
|
|
$args = 4;
|
|
|
|
break;
|
|
|
|
case 210:
|
|
|
|
$function = 'MIDB';
|
|
|
|
$args = 3;
|
|
|
|
break;
|
|
|
|
case 211:
|
|
|
|
$function = 'LENB';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 212:
|
|
|
|
$function = 'ROUNDUP';
|
|
|
|
$args = 2;
|
|
|
|
break;
|
|
|
|
case 213:
|
|
|
|
$function = 'ROUNDDOWN';
|
|
|
|
$args = 2;
|
|
|
|
break;
|
|
|
|
case 214:
|
|
|
|
$function = 'ASC';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 215:
|
|
|
|
$function = 'DBCS';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 221:
|
|
|
|
$function = 'TODAY';
|
|
|
|
$args = 0;
|
|
|
|
break;
|
|
|
|
case 229:
|
|
|
|
$function = 'SINH';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 230:
|
|
|
|
$function = 'COSH';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 231:
|
|
|
|
$function = 'TANH';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 232:
|
|
|
|
$function = 'ASINH';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 233:
|
|
|
|
$function = 'ACOSH';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 234:
|
|
|
|
$function = 'ATANH';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 235:
|
|
|
|
$function = 'DGET';
|
|
|
|
$args = 3;
|
|
|
|
break;
|
|
|
|
case 244:
|
|
|
|
$function = 'INFO';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 252:
|
|
|
|
$function = 'FREQUENCY';
|
|
|
|
$args = 2;
|
|
|
|
break;
|
|
|
|
case 261:
|
|
|
|
$function = 'ERROR.TYPE';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 271:
|
|
|
|
$function = 'GAMMALN';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 273:
|
|
|
|
$function = 'BINOMDIST';
|
|
|
|
$args = 4;
|
|
|
|
break;
|
|
|
|
case 274:
|
|
|
|
$function = 'CHIDIST';
|
|
|
|
$args = 2;
|
|
|
|
break;
|
|
|
|
case 275:
|
|
|
|
$function = 'CHIINV';
|
|
|
|
$args = 2;
|
|
|
|
break;
|
|
|
|
case 276:
|
|
|
|
$function = 'COMBIN';
|
|
|
|
$args = 2;
|
|
|
|
break;
|
|
|
|
case 277:
|
|
|
|
$function = 'CONFIDENCE';
|
|
|
|
$args = 3;
|
|
|
|
break;
|
|
|
|
case 278:
|
|
|
|
$function = 'CRITBINOM';
|
|
|
|
$args = 3;
|
|
|
|
break;
|
|
|
|
case 279:
|
|
|
|
$function = 'EVEN';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 280:
|
|
|
|
$function = 'EXPONDIST';
|
|
|
|
$args = 3;
|
|
|
|
break;
|
|
|
|
case 281:
|
|
|
|
$function = 'FDIST';
|
|
|
|
$args = 3;
|
|
|
|
break;
|
|
|
|
case 282:
|
|
|
|
$function = 'FINV';
|
|
|
|
$args = 3;
|
|
|
|
break;
|
|
|
|
case 283:
|
|
|
|
$function = 'FISHER';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 284:
|
|
|
|
$function = 'FISHERINV';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 285:
|
|
|
|
$function = 'FLOOR';
|
|
|
|
$args = 2;
|
|
|
|
break;
|
|
|
|
case 286:
|
|
|
|
$function = 'GAMMADIST';
|
|
|
|
$args = 4;
|
|
|
|
break;
|
|
|
|
case 287:
|
|
|
|
$function = 'GAMMAINV';
|
|
|
|
$args = 3;
|
|
|
|
break;
|
|
|
|
case 288:
|
|
|
|
$function = 'CEILING';
|
|
|
|
$args = 2;
|
|
|
|
break;
|
|
|
|
case 289:
|
|
|
|
$function = 'HYPGEOMDIST';
|
|
|
|
$args = 4;
|
|
|
|
break;
|
|
|
|
case 290:
|
|
|
|
$function = 'LOGNORMDIST';
|
|
|
|
$args = 3;
|
|
|
|
break;
|
|
|
|
case 291:
|
|
|
|
$function = 'LOGINV';
|
|
|
|
$args = 3;
|
|
|
|
break;
|
|
|
|
case 292:
|
|
|
|
$function = 'NEGBINOMDIST';
|
|
|
|
$args = 3;
|
|
|
|
break;
|
|
|
|
case 293:
|
|
|
|
$function = 'NORMDIST';
|
|
|
|
$args = 4;
|
|
|
|
break;
|
|
|
|
case 294:
|
|
|
|
$function = 'NORMSDIST';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 295:
|
|
|
|
$function = 'NORMINV';
|
|
|
|
$args = 3;
|
|
|
|
break;
|
|
|
|
case 296:
|
|
|
|
$function = 'NORMSINV';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 297:
|
|
|
|
$function = 'STANDARDIZE';
|
|
|
|
$args = 3;
|
|
|
|
break;
|
|
|
|
case 298:
|
|
|
|
$function = 'ODD';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 299:
|
|
|
|
$function = 'PERMUT';
|
|
|
|
$args = 2;
|
|
|
|
break;
|
|
|
|
case 300:
|
|
|
|
$function = 'POISSON';
|
|
|
|
$args = 3;
|
|
|
|
break;
|
|
|
|
case 301:
|
|
|
|
$function = 'TDIST';
|
|
|
|
$args = 3;
|
|
|
|
break;
|
|
|
|
case 302:
|
|
|
|
$function = 'WEIBULL';
|
|
|
|
$args = 4;
|
|
|
|
break;
|
|
|
|
case 303:
|
|
|
|
$function = 'SUMXMY2';
|
|
|
|
$args = 2;
|
|
|
|
break;
|
|
|
|
case 304:
|
|
|
|
$function = 'SUMX2MY2';
|
|
|
|
$args = 2;
|
|
|
|
break;
|
|
|
|
case 305:
|
|
|
|
$function = 'SUMX2PY2';
|
|
|
|
$args = 2;
|
|
|
|
break;
|
|
|
|
case 306:
|
|
|
|
$function = 'CHITEST';
|
|
|
|
$args = 2;
|
|
|
|
break;
|
|
|
|
case 307:
|
|
|
|
$function = 'CORREL';
|
|
|
|
$args = 2;
|
|
|
|
break;
|
|
|
|
case 308:
|
|
|
|
$function = 'COVAR';
|
|
|
|
$args = 2;
|
|
|
|
break;
|
|
|
|
case 309:
|
|
|
|
$function = 'FORECAST';
|
|
|
|
$args = 3;
|
|
|
|
break;
|
|
|
|
case 310:
|
|
|
|
$function = 'FTEST';
|
|
|
|
$args = 2;
|
|
|
|
break;
|
|
|
|
case 311:
|
|
|
|
$function = 'INTERCEPT';
|
|
|
|
$args = 2;
|
|
|
|
break;
|
|
|
|
case 312:
|
|
|
|
$function = 'PEARSON';
|
|
|
|
$args = 2;
|
|
|
|
break;
|
|
|
|
case 313:
|
|
|
|
$function = 'RSQ';
|
|
|
|
$args = 2;
|
|
|
|
break;
|
|
|
|
case 314:
|
|
|
|
$function = 'STEYX';
|
|
|
|
$args = 2;
|
|
|
|
break;
|
|
|
|
case 315:
|
|
|
|
$function = 'SLOPE';
|
|
|
|
$args = 2;
|
|
|
|
break;
|
|
|
|
case 316:
|
|
|
|
$function = 'TTEST';
|
|
|
|
$args = 4;
|
|
|
|
break;
|
|
|
|
case 325:
|
|
|
|
$function = 'LARGE';
|
|
|
|
$args = 2;
|
|
|
|
break;
|
|
|
|
case 326:
|
|
|
|
$function = 'SMALL';
|
|
|
|
$args = 2;
|
|
|
|
break;
|
|
|
|
case 327:
|
|
|
|
$function = 'QUARTILE';
|
|
|
|
$args = 2;
|
|
|
|
break;
|
|
|
|
case 328:
|
|
|
|
$function = 'PERCENTILE';
|
|
|
|
$args = 2;
|
|
|
|
break;
|
|
|
|
case 331:
|
|
|
|
$function = 'TRIMMEAN';
|
|
|
|
$args = 2;
|
|
|
|
break;
|
|
|
|
case 332:
|
|
|
|
$function = 'TINV';
|
|
|
|
$args = 2;
|
|
|
|
break;
|
|
|
|
case 337:
|
|
|
|
$function = 'POWER';
|
|
|
|
$args = 2;
|
|
|
|
break;
|
|
|
|
case 342:
|
|
|
|
$function = 'RADIANS';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 343:
|
|
|
|
$function = 'DEGREES';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 346:
|
|
|
|
$function = 'COUNTIF';
|
|
|
|
$args = 2;
|
|
|
|
break;
|
|
|
|
case 347:
|
|
|
|
$function = 'COUNTBLANK';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 350:
|
|
|
|
$function = 'ISPMT';
|
|
|
|
$args = 4;
|
|
|
|
break;
|
|
|
|
case 351:
|
|
|
|
$function = 'DATEDIF';
|
|
|
|
$args = 3;
|
|
|
|
break;
|
|
|
|
case 352:
|
|
|
|
$function = 'DATESTRING';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 353:
|
|
|
|
$function = 'NUMBERSTRING';
|
|
|
|
$args = 2;
|
|
|
|
break;
|
|
|
|
case 360:
|
|
|
|
$function = 'PHONETIC';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
case 368:
|
|
|
|
$function = 'BAHTTEXT';
|
|
|
|
$args = 1;
|
|
|
|
break;
|
|
|
|
default:
|
|
|
|
throw new PHPExcel_Reader_Exception('Unrecognized function in formula');
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
$data = array('function' => $function, 'args' => $args);
|
|
|
|
break;
|
|
|
|
case 0x22: // function with variable number of arguments
|
|
|
|
case 0x42:
|
|
|
|
case 0x62:
|
|
|
|
$name = 'tFuncV';
|
|
|
|
$size = 4;
|
|
|
|
// offset: 1; size: 1; number of arguments
|
|
|
|
$args = ord($formulaData[1]);
|
|
|
|
// offset: 2: size: 2; index to built-in sheet function
|
2015-05-20 18:17:17 +00:00
|
|
|
$index = self::getInt2d($formulaData, 2);
|
2015-05-17 16:10:35 +00:00
|
|
|
switch ($index) {
|
|
|
|
case 0:
|
|
|
|
$function = 'COUNT';
|
|
|
|
break;
|
|
|
|
case 1:
|
|
|
|
$function = 'IF';
|
|
|
|
break;
|
|
|
|
case 4:
|
|
|
|
$function = 'SUM';
|
|
|
|
break;
|
|
|
|
case 5:
|
|
|
|
$function = 'AVERAGE';
|
|
|
|
break;
|
|
|
|
case 6:
|
|
|
|
$function = 'MIN';
|
|
|
|
break;
|
|
|
|
case 7:
|
|
|
|
$function = 'MAX';
|
|
|
|
break;
|
|
|
|
case 8:
|
|
|
|
$function = 'ROW';
|
|
|
|
break;
|
|
|
|
case 9:
|
|
|
|
$function = 'COLUMN';
|
|
|
|
break;
|
|
|
|
case 11:
|
|
|
|
$function = 'NPV';
|
|
|
|
break;
|
|
|
|
case 12:
|
|
|
|
$function = 'STDEV';
|
|
|
|
break;
|
|
|
|
case 13:
|
|
|
|
$function = 'DOLLAR';
|
|
|
|
break;
|
|
|
|
case 14:
|
|
|
|
$function = 'FIXED';
|
|
|
|
break;
|
|
|
|
case 28:
|
|
|
|
$function = 'LOOKUP';
|
|
|
|
break;
|
|
|
|
case 29:
|
|
|
|
$function = 'INDEX';
|
|
|
|
break;
|
|
|
|
case 36:
|
|
|
|
$function = 'AND';
|
|
|
|
break;
|
|
|
|
case 37:
|
|
|
|
$function = 'OR';
|
|
|
|
break;
|
|
|
|
case 46:
|
|
|
|
$function = 'VAR';
|
|
|
|
break;
|
|
|
|
case 49:
|
|
|
|
$function = 'LINEST';
|
|
|
|
break;
|
|
|
|
case 50:
|
|
|
|
$function = 'TREND';
|
|
|
|
break;
|
|
|
|
case 51:
|
|
|
|
$function = 'LOGEST';
|
|
|
|
break;
|
|
|
|
case 52:
|
|
|
|
$function = 'GROWTH';
|
|
|
|
break;
|
|
|
|
case 56:
|
|
|
|
$function = 'PV';
|
|
|
|
break;
|
|
|
|
case 57:
|
|
|
|
$function = 'FV';
|
|
|
|
break;
|
|
|
|
case 58:
|
|
|
|
$function = 'NPER';
|
|
|
|
break;
|
|
|
|
case 59:
|
|
|
|
$function = 'PMT';
|
|
|
|
break;
|
|
|
|
case 60:
|
|
|
|
$function = 'RATE';
|
|
|
|
break;
|
|
|
|
case 62:
|
|
|
|
$function = 'IRR';
|
|
|
|
break;
|
|
|
|
case 64:
|
|
|
|
$function = 'MATCH';
|
|
|
|
break;
|
|
|
|
case 70:
|
|
|
|
$function = 'WEEKDAY';
|
|
|
|
break;
|
|
|
|
case 78:
|
|
|
|
$function = 'OFFSET';
|
|
|
|
break;
|
|
|
|
case 82:
|
|
|
|
$function = 'SEARCH';
|
|
|
|
break;
|
|
|
|
case 100:
|
|
|
|
$function = 'CHOOSE';
|
|
|
|
break;
|
|
|
|
case 101:
|
|
|
|
$function = 'HLOOKUP';
|
|
|
|
break;
|
|
|
|
case 102:
|
|
|
|
$function = 'VLOOKUP';
|
|
|
|
break;
|
|
|
|
case 109:
|
|
|
|
$function = 'LOG';
|
|
|
|
break;
|
|
|
|
case 115:
|
|
|
|
$function = 'LEFT';
|
|
|
|
break;
|
|
|
|
case 116:
|
|
|
|
$function = 'RIGHT';
|
|
|
|
break;
|
|
|
|
case 120:
|
|
|
|
$function = 'SUBSTITUTE';
|
|
|
|
break;
|
|
|
|
case 124:
|
|
|
|
$function = 'FIND';
|
|
|
|
break;
|
|
|
|
case 125:
|
|
|
|
$function = 'CELL';
|
|
|
|
break;
|
|
|
|
case 144:
|
|
|
|
$function = 'DDB';
|
|
|
|
break;
|
|
|
|
case 148:
|
|
|
|
$function = 'INDIRECT';
|
|
|
|
break;
|
|
|
|
case 167:
|
|
|
|
$function = 'IPMT';
|
|
|
|
break;
|
|
|
|
case 168:
|
|
|
|
$function = 'PPMT';
|
|
|
|
break;
|
|
|
|
case 169:
|
|
|
|
$function = 'COUNTA';
|
|
|
|
break;
|
|
|
|
case 183:
|
|
|
|
$function = 'PRODUCT';
|
|
|
|
break;
|
|
|
|
case 193:
|
|
|
|
$function = 'STDEVP';
|
|
|
|
break;
|
|
|
|
case 194:
|
|
|
|
$function = 'VARP';
|
|
|
|
break;
|
|
|
|
case 197:
|
|
|
|
$function = 'TRUNC';
|
|
|
|
break;
|
|
|
|
case 204:
|
|
|
|
$function = 'USDOLLAR';
|
|
|
|
break;
|
|
|
|
case 205:
|
|
|
|
$function = 'FINDB';
|
|
|
|
break;
|
|
|
|
case 206:
|
|
|
|
$function = 'SEARCHB';
|
|
|
|
break;
|
|
|
|
case 208:
|
|
|
|
$function = 'LEFTB';
|
|
|
|
break;
|
|
|
|
case 209:
|
|
|
|
$function = 'RIGHTB';
|
|
|
|
break;
|
|
|
|
case 216:
|
|
|
|
$function = 'RANK';
|
|
|
|
break;
|
|
|
|
case 219:
|
|
|
|
$function = 'ADDRESS';
|
|
|
|
break;
|
|
|
|
case 220:
|
|
|
|
$function = 'DAYS360';
|
|
|
|
break;
|
|
|
|
case 222:
|
|
|
|
$function = 'VDB';
|
|
|
|
break;
|
|
|
|
case 227:
|
|
|
|
$function = 'MEDIAN';
|
|
|
|
break;
|
|
|
|
case 228:
|
|
|
|
$function = 'SUMPRODUCT';
|
|
|
|
break;
|
|
|
|
case 247:
|
|
|
|
$function = 'DB';
|
|
|
|
break;
|
|
|
|
case 255:
|
|
|
|
$function = '';
|
|
|
|
break;
|
|
|
|
case 269:
|
|
|
|
$function = 'AVEDEV';
|
|
|
|
break;
|
|
|
|
case 270:
|
|
|
|
$function = 'BETADIST';
|
|
|
|
break;
|
|
|
|
case 272:
|
|
|
|
$function = 'BETAINV';
|
|
|
|
break;
|
|
|
|
case 317:
|
|
|
|
$function = 'PROB';
|
|
|
|
break;
|
|
|
|
case 318:
|
|
|
|
$function = 'DEVSQ';
|
|
|
|
break;
|
|
|
|
case 319:
|
|
|
|
$function = 'GEOMEAN';
|
|
|
|
break;
|
|
|
|
case 320:
|
|
|
|
$function = 'HARMEAN';
|
|
|
|
break;
|
|
|
|
case 321:
|
|
|
|
$function = 'SUMSQ';
|
|
|
|
break;
|
|
|
|
case 322:
|
|
|
|
$function = 'KURT';
|
|
|
|
break;
|
|
|
|
case 323:
|
|
|
|
$function = 'SKEW';
|
|
|
|
break;
|
|
|
|
case 324:
|
|
|
|
$function = 'ZTEST';
|
|
|
|
break;
|
|
|
|
case 329:
|
|
|
|
$function = 'PERCENTRANK';
|
|
|
|
break;
|
|
|
|
case 330:
|
|
|
|
$function = 'MODE';
|
|
|
|
break;
|
|
|
|
case 336:
|
|
|
|
$function = 'CONCATENATE';
|
|
|
|
break;
|
|
|
|
case 344:
|
|
|
|
$function = 'SUBTOTAL';
|
|
|
|
break;
|
|
|
|
case 345:
|
|
|
|
$function = 'SUMIF';
|
|
|
|
break;
|
|
|
|
case 354:
|
|
|
|
$function = 'ROMAN';
|
|
|
|
break;
|
|
|
|
case 358:
|
|
|
|
$function = 'GETPIVOTDATA';
|
|
|
|
break;
|
|
|
|
case 359:
|
|
|
|
$function = 'HYPERLINK';
|
|
|
|
break;
|
|
|
|
case 361:
|
|
|
|
$function = 'AVERAGEA';
|
|
|
|
break;
|
|
|
|
case 362:
|
|
|
|
$function = 'MAXA';
|
|
|
|
break;
|
|
|
|
case 363:
|
|
|
|
$function = 'MINA';
|
|
|
|
break;
|
|
|
|
case 364:
|
|
|
|
$function = 'STDEVPA';
|
|
|
|
break;
|
|
|
|
case 365:
|
|
|
|
$function = 'VARPA';
|
|
|
|
break;
|
|
|
|
case 366:
|
|
|
|
$function = 'STDEVA';
|
|
|
|
break;
|
|
|
|
case 367:
|
|
|
|
$function = 'VARA';
|
|
|
|
break;
|
|
|
|
default:
|
|
|
|
throw new PHPExcel_Reader_Exception('Unrecognized function in formula');
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
$data = array('function' => $function, 'args' => $args);
|
|
|
|
break;
|
|
|
|
case 0x23: // index to defined name
|
|
|
|
case 0x43:
|
|
|
|
case 0x63:
|
|
|
|
$name = 'tName';
|
|
|
|
$size = 5;
|
|
|
|
// offset: 1; size: 2; one-based index to definedname record
|
2015-05-20 18:17:17 +00:00
|
|
|
$definedNameIndex = self::getInt2d($formulaData, 1) - 1;
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 2; size: 2; not used
|
2015-05-20 18:17:17 +00:00
|
|
|
$data = $this->definedname[$definedNameIndex]['name'];
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case 0x24: // single cell reference e.g. A5
|
|
|
|
case 0x44:
|
|
|
|
case 0x64:
|
|
|
|
$name = 'tRef';
|
|
|
|
$size = 5;
|
2015-05-20 18:17:17 +00:00
|
|
|
$data = $this->readBIFF8CellAddress(substr($formulaData, 1, 4));
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case 0x25: // cell range reference to cells in the same sheet (2d)
|
|
|
|
case 0x45:
|
|
|
|
case 0x65:
|
|
|
|
$name = 'tArea';
|
|
|
|
$size = 9;
|
2015-05-20 18:17:17 +00:00
|
|
|
$data = $this->readBIFF8CellRangeAddress(substr($formulaData, 1, 8));
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case 0x26: // Constant reference sub-expression
|
|
|
|
case 0x46:
|
|
|
|
case 0x66:
|
|
|
|
$name = 'tMemArea';
|
|
|
|
// offset: 1; size: 4; not used
|
|
|
|
// offset: 5; size: 2; size of the following subexpression
|
2015-05-20 18:17:17 +00:00
|
|
|
$subSize = self::getInt2d($formulaData, 5);
|
2015-05-17 16:10:35 +00:00
|
|
|
$size = 7 + $subSize;
|
2015-05-20 18:17:17 +00:00
|
|
|
$data = $this->getFormulaFromData(substr($formulaData, 7, $subSize));
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case 0x27: // Deleted constant reference sub-expression
|
|
|
|
case 0x47:
|
|
|
|
case 0x67:
|
|
|
|
$name = 'tMemErr';
|
|
|
|
// offset: 1; size: 4; not used
|
|
|
|
// offset: 5; size: 2; size of the following subexpression
|
2015-05-20 18:17:17 +00:00
|
|
|
$subSize = self::getInt2d($formulaData, 5);
|
2015-05-17 16:10:35 +00:00
|
|
|
$size = 7 + $subSize;
|
2015-05-20 18:17:17 +00:00
|
|
|
$data = $this->getFormulaFromData(substr($formulaData, 7, $subSize));
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case 0x29: // Variable reference sub-expression
|
|
|
|
case 0x49:
|
|
|
|
case 0x69:
|
|
|
|
$name = 'tMemFunc';
|
|
|
|
// offset: 1; size: 2; size of the following sub-expression
|
2015-05-20 18:17:17 +00:00
|
|
|
$subSize = self::getInt2d($formulaData, 1);
|
2015-05-17 16:10:35 +00:00
|
|
|
$size = 3 + $subSize;
|
2015-05-20 18:17:17 +00:00
|
|
|
$data = $this->getFormulaFromData(substr($formulaData, 3, $subSize));
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case 0x2C: // Relative 2d cell reference reference, used in shared formulas and some other places
|
|
|
|
case 0x4C:
|
|
|
|
case 0x6C:
|
|
|
|
$name = 'tRefN';
|
|
|
|
$size = 5;
|
2015-05-20 18:17:17 +00:00
|
|
|
$data = $this->readBIFF8CellAddressB(substr($formulaData, 1, 4), $baseCell);
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case 0x2D: // Relative 2d range reference
|
|
|
|
case 0x4D:
|
|
|
|
case 0x6D:
|
|
|
|
$name = 'tAreaN';
|
|
|
|
$size = 9;
|
2015-05-20 18:17:17 +00:00
|
|
|
$data = $this->readBIFF8CellRangeAddressB(substr($formulaData, 1, 8), $baseCell);
|
2015-05-17 16:10:35 +00:00
|
|
|
break;
|
|
|
|
case 0x39: // External name
|
|
|
|
case 0x59:
|
|
|
|
case 0x79:
|
|
|
|
$name = 'tNameX';
|
|
|
|
$size = 7;
|
|
|
|
// offset: 1; size: 2; index to REF entry in EXTERNSHEET record
|
|
|
|
// offset: 3; size: 2; one-based index to DEFINEDNAME or EXTERNNAME record
|
2015-05-20 18:17:17 +00:00
|
|
|
$index = self::getInt2d($formulaData, 3);
|
2015-05-17 16:10:35 +00:00
|
|
|
// assume index is to EXTERNNAME record
|
2015-05-20 18:17:17 +00:00
|
|
|
$data = $this->externalNames[$index - 1]['name'];
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 5; size: 2; not used
|
|
|
|
break;
|
|
|
|
case 0x3A: // 3d reference to cell
|
|
|
|
case 0x5A:
|
|
|
|
case 0x7A:
|
|
|
|
$name = 'tRef3d';
|
|
|
|
$size = 7;
|
|
|
|
|
|
|
|
try {
|
|
|
|
// offset: 1; size: 2; index to REF entry
|
2015-05-20 18:17:17 +00:00
|
|
|
$sheetRange = $this->readSheetRangeByRefIndex(self::getInt2d($formulaData, 1));
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 3; size: 4; cell address
|
2015-05-20 18:17:17 +00:00
|
|
|
$cellAddress = $this->readBIFF8CellAddress(substr($formulaData, 3, 4));
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
$data = "$sheetRange!$cellAddress";
|
|
|
|
} catch (PHPExcel_Exception $e) {
|
|
|
|
// deleted sheet reference
|
|
|
|
$data = '#REF!';
|
|
|
|
}
|
|
|
|
break;
|
|
|
|
case 0x3B: // 3d reference to cell range
|
|
|
|
case 0x5B:
|
|
|
|
case 0x7B:
|
|
|
|
$name = 'tArea3d';
|
|
|
|
$size = 11;
|
|
|
|
|
|
|
|
try {
|
|
|
|
// offset: 1; size: 2; index to REF entry
|
2015-05-20 18:17:17 +00:00
|
|
|
$sheetRange = $this->readSheetRangeByRefIndex(self::getInt2d($formulaData, 1));
|
2015-05-17 16:10:35 +00:00
|
|
|
// offset: 3; size: 8; cell address
|
2015-05-20 18:17:17 +00:00
|
|
|
$cellRangeAddress = $this->readBIFF8CellRangeAddress(substr($formulaData, 3, 8));
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
$data = "$sheetRange!$cellRangeAddress";
|
|
|
|
} catch (PHPExcel_Exception $e) {
|
|
|
|
// deleted sheet reference
|
|
|
|
$data = '#REF!';
|
|
|
|
}
|
|
|
|
break;
|
|
|
|
// Unknown cases // don't know how to deal with
|
|
|
|
default:
|
|
|
|
throw new PHPExcel_Reader_Exception('Unrecognized token ' . sprintf('%02X', $id) . ' in formula');
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
|
|
|
|
return array(
|
|
|
|
'id' => $id,
|
|
|
|
'name' => $name,
|
|
|
|
'size' => $size,
|
|
|
|
'data' => $data,
|
|
|
|
);
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Reads a cell address in BIFF8 e.g. 'A2' or '$A$2'
|
|
|
|
* section 3.3.4
|
|
|
|
*
|
|
|
|
* @param string $cellAddressStructure
|
|
|
|
* @return string
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readBIFF8CellAddress($cellAddressStructure)
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
// offset: 0; size: 2; index to row (0... 65535) (or offset (-32768... 32767))
|
2015-05-20 18:17:17 +00:00
|
|
|
$row = self::getInt2d($cellAddressStructure, 0) + 1;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 2; size: 2; index to column or column offset + relative flags
|
|
|
|
// bit: 7-0; mask 0x00FF; column index
|
2015-05-20 18:17:17 +00:00
|
|
|
$column = PHPExcel_Cell::stringFromColumnIndex(0x00FF & self::getInt2d($cellAddressStructure, 2));
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 14; mask 0x4000; (1 = relative column index, 0 = absolute column index)
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!(0x4000 & self::getInt2d($cellAddressStructure, 2))) {
|
2015-05-17 16:10:35 +00:00
|
|
|
$column = '$' . $column;
|
|
|
|
}
|
|
|
|
// bit: 15; mask 0x8000; (1 = relative row index, 0 = absolute row index)
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!(0x8000 & self::getInt2d($cellAddressStructure, 2))) {
|
2015-05-17 16:10:35 +00:00
|
|
|
$row = '$' . $row;
|
|
|
|
}
|
|
|
|
|
|
|
|
return $column . $row;
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Reads a cell address in BIFF8 for shared formulas. Uses positive and negative values for row and column
|
|
|
|
* to indicate offsets from a base cell
|
|
|
|
* section 3.3.4
|
|
|
|
*
|
|
|
|
* @param string $cellAddressStructure
|
|
|
|
* @param string $baseCell Base cell, only needed when formula contains tRefN tokens, e.g. with shared formulas
|
|
|
|
* @return string
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readBIFF8CellAddressB($cellAddressStructure, $baseCell = 'A1')
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
list($baseCol, $baseRow) = PHPExcel_Cell::coordinateFromString($baseCell);
|
|
|
|
$baseCol = PHPExcel_Cell::columnIndexFromString($baseCol) - 1;
|
|
|
|
|
|
|
|
// offset: 0; size: 2; index to row (0... 65535) (or offset (-32768... 32767))
|
2015-05-20 18:17:17 +00:00
|
|
|
$rowIndex = self::getInt2d($cellAddressStructure, 0);
|
|
|
|
$row = self::getInt2d($cellAddressStructure, 0) + 1;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 2; size: 2; index to column or column offset + relative flags
|
|
|
|
// bit: 7-0; mask 0x00FF; column index
|
2015-05-20 18:17:17 +00:00
|
|
|
$colIndex = 0x00FF & self::getInt2d($cellAddressStructure, 2);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 14; mask 0x4000; (1 = relative column index, 0 = absolute column index)
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!(0x4000 & self::getInt2d($cellAddressStructure, 2))) {
|
2015-05-17 16:10:35 +00:00
|
|
|
$column = PHPExcel_Cell::stringFromColumnIndex($colIndex);
|
|
|
|
$column = '$' . $column;
|
|
|
|
} else {
|
|
|
|
$colIndex = ($colIndex <= 127) ? $colIndex : $colIndex - 256;
|
|
|
|
$column = PHPExcel_Cell::stringFromColumnIndex($baseCol + $colIndex);
|
|
|
|
}
|
|
|
|
|
|
|
|
// bit: 15; mask 0x8000; (1 = relative row index, 0 = absolute row index)
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!(0x8000 & self::getInt2d($cellAddressStructure, 2))) {
|
2015-05-17 16:10:35 +00:00
|
|
|
$row = '$' . $row;
|
|
|
|
} else {
|
|
|
|
$rowIndex = ($rowIndex <= 32767) ? $rowIndex : $rowIndex - 65536;
|
|
|
|
$row = $baseRow + $rowIndex;
|
|
|
|
}
|
|
|
|
|
|
|
|
return $column . $row;
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Reads a cell range address in BIFF5 e.g. 'A2:B6' or 'A1'
|
|
|
|
* always fixed range
|
|
|
|
* section 2.5.14
|
|
|
|
*
|
|
|
|
* @param string $subData
|
|
|
|
* @return string
|
|
|
|
* @throws PHPExcel_Reader_Exception
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readBIFF5CellRangeAddressFixed($subData)
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
// offset: 0; size: 2; index to first row
|
2015-05-20 18:17:17 +00:00
|
|
|
$fr = self::getInt2d($subData, 0) + 1;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 2; size: 2; index to last row
|
2015-05-20 18:17:17 +00:00
|
|
|
$lr = self::getInt2d($subData, 2) + 1;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 4; size: 1; index to first column
|
|
|
|
$fc = ord($subData{4});
|
|
|
|
|
|
|
|
// offset: 5; size: 1; index to last column
|
|
|
|
$lc = ord($subData{5});
|
|
|
|
|
|
|
|
// check values
|
|
|
|
if ($fr > $lr || $fc > $lc) {
|
|
|
|
throw new PHPExcel_Reader_Exception('Not a cell range address');
|
|
|
|
}
|
|
|
|
|
|
|
|
// column index to letter
|
|
|
|
$fc = PHPExcel_Cell::stringFromColumnIndex($fc);
|
|
|
|
$lc = PHPExcel_Cell::stringFromColumnIndex($lc);
|
|
|
|
|
|
|
|
if ($fr == $lr and $fc == $lc) {
|
|
|
|
return "$fc$fr";
|
|
|
|
}
|
|
|
|
return "$fc$fr:$lc$lr";
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Reads a cell range address in BIFF8 e.g. 'A2:B6' or 'A1'
|
|
|
|
* always fixed range
|
|
|
|
* section 2.5.14
|
|
|
|
*
|
|
|
|
* @param string $subData
|
|
|
|
* @return string
|
|
|
|
* @throws PHPExcel_Reader_Exception
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readBIFF8CellRangeAddressFixed($subData)
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
// offset: 0; size: 2; index to first row
|
2015-05-20 18:17:17 +00:00
|
|
|
$fr = self::getInt2d($subData, 0) + 1;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 2; size: 2; index to last row
|
2015-05-20 18:17:17 +00:00
|
|
|
$lr = self::getInt2d($subData, 2) + 1;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 4; size: 2; index to first column
|
2015-05-20 18:17:17 +00:00
|
|
|
$fc = self::getInt2d($subData, 4);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 6; size: 2; index to last column
|
2015-05-20 18:17:17 +00:00
|
|
|
$lc = self::getInt2d($subData, 6);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// check values
|
|
|
|
if ($fr > $lr || $fc > $lc) {
|
|
|
|
throw new PHPExcel_Reader_Exception('Not a cell range address');
|
|
|
|
}
|
|
|
|
|
|
|
|
// column index to letter
|
|
|
|
$fc = PHPExcel_Cell::stringFromColumnIndex($fc);
|
|
|
|
$lc = PHPExcel_Cell::stringFromColumnIndex($lc);
|
|
|
|
|
|
|
|
if ($fr == $lr and $fc == $lc) {
|
|
|
|
return "$fc$fr";
|
|
|
|
}
|
|
|
|
return "$fc$fr:$lc$lr";
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Reads a cell range address in BIFF8 e.g. 'A2:B6' or '$A$2:$B$6'
|
|
|
|
* there are flags indicating whether column/row index is relative
|
|
|
|
* section 3.3.4
|
|
|
|
*
|
|
|
|
* @param string $subData
|
|
|
|
* @return string
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readBIFF8CellRangeAddress($subData)
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
// todo: if cell range is just a single cell, should this funciton
|
|
|
|
// not just return e.g. 'A1' and not 'A1:A1' ?
|
|
|
|
|
|
|
|
// offset: 0; size: 2; index to first row (0... 65535) (or offset (-32768... 32767))
|
2015-05-20 18:17:17 +00:00
|
|
|
$fr = self::getInt2d($subData, 0) + 1;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 2; size: 2; index to last row (0... 65535) (or offset (-32768... 32767))
|
2015-05-20 18:17:17 +00:00
|
|
|
$lr = self::getInt2d($subData, 2) + 1;
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 4; size: 2; index to first column or column offset + relative flags
|
|
|
|
|
|
|
|
// bit: 7-0; mask 0x00FF; column index
|
2015-05-20 18:17:17 +00:00
|
|
|
$fc = PHPExcel_Cell::stringFromColumnIndex(0x00FF & self::getInt2d($subData, 4));
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 14; mask 0x4000; (1 = relative column index, 0 = absolute column index)
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!(0x4000 & self::getInt2d($subData, 4))) {
|
2015-05-17 16:10:35 +00:00
|
|
|
$fc = '$' . $fc;
|
|
|
|
}
|
|
|
|
|
|
|
|
// bit: 15; mask 0x8000; (1 = relative row index, 0 = absolute row index)
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!(0x8000 & self::getInt2d($subData, 4))) {
|
2015-05-17 16:10:35 +00:00
|
|
|
$fr = '$' . $fr;
|
|
|
|
}
|
|
|
|
|
|
|
|
// offset: 6; size: 2; index to last column or column offset + relative flags
|
|
|
|
|
|
|
|
// bit: 7-0; mask 0x00FF; column index
|
2015-05-20 18:17:17 +00:00
|
|
|
$lc = PHPExcel_Cell::stringFromColumnIndex(0x00FF & self::getInt2d($subData, 6));
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 14; mask 0x4000; (1 = relative column index, 0 = absolute column index)
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!(0x4000 & self::getInt2d($subData, 6))) {
|
2015-05-17 16:10:35 +00:00
|
|
|
$lc = '$' . $lc;
|
|
|
|
}
|
|
|
|
|
|
|
|
// bit: 15; mask 0x8000; (1 = relative row index, 0 = absolute row index)
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!(0x8000 & self::getInt2d($subData, 6))) {
|
2015-05-17 16:10:35 +00:00
|
|
|
$lr = '$' . $lr;
|
|
|
|
}
|
|
|
|
|
|
|
|
return "$fc$fr:$lc$lr";
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Reads a cell range address in BIFF8 for shared formulas. Uses positive and negative values for row and column
|
|
|
|
* to indicate offsets from a base cell
|
|
|
|
* section 3.3.4
|
|
|
|
*
|
|
|
|
* @param string $subData
|
|
|
|
* @param string $baseCell Base cell
|
|
|
|
* @return string Cell range address
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readBIFF8CellRangeAddressB($subData, $baseCell = 'A1')
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
list($baseCol, $baseRow) = PHPExcel_Cell::coordinateFromString($baseCell);
|
|
|
|
$baseCol = PHPExcel_Cell::columnIndexFromString($baseCol) - 1;
|
|
|
|
|
|
|
|
// TODO: if cell range is just a single cell, should this funciton
|
|
|
|
// not just return e.g. 'A1' and not 'A1:A1' ?
|
|
|
|
|
|
|
|
// offset: 0; size: 2; first row
|
2015-05-20 18:17:17 +00:00
|
|
|
$frIndex = self::getInt2d($subData, 0); // adjust below
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 2; size: 2; relative index to first row (0... 65535) should be treated as offset (-32768... 32767)
|
2015-05-20 18:17:17 +00:00
|
|
|
$lrIndex = self::getInt2d($subData, 2); // adjust below
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 4; size: 2; first column with relative/absolute flags
|
|
|
|
|
|
|
|
// bit: 7-0; mask 0x00FF; column index
|
2015-05-20 18:17:17 +00:00
|
|
|
$fcIndex = 0x00FF & self::getInt2d($subData, 4);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// bit: 14; mask 0x4000; (1 = relative column index, 0 = absolute column index)
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!(0x4000 & self::getInt2d($subData, 4))) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// absolute column index
|
|
|
|
$fc = PHPExcel_Cell::stringFromColumnIndex($fcIndex);
|
|
|
|
$fc = '$' . $fc;
|
|
|
|
} else {
|
|
|
|
// column offset
|
|
|
|
$fcIndex = ($fcIndex <= 127) ? $fcIndex : $fcIndex - 256;
|
|
|
|
$fc = PHPExcel_Cell::stringFromColumnIndex($baseCol + $fcIndex);
|
|
|
|
}
|
|
|
|
|
|
|
|
// bit: 15; mask 0x8000; (1 = relative row index, 0 = absolute row index)
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!(0x8000 & self::getInt2d($subData, 4))) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// absolute row index
|
|
|
|
$fr = $frIndex + 1;
|
|
|
|
$fr = '$' . $fr;
|
|
|
|
} else {
|
|
|
|
// row offset
|
|
|
|
$frIndex = ($frIndex <= 32767) ? $frIndex : $frIndex - 65536;
|
|
|
|
$fr = $baseRow + $frIndex;
|
|
|
|
}
|
|
|
|
|
|
|
|
// offset: 6; size: 2; last column with relative/absolute flags
|
|
|
|
|
|
|
|
// bit: 7-0; mask 0x00FF; column index
|
2015-05-20 18:17:17 +00:00
|
|
|
$lcIndex = 0x00FF & self::getInt2d($subData, 6);
|
2015-05-17 16:10:35 +00:00
|
|
|
$lcIndex = ($lcIndex <= 127) ? $lcIndex : $lcIndex - 256;
|
|
|
|
$lc = PHPExcel_Cell::stringFromColumnIndex($baseCol + $lcIndex);
|
|
|
|
|
|
|
|
// bit: 14; mask 0x4000; (1 = relative column index, 0 = absolute column index)
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!(0x4000 & self::getInt2d($subData, 6))) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// absolute column index
|
|
|
|
$lc = PHPExcel_Cell::stringFromColumnIndex($lcIndex);
|
|
|
|
$lc = '$' . $lc;
|
|
|
|
} else {
|
|
|
|
// column offset
|
|
|
|
$lcIndex = ($lcIndex <= 127) ? $lcIndex : $lcIndex - 256;
|
|
|
|
$lc = PHPExcel_Cell::stringFromColumnIndex($baseCol + $lcIndex);
|
|
|
|
}
|
|
|
|
|
|
|
|
// bit: 15; mask 0x8000; (1 = relative row index, 0 = absolute row index)
|
2015-05-20 18:17:17 +00:00
|
|
|
if (!(0x8000 & self::getInt2d($subData, 6))) {
|
2015-05-17 16:10:35 +00:00
|
|
|
// absolute row index
|
|
|
|
$lr = $lrIndex + 1;
|
|
|
|
$lr = '$' . $lr;
|
|
|
|
} else {
|
|
|
|
// row offset
|
|
|
|
$lrIndex = ($lrIndex <= 32767) ? $lrIndex : $lrIndex - 65536;
|
|
|
|
$lr = $baseRow + $lrIndex;
|
|
|
|
}
|
|
|
|
|
|
|
|
return "$fc$fr:$lc$lr";
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read BIFF8 cell range address list
|
|
|
|
* section 2.5.15
|
|
|
|
*
|
|
|
|
* @param string $subData
|
|
|
|
* @return array
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readBIFF8CellRangeAddressList($subData)
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
$cellRangeAddresses = array();
|
|
|
|
|
|
|
|
// offset: 0; size: 2; number of the following cell range addresses
|
2015-05-20 18:17:17 +00:00
|
|
|
$nm = self::getInt2d($subData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
$offset = 2;
|
|
|
|
// offset: 2; size: 8 * $nm; list of $nm (fixed) cell range addresses
|
|
|
|
for ($i = 0; $i < $nm; ++$i) {
|
2015-05-20 18:17:17 +00:00
|
|
|
$cellRangeAddresses[] = $this->readBIFF8CellRangeAddressFixed(substr($subData, $offset, 8));
|
2015-05-17 16:10:35 +00:00
|
|
|
$offset += 8;
|
|
|
|
}
|
|
|
|
|
|
|
|
return array(
|
|
|
|
'size' => 2 + 8 * $nm,
|
|
|
|
'cellRangeAddresses' => $cellRangeAddresses,
|
|
|
|
);
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read BIFF5 cell range address list
|
|
|
|
* section 2.5.15
|
|
|
|
*
|
|
|
|
* @param string $subData
|
|
|
|
* @return array
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readBIFF5CellRangeAddressList($subData)
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
$cellRangeAddresses = array();
|
|
|
|
|
|
|
|
// offset: 0; size: 2; number of the following cell range addresses
|
2015-05-20 18:17:17 +00:00
|
|
|
$nm = self::getInt2d($subData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
$offset = 2;
|
|
|
|
// offset: 2; size: 6 * $nm; list of $nm (fixed) cell range addresses
|
|
|
|
for ($i = 0; $i < $nm; ++$i) {
|
2015-05-20 18:17:17 +00:00
|
|
|
$cellRangeAddresses[] = $this->readBIFF5CellRangeAddressFixed(substr($subData, $offset, 6));
|
2015-05-17 16:10:35 +00:00
|
|
|
$offset += 6;
|
|
|
|
}
|
|
|
|
|
|
|
|
return array(
|
|
|
|
'size' => 2 + 6 * $nm,
|
|
|
|
'cellRangeAddresses' => $cellRangeAddresses,
|
|
|
|
);
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Get a sheet range like Sheet1:Sheet3 from REF index
|
|
|
|
* Note: If there is only one sheet in the range, one gets e.g Sheet1
|
|
|
|
* It can also happen that the REF structure uses the -1 (FFFF) code to indicate deleted sheets,
|
|
|
|
* in which case an PHPExcel_Reader_Exception is thrown
|
|
|
|
*
|
|
|
|
* @param int $index
|
|
|
|
* @return string|false
|
|
|
|
* @throws PHPExcel_Reader_Exception
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readSheetRangeByRefIndex($index)
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
if (isset($this->ref[$index])) {
|
|
|
|
$type = $this->externalBooks[$this->ref[$index]['externalBookIndex']]['type'];
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
switch ($type) {
|
|
|
|
case 'internal':
|
|
|
|
// check if we have a deleted 3d reference
|
2015-05-20 18:17:17 +00:00
|
|
|
if ($this->ref[$index]['firstSheetIndex'] == 0xFFFF or $this->ref[$index]['lastSheetIndex'] == 0xFFFF) {
|
2015-05-17 16:10:35 +00:00
|
|
|
throw new PHPExcel_Reader_Exception('Deleted sheet reference');
|
|
|
|
}
|
|
|
|
|
|
|
|
// we have normal sheet range (collapsed or uncollapsed)
|
2015-05-20 18:17:17 +00:00
|
|
|
$firstSheetName = $this->sheets[$this->ref[$index]['firstSheetIndex']]['name'];
|
|
|
|
$lastSheetName = $this->sheets[$this->ref[$index]['lastSheetIndex']]['name'];
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
if ($firstSheetName == $lastSheetName) {
|
|
|
|
// collapsed sheet range
|
|
|
|
$sheetRange = $firstSheetName;
|
|
|
|
} else {
|
|
|
|
$sheetRange = "$firstSheetName:$lastSheetName";
|
|
|
|
}
|
|
|
|
|
|
|
|
// escape the single-quotes
|
|
|
|
$sheetRange = str_replace("'", "''", $sheetRange);
|
|
|
|
|
|
|
|
// if there are special characters, we need to enclose the range in single-quotes
|
|
|
|
// todo: check if we have identified the whole set of special characters
|
|
|
|
// it seems that the following characters are not accepted for sheet names
|
|
|
|
// and we may assume that they are not present: []*/:\?
|
|
|
|
if (preg_match("/[ !\"@#£$%&{()}<>=+'|^,;-]/", $sheetRange)) {
|
|
|
|
$sheetRange = "'$sheetRange'";
|
|
|
|
}
|
|
|
|
|
|
|
|
return $sheetRange;
|
|
|
|
break;
|
|
|
|
default:
|
|
|
|
// TODO: external sheet support
|
|
|
|
throw new PHPExcel_Reader_Exception('Excel5 reader only supports internal sheets in fomulas');
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
return false;
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* read BIFF8 constant value array from array data
|
|
|
|
* returns e.g. array('value' => '{1,2;3,4}', 'size' => 40}
|
|
|
|
* section 2.5.8
|
|
|
|
*
|
|
|
|
* @param string $arrayData
|
|
|
|
* @return array
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private static function readBIFF8ConstantArray($arrayData)
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
// offset: 0; size: 1; number of columns decreased by 1
|
|
|
|
$nc = ord($arrayData[0]);
|
|
|
|
|
|
|
|
// offset: 1; size: 2; number of rows decreased by 1
|
2015-05-20 18:17:17 +00:00
|
|
|
$nr = self::getInt2d($arrayData, 1);
|
2015-05-17 16:10:35 +00:00
|
|
|
$size = 3; // initialize
|
|
|
|
$arrayData = substr($arrayData, 3);
|
|
|
|
|
|
|
|
// offset: 3; size: var; list of ($nc + 1) * ($nr + 1) constant values
|
|
|
|
$matrixChunks = array();
|
|
|
|
for ($r = 1; $r <= $nr + 1; ++$r) {
|
|
|
|
$items = array();
|
|
|
|
for ($c = 1; $c <= $nc + 1; ++$c) {
|
|
|
|
$constant = self::_readBIFF8Constant($arrayData);
|
|
|
|
$items[] = $constant['value'];
|
|
|
|
$arrayData = substr($arrayData, $constant['size']);
|
|
|
|
$size += $constant['size'];
|
|
|
|
}
|
|
|
|
$matrixChunks[] = implode(',', $items); // looks like e.g. '1,"hello"'
|
|
|
|
}
|
|
|
|
$matrix = '{' . implode(';', $matrixChunks) . '}';
|
|
|
|
|
|
|
|
return array(
|
|
|
|
'value' => $matrix,
|
|
|
|
'size' => $size,
|
|
|
|
);
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* read BIFF8 constant value which may be 'Empty Value', 'Number', 'String Value', 'Boolean Value', 'Error Value'
|
|
|
|
* section 2.5.7
|
|
|
|
* returns e.g. array('value' => '5', 'size' => 9)
|
|
|
|
*
|
|
|
|
* @param string $valueData
|
|
|
|
* @return array
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private static function readBIFF8Constant($valueData)
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
// offset: 0; size: 1; identifier for type of constant
|
|
|
|
$identifier = ord($valueData[0]);
|
|
|
|
|
|
|
|
switch ($identifier) {
|
|
|
|
case 0x00: // empty constant (what is this?)
|
|
|
|
$value = '';
|
|
|
|
$size = 9;
|
|
|
|
break;
|
|
|
|
case 0x01: // number
|
|
|
|
// offset: 1; size: 8; IEEE 754 floating-point value
|
2015-05-20 18:17:17 +00:00
|
|
|
$value = self::extractNumber(substr($valueData, 1, 8));
|
2015-05-17 16:10:35 +00:00
|
|
|
$size = 9;
|
|
|
|
break;
|
|
|
|
case 0x02: // string value
|
|
|
|
// offset: 1; size: var; Unicode string, 16-bit string length
|
2015-05-20 18:17:17 +00:00
|
|
|
$string = self::readUnicodeStringLong(substr($valueData, 1));
|
2015-05-17 16:10:35 +00:00
|
|
|
$value = '"' . $string['value'] . '"';
|
|
|
|
$size = 1 + $string['size'];
|
|
|
|
break;
|
|
|
|
case 0x04: // boolean
|
|
|
|
// offset: 1; size: 1; 0 = FALSE, 1 = TRUE
|
|
|
|
if (ord($valueData[1])) {
|
|
|
|
$value = 'TRUE';
|
|
|
|
} else {
|
|
|
|
$value = 'FALSE';
|
|
|
|
}
|
|
|
|
$size = 9;
|
|
|
|
break;
|
|
|
|
case 0x10: // error code
|
|
|
|
// offset: 1; size: 1; error code
|
2015-05-20 18:17:17 +00:00
|
|
|
$value = self::mapErrorCode(ord($valueData[1]));
|
2015-05-17 16:10:35 +00:00
|
|
|
$size = 9;
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
return array(
|
|
|
|
'value' => $value,
|
|
|
|
'size' => $size,
|
|
|
|
);
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Extract RGB color
|
|
|
|
* OpenOffice.org's Documentation of the Microsoft Excel File Format, section 2.5.4
|
|
|
|
*
|
|
|
|
* @param string $rgb Encoded RGB value (4 bytes)
|
|
|
|
* @return array
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private static function readRGB($rgb)
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
// offset: 0; size 1; Red component
|
|
|
|
$r = ord($rgb{0});
|
|
|
|
|
|
|
|
// offset: 1; size: 1; Green component
|
|
|
|
$g = ord($rgb{1});
|
|
|
|
|
|
|
|
// offset: 2; size: 1; Blue component
|
|
|
|
$b = ord($rgb{2});
|
|
|
|
|
|
|
|
// HEX notation, e.g. 'FF00FC'
|
|
|
|
$rgb = sprintf('%02X%02X%02X', $r, $g, $b);
|
|
|
|
|
|
|
|
return array('rgb' => $rgb);
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read byte string (8-bit string length)
|
|
|
|
* OpenOffice documentation: 2.5.2
|
|
|
|
*
|
|
|
|
* @param string $subData
|
|
|
|
* @return array
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readByteStringShort($subData)
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
// offset: 0; size: 1; length of the string (character count)
|
|
|
|
$ln = ord($subData[0]);
|
|
|
|
|
|
|
|
// offset: 1: size: var; character array (8-bit characters)
|
2015-05-20 18:17:17 +00:00
|
|
|
$value = $this->decodeCodepage(substr($subData, 1, $ln));
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
return array(
|
|
|
|
'value' => $value,
|
|
|
|
'size' => 1 + $ln, // size in bytes of data structure
|
|
|
|
);
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read byte string (16-bit string length)
|
|
|
|
* OpenOffice documentation: 2.5.2
|
|
|
|
*
|
|
|
|
* @param string $subData
|
|
|
|
* @return array
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function readByteStringLong($subData)
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
// offset: 0; size: 2; length of the string (character count)
|
2015-05-20 18:17:17 +00:00
|
|
|
$ln = self::getInt2d($subData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// offset: 2: size: var; character array (8-bit characters)
|
2015-05-20 18:17:17 +00:00
|
|
|
$value = $this->decodeCodepage(substr($subData, 2));
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
//return $string;
|
|
|
|
return array(
|
|
|
|
'value' => $value,
|
|
|
|
'size' => 2 + $ln, // size in bytes of data structure
|
|
|
|
);
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Extracts an Excel Unicode short string (8-bit string length)
|
|
|
|
* OpenOffice documentation: 2.5.3
|
|
|
|
* function will automatically find out where the Unicode string ends.
|
|
|
|
*
|
|
|
|
* @param string $subData
|
|
|
|
* @return array
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private static function readUnicodeStringShort($subData)
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
$value = '';
|
|
|
|
|
|
|
|
// offset: 0: size: 1; length of the string (character count)
|
|
|
|
$characterCount = ord($subData[0]);
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$string = self::readUnicodeString(substr($subData, 1), $characterCount);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// add 1 for the string length
|
|
|
|
$string['size'] += 1;
|
|
|
|
|
|
|
|
return $string;
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Extracts an Excel Unicode long string (16-bit string length)
|
|
|
|
* OpenOffice documentation: 2.5.3
|
|
|
|
* this function is under construction, needs to support rich text, and Asian phonetic settings
|
|
|
|
*
|
|
|
|
* @param string $subData
|
|
|
|
* @return array
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private static function readUnicodeStringLong($subData)
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
$value = '';
|
|
|
|
|
|
|
|
// offset: 0: size: 2; length of the string (character count)
|
2015-05-20 18:17:17 +00:00
|
|
|
$characterCount = self::getInt2d($subData, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
$string = self::readUnicodeString(substr($subData, 2), $characterCount);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
// add 2 for the string length
|
|
|
|
$string['size'] += 2;
|
|
|
|
|
|
|
|
return $string;
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read Unicode string with no string length field, but with known character count
|
|
|
|
* this function is under construction, needs to support rich text, and Asian phonetic settings
|
|
|
|
* OpenOffice.org's Documentation of the Microsoft Excel File Format, section 2.5.3
|
|
|
|
*
|
|
|
|
* @param string $subData
|
|
|
|
* @param int $characterCount
|
|
|
|
* @return array
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private static function readUnicodeString($subData, $characterCount)
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
$value = '';
|
|
|
|
|
|
|
|
// offset: 0: size: 1; option flags
|
|
|
|
// bit: 0; mask: 0x01; character compression (0 = compressed 8-bit, 1 = uncompressed 16-bit)
|
|
|
|
$isCompressed = !((0x01 & ord($subData[0])) >> 0);
|
|
|
|
|
|
|
|
// bit: 2; mask: 0x04; Asian phonetic settings
|
|
|
|
$hasAsian = (0x04) & ord($subData[0]) >> 2;
|
|
|
|
|
|
|
|
// bit: 3; mask: 0x08; Rich-Text settings
|
|
|
|
$hasRichText = (0x08) & ord($subData[0]) >> 3;
|
|
|
|
|
|
|
|
// offset: 1: size: var; character array
|
|
|
|
// this offset assumes richtext and Asian phonetic settings are off which is generally wrong
|
|
|
|
// needs to be fixed
|
2015-05-20 18:17:17 +00:00
|
|
|
$value = self::encodeUTF16(substr($subData, 1, $isCompressed ? $characterCount : 2 * $characterCount), $isCompressed);
|
2015-05-17 16:10:35 +00:00
|
|
|
|
|
|
|
return array(
|
|
|
|
'value' => $value,
|
|
|
|
'size' => $isCompressed ? 1 + $characterCount : 1 + 2 * $characterCount, // the size in bytes including the option flags
|
|
|
|
);
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Convert UTF-8 string to string surounded by double quotes. Used for explicit string tokens in formulas.
|
|
|
|
* Example: hello"world --> "hello""world"
|
|
|
|
*
|
|
|
|
* @param string $value UTF-8 encoded string
|
|
|
|
* @return string
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private static function UTF8toExcelDoubleQuoted($value)
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
return '"' . str_replace('"', '""', $value) . '"';
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Reads first 8 bytes of a string and return IEEE 754 float
|
|
|
|
*
|
|
|
|
* @param string $data Binary string that is at least 8 bytes long
|
|
|
|
* @return float
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private static function extractNumber($data)
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
$rknumhigh = self::getInt4d($data, 4);
|
|
|
|
$rknumlow = self::getInt4d($data, 0);
|
2015-05-17 16:10:35 +00:00
|
|
|
$sign = ($rknumhigh & 0x80000000) >> 31;
|
|
|
|
$exp = (($rknumhigh & 0x7ff00000) >> 20) - 1023;
|
|
|
|
$mantissa = (0x100000 | ($rknumhigh & 0x000fffff));
|
|
|
|
$mantissalow1 = ($rknumlow & 0x80000000) >> 31;
|
|
|
|
$mantissalow2 = ($rknumlow & 0x7fffffff);
|
|
|
|
$value = $mantissa / pow(2, (20 - $exp));
|
|
|
|
|
|
|
|
if ($mantissalow1 != 0) {
|
|
|
|
$value += 1 / pow(2, (21 - $exp));
|
|
|
|
}
|
|
|
|
|
|
|
|
$value += $mantissalow2 / pow(2, (52 - $exp));
|
|
|
|
if ($sign) {
|
|
|
|
$value *= -1;
|
|
|
|
}
|
|
|
|
|
|
|
|
return $value;
|
|
|
|
}
|
|
|
|
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
private static function getIEEE754($rknum)
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
if (($rknum & 0x02) != 0) {
|
|
|
|
$value = $rknum >> 2;
|
|
|
|
} else {
|
|
|
|
// changes by mmp, info on IEEE754 encoding from
|
|
|
|
// research.microsoft.com/~hollasch/cgindex/coding/ieeefloat.html
|
|
|
|
// The RK format calls for using only the most significant 30 bits
|
|
|
|
// of the 64 bit floating point value. The other 34 bits are assumed
|
|
|
|
// to be 0 so we use the upper 30 bits of $rknum as follows...
|
|
|
|
$sign = ($rknum & 0x80000000) >> 31;
|
|
|
|
$exp = ($rknum & 0x7ff00000) >> 20;
|
|
|
|
$mantissa = (0x100000 | ($rknum & 0x000ffffc));
|
|
|
|
$value = $mantissa / pow(2, (20- ($exp - 1023)));
|
|
|
|
if ($sign) {
|
|
|
|
$value = -1 * $value;
|
|
|
|
}
|
|
|
|
//end of changes by mmp
|
|
|
|
}
|
|
|
|
if (($rknum & 0x01) != 0) {
|
|
|
|
$value /= 100;
|
|
|
|
}
|
|
|
|
return $value;
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Get UTF-8 string from (compressed or uncompressed) UTF-16 string
|
|
|
|
*
|
|
|
|
* @param string $string
|
|
|
|
* @param bool $compressed
|
|
|
|
* @return string
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private static function encodeUTF16($string, $compressed = '')
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
if ($compressed) {
|
2015-05-20 18:17:17 +00:00
|
|
|
$string = self::uncompressByteString($string);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
return PHPExcel_Shared_String::ConvertEncoding($string, 'UTF-8', 'UTF-16LE');
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Convert UTF-16 string in compressed notation to uncompressed form. Only used for BIFF8.
|
|
|
|
*
|
|
|
|
* @param string $string
|
|
|
|
* @return string
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private static function uncompressByteString($string)
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
$uncompressedString = '';
|
|
|
|
$strLen = strlen($string);
|
|
|
|
for ($i = 0; $i < $strLen; ++$i) {
|
|
|
|
$uncompressedString .= $string[$i] . "\0";
|
|
|
|
}
|
|
|
|
|
|
|
|
return $uncompressedString;
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Convert string to UTF-8. Only used for BIFF5.
|
|
|
|
*
|
|
|
|
* @param string $string
|
|
|
|
* @return string
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private function decodeCodepage($string)
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
2015-05-20 18:17:17 +00:00
|
|
|
return PHPExcel_Shared_String::ConvertEncoding($string, 'UTF-8', $this->codepage);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read 16-bit unsigned integer
|
|
|
|
*
|
|
|
|
* @param string $data
|
|
|
|
* @param int $pos
|
|
|
|
* @return int
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
public static function getInt2d($data, $pos)
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
return ord($data[$pos]) | (ord($data[$pos+1]) << 8);
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read 32-bit signed integer
|
|
|
|
*
|
|
|
|
* @param string $data
|
|
|
|
* @param int $pos
|
|
|
|
* @return int
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
public static function getInt4d($data, $pos)
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
// FIX: represent numbers correctly on 64-bit system
|
|
|
|
// http://sourceforge.net/tracker/index.php?func=detail&aid=1487372&group_id=99160&atid=623334
|
|
|
|
// Hacked by Andreas Rehm 2006 to ensure correct result of the <<24 block on 32 and 64bit systems
|
|
|
|
$_or_24 = ord($data[$pos + 3]);
|
|
|
|
if ($_or_24 >= 128) {
|
|
|
|
// negative number
|
|
|
|
$_ord_24 = -abs((256 - $_or_24) << 24);
|
|
|
|
} else {
|
|
|
|
$_ord_24 = ($_or_24 & 127) << 24;
|
|
|
|
}
|
|
|
|
return ord($data[$pos]) | (ord($data[$pos+1]) << 8) | (ord($data[$pos+2]) << 16) | $_ord_24;
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Read color
|
|
|
|
*
|
|
|
|
* @param int $color Indexed color
|
|
|
|
* @param array $palette Color palette
|
|
|
|
* @return array RGB color value, example: array('rgb' => 'FF0000')
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private static function readColor($color, $palette, $version)
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
if ($color <= 0x07 || $color >= 0x40) {
|
|
|
|
// special built-in color
|
2015-05-20 18:17:17 +00:00
|
|
|
return self::mapBuiltInColor($color);
|
2015-05-17 16:10:35 +00:00
|
|
|
} elseif (isset($palette) && isset($palette[$color - 8])) {
|
|
|
|
// palette color, color index 0x08 maps to pallete index 0
|
|
|
|
return $palette[$color - 8];
|
|
|
|
} else {
|
|
|
|
// default color table
|
|
|
|
if ($version == self::XLS_BIFF8) {
|
2015-05-20 18:17:17 +00:00
|
|
|
return self::mapColor($color);
|
2015-05-17 16:10:35 +00:00
|
|
|
} else {
|
|
|
|
// BIFF5
|
2015-05-20 18:17:17 +00:00
|
|
|
return self::mapColorBIFF5($color);
|
2015-05-17 16:10:35 +00:00
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
return $color;
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Map border style
|
|
|
|
* OpenOffice documentation: 2.5.11
|
|
|
|
*
|
|
|
|
* @param int $index
|
|
|
|
* @return string
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private static function mapBorderStyle($index)
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
switch ($index) {
|
|
|
|
case 0x00:
|
|
|
|
return PHPExcel_Style_Border::BORDER_NONE;
|
|
|
|
case 0x01:
|
|
|
|
return PHPExcel_Style_Border::BORDER_THIN;
|
|
|
|
case 0x02:
|
|
|
|
return PHPExcel_Style_Border::BORDER_MEDIUM;
|
|
|
|
case 0x03:
|
|
|
|
return PHPExcel_Style_Border::BORDER_DASHED;
|
|
|
|
case 0x04:
|
|
|
|
return PHPExcel_Style_Border::BORDER_DOTTED;
|
|
|
|
case 0x05:
|
|
|
|
return PHPExcel_Style_Border::BORDER_THICK;
|
|
|
|
case 0x06:
|
|
|
|
return PHPExcel_Style_Border::BORDER_DOUBLE;
|
|
|
|
case 0x07:
|
|
|
|
return PHPExcel_Style_Border::BORDER_HAIR;
|
|
|
|
case 0x08:
|
|
|
|
return PHPExcel_Style_Border::BORDER_MEDIUMDASHED;
|
|
|
|
case 0x09:
|
|
|
|
return PHPExcel_Style_Border::BORDER_DASHDOT;
|
|
|
|
case 0x0A:
|
|
|
|
return PHPExcel_Style_Border::BORDER_MEDIUMDASHDOT;
|
|
|
|
case 0x0B:
|
|
|
|
return PHPExcel_Style_Border::BORDER_DASHDOTDOT;
|
|
|
|
case 0x0C:
|
|
|
|
return PHPExcel_Style_Border::BORDER_MEDIUMDASHDOTDOT;
|
|
|
|
case 0x0D:
|
|
|
|
return PHPExcel_Style_Border::BORDER_SLANTDASHDOT;
|
|
|
|
default:
|
|
|
|
return PHPExcel_Style_Border::BORDER_NONE;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Get fill pattern from index
|
|
|
|
* OpenOffice documentation: 2.5.12
|
|
|
|
*
|
|
|
|
* @param int $index
|
|
|
|
* @return string
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private static function mapFillPattern($index)
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
switch ($index) {
|
|
|
|
case 0x00:
|
|
|
|
return PHPExcel_Style_Fill::FILL_NONE;
|
|
|
|
case 0x01:
|
|
|
|
return PHPExcel_Style_Fill::FILL_SOLID;
|
|
|
|
case 0x02:
|
|
|
|
return PHPExcel_Style_Fill::FILL_PATTERN_MEDIUMGRAY;
|
|
|
|
case 0x03:
|
|
|
|
return PHPExcel_Style_Fill::FILL_PATTERN_DARKGRAY;
|
|
|
|
case 0x04:
|
|
|
|
return PHPExcel_Style_Fill::FILL_PATTERN_LIGHTGRAY;
|
|
|
|
case 0x05:
|
|
|
|
return PHPExcel_Style_Fill::FILL_PATTERN_DARKHORIZONTAL;
|
|
|
|
case 0x06:
|
|
|
|
return PHPExcel_Style_Fill::FILL_PATTERN_DARKVERTICAL;
|
|
|
|
case 0x07:
|
|
|
|
return PHPExcel_Style_Fill::FILL_PATTERN_DARKDOWN;
|
|
|
|
case 0x08:
|
|
|
|
return PHPExcel_Style_Fill::FILL_PATTERN_DARKUP;
|
|
|
|
case 0x09:
|
|
|
|
return PHPExcel_Style_Fill::FILL_PATTERN_DARKGRID;
|
|
|
|
case 0x0A:
|
|
|
|
return PHPExcel_Style_Fill::FILL_PATTERN_DARKTRELLIS;
|
|
|
|
case 0x0B:
|
|
|
|
return PHPExcel_Style_Fill::FILL_PATTERN_LIGHTHORIZONTAL;
|
|
|
|
case 0x0C:
|
|
|
|
return PHPExcel_Style_Fill::FILL_PATTERN_LIGHTVERTICAL;
|
|
|
|
case 0x0D:
|
|
|
|
return PHPExcel_Style_Fill::FILL_PATTERN_LIGHTDOWN;
|
|
|
|
case 0x0E:
|
|
|
|
return PHPExcel_Style_Fill::FILL_PATTERN_LIGHTUP;
|
|
|
|
case 0x0F:
|
|
|
|
return PHPExcel_Style_Fill::FILL_PATTERN_LIGHTGRID;
|
|
|
|
case 0x10:
|
|
|
|
return PHPExcel_Style_Fill::FILL_PATTERN_LIGHTTRELLIS;
|
|
|
|
case 0x11:
|
|
|
|
return PHPExcel_Style_Fill::FILL_PATTERN_GRAY125;
|
|
|
|
case 0x12:
|
|
|
|
return PHPExcel_Style_Fill::FILL_PATTERN_GRAY0625;
|
|
|
|
default:
|
|
|
|
return PHPExcel_Style_Fill::FILL_NONE;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Map error code, e.g. '#N/A'
|
|
|
|
*
|
|
|
|
* @param int $subData
|
|
|
|
* @return string
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private static function mapErrorCode($subData)
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
switch ($subData) {
|
|
|
|
case 0x00:
|
|
|
|
return '#NULL!';
|
|
|
|
break;
|
|
|
|
case 0x07:
|
|
|
|
return '#DIV/0!';
|
|
|
|
break;
|
|
|
|
case 0x0F:
|
|
|
|
return '#VALUE!';
|
|
|
|
break;
|
|
|
|
case 0x17:
|
|
|
|
return '#REF!';
|
|
|
|
break;
|
|
|
|
case 0x1D:
|
|
|
|
return '#NAME?';
|
|
|
|
break;
|
|
|
|
case 0x24:
|
|
|
|
return '#NUM!';
|
|
|
|
break;
|
|
|
|
case 0x2A:
|
|
|
|
return '#N/A';
|
|
|
|
break;
|
|
|
|
default:
|
|
|
|
return false;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Map built-in color to RGB value
|
|
|
|
*
|
|
|
|
* @param int $color Indexed color
|
|
|
|
* @return array
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private static function mapBuiltInColor($color)
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
switch ($color) {
|
|
|
|
case 0x00:
|
|
|
|
return array('rgb' => '000000');
|
|
|
|
case 0x01:
|
|
|
|
return array('rgb' => 'FFFFFF');
|
|
|
|
case 0x02:
|
|
|
|
return array('rgb' => 'FF0000');
|
|
|
|
case 0x03:
|
|
|
|
return array('rgb' => '00FF00');
|
|
|
|
case 0x04:
|
|
|
|
return array('rgb' => '0000FF');
|
|
|
|
case 0x05:
|
|
|
|
return array('rgb' => 'FFFF00');
|
|
|
|
case 0x06:
|
|
|
|
return array('rgb' => 'FF00FF');
|
|
|
|
case 0x07:
|
|
|
|
return array('rgb' => '00FFFF');
|
|
|
|
case 0x40:
|
|
|
|
return array('rgb' => '000000'); // system window text color
|
|
|
|
case 0x41:
|
|
|
|
return array('rgb' => 'FFFFFF'); // system window background color
|
|
|
|
default:
|
|
|
|
return array('rgb' => '000000');
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Map color array from BIFF5 built-in color index
|
|
|
|
*
|
|
|
|
* @param int $subData
|
|
|
|
* @return array
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private static function mapColorBIFF5($subData)
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
switch ($subData) {
|
|
|
|
case 0x08:
|
|
|
|
return array('rgb' => '000000');
|
|
|
|
case 0x09:
|
|
|
|
return array('rgb' => 'FFFFFF');
|
|
|
|
case 0x0A:
|
|
|
|
return array('rgb' => 'FF0000');
|
|
|
|
case 0x0B:
|
|
|
|
return array('rgb' => '00FF00');
|
|
|
|
case 0x0C:
|
|
|
|
return array('rgb' => '0000FF');
|
|
|
|
case 0x0D:
|
|
|
|
return array('rgb' => 'FFFF00');
|
|
|
|
case 0x0E:
|
|
|
|
return array('rgb' => 'FF00FF');
|
|
|
|
case 0x0F:
|
|
|
|
return array('rgb' => '00FFFF');
|
|
|
|
case 0x10:
|
|
|
|
return array('rgb' => '800000');
|
|
|
|
case 0x11:
|
|
|
|
return array('rgb' => '008000');
|
|
|
|
case 0x12:
|
|
|
|
return array('rgb' => '000080');
|
|
|
|
case 0x13:
|
|
|
|
return array('rgb' => '808000');
|
|
|
|
case 0x14:
|
|
|
|
return array('rgb' => '800080');
|
|
|
|
case 0x15:
|
|
|
|
return array('rgb' => '008080');
|
|
|
|
case 0x16:
|
|
|
|
return array('rgb' => 'C0C0C0');
|
|
|
|
case 0x17:
|
|
|
|
return array('rgb' => '808080');
|
|
|
|
case 0x18:
|
|
|
|
return array('rgb' => '8080FF');
|
|
|
|
case 0x19:
|
|
|
|
return array('rgb' => '802060');
|
|
|
|
case 0x1A:
|
|
|
|
return array('rgb' => 'FFFFC0');
|
|
|
|
case 0x1B:
|
|
|
|
return array('rgb' => 'A0E0F0');
|
|
|
|
case 0x1C:
|
|
|
|
return array('rgb' => '600080');
|
|
|
|
case 0x1D:
|
|
|
|
return array('rgb' => 'FF8080');
|
|
|
|
case 0x1E:
|
|
|
|
return array('rgb' => '0080C0');
|
|
|
|
case 0x1F:
|
|
|
|
return array('rgb' => 'C0C0FF');
|
|
|
|
case 0x20:
|
|
|
|
return array('rgb' => '000080');
|
|
|
|
case 0x21:
|
|
|
|
return array('rgb' => 'FF00FF');
|
|
|
|
case 0x22:
|
|
|
|
return array('rgb' => 'FFFF00');
|
|
|
|
case 0x23:
|
|
|
|
return array('rgb' => '00FFFF');
|
|
|
|
case 0x24:
|
|
|
|
return array('rgb' => '800080');
|
|
|
|
case 0x25:
|
|
|
|
return array('rgb' => '800000');
|
|
|
|
case 0x26:
|
|
|
|
return array('rgb' => '008080');
|
|
|
|
case 0x27:
|
|
|
|
return array('rgb' => '0000FF');
|
|
|
|
case 0x28:
|
|
|
|
return array('rgb' => '00CFFF');
|
|
|
|
case 0x29:
|
|
|
|
return array('rgb' => '69FFFF');
|
|
|
|
case 0x2A:
|
|
|
|
return array('rgb' => 'E0FFE0');
|
|
|
|
case 0x2B:
|
|
|
|
return array('rgb' => 'FFFF80');
|
|
|
|
case 0x2C:
|
|
|
|
return array('rgb' => 'A6CAF0');
|
|
|
|
case 0x2D:
|
|
|
|
return array('rgb' => 'DD9CB3');
|
|
|
|
case 0x2E:
|
|
|
|
return array('rgb' => 'B38FEE');
|
|
|
|
case 0x2F:
|
|
|
|
return array('rgb' => 'E3E3E3');
|
|
|
|
case 0x30:
|
|
|
|
return array('rgb' => '2A6FF9');
|
|
|
|
case 0x31:
|
|
|
|
return array('rgb' => '3FB8CD');
|
|
|
|
case 0x32:
|
|
|
|
return array('rgb' => '488436');
|
|
|
|
case 0x33:
|
|
|
|
return array('rgb' => '958C41');
|
|
|
|
case 0x34:
|
|
|
|
return array('rgb' => '8E5E42');
|
|
|
|
case 0x35:
|
|
|
|
return array('rgb' => 'A0627A');
|
|
|
|
case 0x36:
|
|
|
|
return array('rgb' => '624FAC');
|
|
|
|
case 0x37:
|
|
|
|
return array('rgb' => '969696');
|
|
|
|
case 0x38:
|
|
|
|
return array('rgb' => '1D2FBE');
|
|
|
|
case 0x39:
|
|
|
|
return array('rgb' => '286676');
|
|
|
|
case 0x3A:
|
|
|
|
return array('rgb' => '004500');
|
|
|
|
case 0x3B:
|
|
|
|
return array('rgb' => '453E01');
|
|
|
|
case 0x3C:
|
|
|
|
return array('rgb' => '6A2813');
|
|
|
|
case 0x3D:
|
|
|
|
return array('rgb' => '85396A');
|
|
|
|
case 0x3E:
|
|
|
|
return array('rgb' => '4A3285');
|
|
|
|
case 0x3F:
|
|
|
|
return array('rgb' => '424242');
|
|
|
|
default:
|
|
|
|
return array('rgb' => '000000');
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Map color array from BIFF8 built-in color index
|
|
|
|
*
|
|
|
|
* @param int $subData
|
|
|
|
* @return array
|
|
|
|
*/
|
2015-05-20 18:17:17 +00:00
|
|
|
private static function mapColor($subData)
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
switch ($subData) {
|
|
|
|
case 0x08:
|
|
|
|
return array('rgb' => '000000');
|
|
|
|
case 0x09:
|
|
|
|
return array('rgb' => 'FFFFFF');
|
|
|
|
case 0x0A:
|
|
|
|
return array('rgb' => 'FF0000');
|
|
|
|
case 0x0B:
|
|
|
|
return array('rgb' => '00FF00');
|
|
|
|
case 0x0C:
|
|
|
|
return array('rgb' => '0000FF');
|
|
|
|
case 0x0D:
|
|
|
|
return array('rgb' => 'FFFF00');
|
|
|
|
case 0x0E:
|
|
|
|
return array('rgb' => 'FF00FF');
|
|
|
|
case 0x0F:
|
|
|
|
return array('rgb' => '00FFFF');
|
|
|
|
case 0x10:
|
|
|
|
return array('rgb' => '800000');
|
|
|
|
case 0x11:
|
|
|
|
return array('rgb' => '008000');
|
|
|
|
case 0x12:
|
|
|
|
return array('rgb' => '000080');
|
|
|
|
case 0x13:
|
|
|
|
return array('rgb' => '808000');
|
|
|
|
case 0x14:
|
|
|
|
return array('rgb' => '800080');
|
|
|
|
case 0x15:
|
|
|
|
return array('rgb' => '008080');
|
|
|
|
case 0x16:
|
|
|
|
return array('rgb' => 'C0C0C0');
|
|
|
|
case 0x17:
|
|
|
|
return array('rgb' => '808080');
|
|
|
|
case 0x18:
|
|
|
|
return array('rgb' => '9999FF');
|
|
|
|
case 0x19:
|
|
|
|
return array('rgb' => '993366');
|
|
|
|
case 0x1A:
|
|
|
|
return array('rgb' => 'FFFFCC');
|
|
|
|
case 0x1B:
|
|
|
|
return array('rgb' => 'CCFFFF');
|
|
|
|
case 0x1C:
|
|
|
|
return array('rgb' => '660066');
|
|
|
|
case 0x1D:
|
|
|
|
return array('rgb' => 'FF8080');
|
|
|
|
case 0x1E:
|
|
|
|
return array('rgb' => '0066CC');
|
|
|
|
case 0x1F:
|
|
|
|
return array('rgb' => 'CCCCFF');
|
|
|
|
case 0x20:
|
|
|
|
return array('rgb' => '000080');
|
|
|
|
case 0x21:
|
|
|
|
return array('rgb' => 'FF00FF');
|
|
|
|
case 0x22:
|
|
|
|
return array('rgb' => 'FFFF00');
|
|
|
|
case 0x23:
|
|
|
|
return array('rgb' => '00FFFF');
|
|
|
|
case 0x24:
|
|
|
|
return array('rgb' => '800080');
|
|
|
|
case 0x25:
|
|
|
|
return array('rgb' => '800000');
|
|
|
|
case 0x26:
|
|
|
|
return array('rgb' => '008080');
|
|
|
|
case 0x27:
|
|
|
|
return array('rgb' => '0000FF');
|
|
|
|
case 0x28:
|
|
|
|
return array('rgb' => '00CCFF');
|
|
|
|
case 0x29:
|
|
|
|
return array('rgb' => 'CCFFFF');
|
|
|
|
case 0x2A:
|
|
|
|
return array('rgb' => 'CCFFCC');
|
|
|
|
case 0x2B:
|
|
|
|
return array('rgb' => 'FFFF99');
|
|
|
|
case 0x2C:
|
|
|
|
return array('rgb' => '99CCFF');
|
|
|
|
case 0x2D:
|
|
|
|
return array('rgb' => 'FF99CC');
|
|
|
|
case 0x2E:
|
|
|
|
return array('rgb' => 'CC99FF');
|
|
|
|
case 0x2F:
|
|
|
|
return array('rgb' => 'FFCC99');
|
|
|
|
case 0x30:
|
|
|
|
return array('rgb' => '3366FF');
|
|
|
|
case 0x31:
|
|
|
|
return array('rgb' => '33CCCC');
|
|
|
|
case 0x32:
|
|
|
|
return array('rgb' => '99CC00');
|
|
|
|
case 0x33:
|
|
|
|
return array('rgb' => 'FFCC00');
|
|
|
|
case 0x34:
|
|
|
|
return array('rgb' => 'FF9900');
|
|
|
|
case 0x35:
|
|
|
|
return array('rgb' => 'FF6600');
|
|
|
|
case 0x36:
|
|
|
|
return array('rgb' => '666699');
|
|
|
|
case 0x37:
|
|
|
|
return array('rgb' => '969696');
|
|
|
|
case 0x38:
|
|
|
|
return array('rgb' => '003366');
|
|
|
|
case 0x39:
|
|
|
|
return array('rgb' => '339966');
|
|
|
|
case 0x3A:
|
|
|
|
return array('rgb' => '003300');
|
|
|
|
case 0x3B:
|
|
|
|
return array('rgb' => '333300');
|
|
|
|
case 0x3C:
|
|
|
|
return array('rgb' => '993300');
|
|
|
|
case 0x3D:
|
|
|
|
return array('rgb' => '993366');
|
|
|
|
case 0x3E:
|
|
|
|
return array('rgb' => '333399');
|
|
|
|
case 0x3F:
|
|
|
|
return array('rgb' => '333333');
|
|
|
|
default:
|
|
|
|
return array('rgb' => '000000');
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2015-05-20 18:17:17 +00:00
|
|
|
private function parseRichText($is = '')
|
2015-05-17 16:10:35 +00:00
|
|
|
{
|
|
|
|
$value = new PHPExcel_RichText();
|
|
|
|
$value->createText($is);
|
|
|
|
|
|
|
|
return $value;
|
|
|
|
}
|
|
|
|
}
|